mirror of
https://github.com/K-Dense-AI/claude-scientific-skills.git
synced 2026-03-29 07:43:46 +08:00
Improved Biomni support
This commit is contained in:
@@ -7,7 +7,7 @@
|
|||||||
},
|
},
|
||||||
"metadata": {
|
"metadata": {
|
||||||
"description": "Claude scientific skills from K-Dense Inc",
|
"description": "Claude scientific skills from K-Dense Inc",
|
||||||
"version": "1.50.0"
|
"version": "1.51.0"
|
||||||
},
|
},
|
||||||
"plugins": [
|
"plugins": [
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -56,7 +56,7 @@
|
|||||||
- **scikit-bio** - Bioinformatics sequence analysis and diversity metrics
|
- **scikit-bio** - Bioinformatics sequence analysis and diversity metrics
|
||||||
- **Zarr** - Chunked, compressed N-dimensional array storage
|
- **Zarr** - Chunked, compressed N-dimensional array storage
|
||||||
|
|
||||||
## Multi-omics & Integration
|
## Multi-omics & AI Agent Frameworks
|
||||||
- **BIOMNI** - Multi-omics data integration with LLM-powered analysis
|
- **BIOMNI** - Autonomous biomedical AI agent framework from Stanford SNAP lab for executing complex research tasks across genomics, drug discovery, molecular biology, and clinical analysis. Combines LLM reasoning with code execution and ~11GB of integrated biomedical databases (Ensembl, NCBI Gene, UniProt, PDB, AlphaFold, ClinVar, OMIM, HPO, PubMed, KEGG, Reactome, GO). Supports multiple LLM providers (Claude, GPT-4, Gemini, Groq, Bedrock). Includes A1 agent class for autonomous task decomposition, BiomniEval1 benchmark framework, and MCP server integration. Use cases: CRISPR screening design, single-cell RNA-seq analysis, ADMET prediction, GWAS interpretation, rare disease diagnosis, protein structure analysis, literature synthesis, and multi-omics integration
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
@@ -1,375 +1,316 @@
|
|||||||
---
|
---
|
||||||
name: biomni
|
name: biomni
|
||||||
description: "AI agent for autonomous biomedical task execution. CRISPR design, scRNA-seq, ADMET, GWAS, structure prediction, multi-omics, with automated planning/code generation, for complex workflows."
|
description: Autonomous biomedical AI agent framework for executing complex research tasks across genomics, drug discovery, molecular biology, and clinical analysis. Use this skill when conducting multi-step biomedical research including CRISPR screening design, single-cell RNA-seq analysis, ADMET prediction, GWAS interpretation, rare disease diagnosis, or lab protocol optimization. Leverages LLM reasoning with code execution and integrated biomedical databases.
|
||||||
---
|
---
|
||||||
|
|
||||||
# Biomni
|
# Biomni
|
||||||
|
|
||||||
## Overview
|
## Overview
|
||||||
|
|
||||||
Biomni is a general-purpose biomedical AI agent that autonomously executes research tasks across diverse biomedical subfields. Use Biomni to combine large language model reasoning with retrieval-augmented planning and code-based execution for scientific productivity and hypothesis generation. The system operates with an ~11GB biomedical knowledge base covering molecular, genomic, and clinical domains.
|
Biomni is an open-source biomedical AI agent framework from Stanford's SNAP lab that autonomously executes complex research tasks across biomedical domains. Use this skill when working on multi-step biological reasoning tasks, analyzing biomedical data, or conducting research spanning genomics, drug discovery, molecular biology, and clinical analysis.
|
||||||
|
|
||||||
|
## Core Capabilities
|
||||||
|
|
||||||
|
Biomni excels at:
|
||||||
|
|
||||||
|
1. **Multi-step biological reasoning** - Autonomous task decomposition and planning for complex biomedical queries
|
||||||
|
2. **Code generation and execution** - Dynamic analysis pipeline creation for data processing
|
||||||
|
3. **Knowledge retrieval** - Access to ~11GB of integrated biomedical databases and literature
|
||||||
|
4. **Cross-domain problem solving** - Unified interface for genomics, proteomics, drug discovery, and clinical tasks
|
||||||
|
|
||||||
|
## When to Use This Skill
|
||||||
|
|
||||||
|
Use biomni for:
|
||||||
|
- **CRISPR screening** - Design screens, prioritize genes, analyze knockout effects
|
||||||
|
- **Single-cell RNA-seq** - Cell type annotation, differential expression, trajectory analysis
|
||||||
|
- **Drug discovery** - ADMET prediction, target identification, compound optimization
|
||||||
|
- **GWAS analysis** - Variant interpretation, causal gene identification, pathway enrichment
|
||||||
|
- **Clinical genomics** - Rare disease diagnosis, variant pathogenicity, phenotype-genotype mapping
|
||||||
|
- **Lab protocols** - Protocol optimization, literature synthesis, experimental design
|
||||||
|
|
||||||
## Quick Start
|
## Quick Start
|
||||||
|
|
||||||
Initialize and use the Biomni agent with these basic steps:
|
### Installation and Setup
|
||||||
|
|
||||||
|
Biomni requires conda environment setup and API keys for LLM providers:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
# Clone repository and set up environment
|
||||||
|
git clone https://github.com/snap-stanford/biomni
|
||||||
|
cd biomni
|
||||||
|
bash setup.sh
|
||||||
|
|
||||||
|
# Or install via pip
|
||||||
|
conda activate biomni_e1
|
||||||
|
pip install biomni --upgrade
|
||||||
|
```
|
||||||
|
|
||||||
|
Configure API keys (store in `.env` file or environment variables):
|
||||||
|
```bash
|
||||||
|
export ANTHROPIC_API_KEY="your-key-here"
|
||||||
|
# Optional: OpenAI, Azure, Google, Groq, AWS Bedrock keys
|
||||||
|
```
|
||||||
|
|
||||||
|
Use `scripts/setup_environment.py` for interactive setup assistance.
|
||||||
|
|
||||||
|
### Basic Usage Pattern
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.agent import A1
|
from biomni.agent import A1
|
||||||
|
|
||||||
# Initialize agent with data path and LLM model
|
# Initialize agent with data path and LLM choice
|
||||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
# Execute a biomedical research task
|
# Execute biomedical task autonomously
|
||||||
agent.go("Your biomedical task description")
|
agent.go("Your biomedical research question or task")
|
||||||
|
|
||||||
|
# Save conversation history and results
|
||||||
|
agent.save_conversation_history("report.pdf")
|
||||||
```
|
```
|
||||||
|
|
||||||
The agent will autonomously decompose the task, retrieve relevant biomedical knowledge, generate and execute code, and provide results.
|
## Working with Biomni
|
||||||
|
|
||||||
## Installation and Setup
|
### 1. Agent Initialization
|
||||||
|
|
||||||
### Environment Preparation
|
The A1 class is the primary interface for biomni:
|
||||||
|
|
||||||
1. **Set up the conda environment:**
|
|
||||||
- Follow instructions in `biomni_env/README.md` from the repository
|
|
||||||
- Activate the environment: `conda activate biomni_e1`
|
|
||||||
|
|
||||||
2. **Install the package:**
|
|
||||||
```bash
|
|
||||||
pip install biomni --upgrade
|
|
||||||
```
|
|
||||||
|
|
||||||
Or install from source:
|
|
||||||
```bash
|
|
||||||
git clone https://github.com/snap-stanford/biomni.git
|
|
||||||
cd biomni
|
|
||||||
pip install -e .
|
|
||||||
```
|
|
||||||
|
|
||||||
3. **Configure API keys:**
|
|
||||||
|
|
||||||
Set up credentials via environment variables or `.env` file:
|
|
||||||
```bash
|
|
||||||
export ANTHROPIC_API_KEY="your-key-here"
|
|
||||||
export OPENAI_API_KEY="your-key-here" # Optional
|
|
||||||
```
|
|
||||||
|
|
||||||
4. **Data initialization:**
|
|
||||||
|
|
||||||
On first use, the agent will automatically download the ~11GB biomedical knowledge base.
|
|
||||||
|
|
||||||
### LLM Provider Configuration
|
|
||||||
|
|
||||||
Biomni supports multiple LLM providers. Configure the default provider using:
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
|
from biomni.agent import A1
|
||||||
from biomni.config import default_config
|
from biomni.config import default_config
|
||||||
|
|
||||||
# Set the default LLM model
|
# Basic initialization
|
||||||
default_config.llm = "claude-sonnet-4-20250514" # Anthropic
|
|
||||||
# default_config.llm = "gpt-4" # OpenAI
|
|
||||||
# default_config.llm = "azure/gpt-4" # Azure OpenAI
|
|
||||||
# default_config.llm = "gemini/gemini-pro" # Google Gemini
|
|
||||||
|
|
||||||
# Set timeout (optional)
|
|
||||||
default_config.timeout_seconds = 1200
|
|
||||||
|
|
||||||
# Set data path (optional)
|
|
||||||
default_config.data_path = "./custom/data/path"
|
|
||||||
```
|
|
||||||
|
|
||||||
Refer to `references/llm_providers.md` for detailed configuration options for each provider.
|
|
||||||
|
|
||||||
## Core Biomedical Research Tasks
|
|
||||||
|
|
||||||
### 1. CRISPR Screening and Design
|
|
||||||
|
|
||||||
Execute CRISPR screening tasks including guide RNA design, off-target analysis, and screening experiment planning:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent.go("Design a CRISPR screening experiment to identify genes involved in cancer cell resistance to drug X")
|
|
||||||
```
|
|
||||||
|
|
||||||
The agent will:
|
|
||||||
- Retrieve relevant gene databases
|
|
||||||
- Design guide RNAs with specificity analysis
|
|
||||||
- Plan experimental controls and readout strategies
|
|
||||||
- Generate analysis code for screening results
|
|
||||||
|
|
||||||
### 2. Single-Cell RNA-seq Analysis
|
|
||||||
|
|
||||||
Perform comprehensive scRNA-seq analysis workflows:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent.go("Analyze this 10X Genomics scRNA-seq dataset, identify cell types, and find differentially expressed genes between clusters")
|
|
||||||
```
|
|
||||||
|
|
||||||
Capabilities include:
|
|
||||||
- Quality control and preprocessing
|
|
||||||
- Dimensionality reduction and clustering
|
|
||||||
- Cell type annotation using marker databases
|
|
||||||
- Differential expression analysis
|
|
||||||
- Pathway enrichment analysis
|
|
||||||
|
|
||||||
### 3. Molecular Property Prediction (ADMET)
|
|
||||||
|
|
||||||
Predict absorption, distribution, metabolism, excretion, and toxicity properties:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent.go("Predict ADMET properties for these drug candidates: [SMILES strings]")
|
|
||||||
```
|
|
||||||
|
|
||||||
The agent handles:
|
|
||||||
- Molecular descriptor calculation
|
|
||||||
- Property prediction using integrated models
|
|
||||||
- Toxicity screening
|
|
||||||
- Drug-likeness assessment
|
|
||||||
|
|
||||||
### 4. Genomic Analysis
|
|
||||||
|
|
||||||
Execute genomic data analysis tasks:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent.go("Perform GWAS analysis to identify SNPs associated with disease phenotype in this cohort")
|
|
||||||
```
|
|
||||||
|
|
||||||
Supports:
|
|
||||||
- Genome-wide association studies (GWAS)
|
|
||||||
- Variant calling and annotation
|
|
||||||
- Population genetics analysis
|
|
||||||
- Functional genomics integration
|
|
||||||
|
|
||||||
### 5. Protein Structure and Function
|
|
||||||
|
|
||||||
Analyze protein sequences and structures:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent.go("Predict the structure of this protein sequence and identify potential binding sites")
|
|
||||||
```
|
|
||||||
|
|
||||||
Capabilities:
|
|
||||||
- Sequence analysis and domain identification
|
|
||||||
- Structure prediction integration
|
|
||||||
- Binding site prediction
|
|
||||||
- Protein-protein interaction analysis
|
|
||||||
|
|
||||||
### 6. Disease Diagnosis and Classification
|
|
||||||
|
|
||||||
Perform disease classification from multi-omics data:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent.go("Build a classifier to diagnose disease X from patient RNA-seq and clinical data")
|
|
||||||
```
|
|
||||||
|
|
||||||
### 7. Systems Biology and Pathway Analysis
|
|
||||||
|
|
||||||
Analyze biological pathways and networks:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent.go("Identify dysregulated pathways in this differential expression dataset")
|
|
||||||
```
|
|
||||||
|
|
||||||
### 8. Drug Discovery and Repurposing
|
|
||||||
|
|
||||||
Support drug discovery workflows:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent.go("Identify FDA-approved drugs that could be repurposed for treating disease Y based on mechanism of action")
|
|
||||||
```
|
|
||||||
|
|
||||||
## Advanced Features
|
|
||||||
|
|
||||||
### Custom Configuration per Agent
|
|
||||||
|
|
||||||
Override global configuration for specific agent instances:
|
|
||||||
|
|
||||||
```python
|
|
||||||
agent = A1(
|
agent = A1(
|
||||||
path='./project_data',
|
path='./data', # Path to data lake (~11GB downloaded on first use)
|
||||||
llm='gpt-4o',
|
llm='claude-sonnet-4-20250514' # LLM model selection
|
||||||
timeout=1800
|
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# Advanced configuration
|
||||||
|
default_config.llm = "gpt-4"
|
||||||
|
default_config.timeout_seconds = 1200
|
||||||
|
default_config.max_iterations = 50
|
||||||
```
|
```
|
||||||
|
|
||||||
### Conversation History and Reporting
|
**Supported LLM Providers:**
|
||||||
|
- Anthropic Claude (recommended): `claude-sonnet-4-20250514`, `claude-opus-4-20250514`
|
||||||
|
- OpenAI: `gpt-4`, `gpt-4-turbo`
|
||||||
|
- Azure OpenAI: via Azure configuration
|
||||||
|
- Google Gemini: `gemini-2.0-flash-exp`
|
||||||
|
- Groq: `llama-3.3-70b-versatile`
|
||||||
|
- AWS Bedrock: Various models via Bedrock API
|
||||||
|
|
||||||
Save execution traces as formatted PDF reports:
|
See `references/llm_providers.md` for detailed LLM configuration instructions.
|
||||||
|
|
||||||
|
### 2. Task Execution Workflow
|
||||||
|
|
||||||
|
Biomni follows an autonomous agent workflow:
|
||||||
|
|
||||||
```python
|
```python
|
||||||
# After executing tasks
|
# Step 1: Initialize agent
|
||||||
agent.save_conversation_history(
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
output_path='./reports/experiment_log.pdf',
|
|
||||||
format='pdf'
|
# Step 2: Execute task with natural language query
|
||||||
|
result = agent.go("""
|
||||||
|
Design a CRISPR screen to identify genes regulating autophagy in
|
||||||
|
HEK293 cells. Prioritize genes based on essentiality and pathway
|
||||||
|
relevance.
|
||||||
|
""")
|
||||||
|
|
||||||
|
# Step 3: Review generated code and analysis
|
||||||
|
# Agent autonomously:
|
||||||
|
# - Decomposes task into sub-steps
|
||||||
|
# - Retrieves relevant biological knowledge
|
||||||
|
# - Generates and executes analysis code
|
||||||
|
# - Interprets results and provides insights
|
||||||
|
|
||||||
|
# Step 4: Save results
|
||||||
|
agent.save_conversation_history("autophagy_screen_report.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
### 3. Common Task Patterns
|
||||||
|
|
||||||
|
#### CRISPR Screening Design
|
||||||
|
```python
|
||||||
|
agent.go("""
|
||||||
|
Design a genome-wide CRISPR knockout screen for identifying genes
|
||||||
|
affecting [phenotype] in [cell type]. Include:
|
||||||
|
1. sgRNA library design
|
||||||
|
2. Gene prioritization criteria
|
||||||
|
3. Expected hit genes based on pathway analysis
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
#### Single-Cell RNA-seq Analysis
|
||||||
|
```python
|
||||||
|
agent.go("""
|
||||||
|
Analyze this single-cell RNA-seq dataset:
|
||||||
|
- Perform quality control and filtering
|
||||||
|
- Identify cell populations via clustering
|
||||||
|
- Annotate cell types using marker genes
|
||||||
|
- Conduct differential expression between conditions
|
||||||
|
File path: [path/to/data.h5ad]
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
#### Drug ADMET Prediction
|
||||||
|
```python
|
||||||
|
agent.go("""
|
||||||
|
Predict ADMET properties for these drug candidates:
|
||||||
|
[SMILES strings or compound IDs]
|
||||||
|
Focus on:
|
||||||
|
- Absorption (Caco-2 permeability, HIA)
|
||||||
|
- Distribution (plasma protein binding, BBB penetration)
|
||||||
|
- Metabolism (CYP450 interaction)
|
||||||
|
- Excretion (clearance)
|
||||||
|
- Toxicity (hERG liability, hepatotoxicity)
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
#### GWAS Variant Interpretation
|
||||||
|
```python
|
||||||
|
agent.go("""
|
||||||
|
Interpret GWAS results for [trait/disease]:
|
||||||
|
- Identify genome-wide significant variants
|
||||||
|
- Map variants to causal genes
|
||||||
|
- Perform pathway enrichment analysis
|
||||||
|
- Predict functional consequences
|
||||||
|
Summary statistics file: [path/to/gwas_summary.txt]
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
See `references/use_cases.md` for comprehensive task examples across all biomedical domains.
|
||||||
|
|
||||||
|
### 4. Data Integration
|
||||||
|
|
||||||
|
Biomni integrates ~11GB of biomedical knowledge sources:
|
||||||
|
- **Gene databases** - Ensembl, NCBI Gene, UniProt
|
||||||
|
- **Protein structures** - PDB, AlphaFold
|
||||||
|
- **Clinical datasets** - ClinVar, OMIM, HPO
|
||||||
|
- **Literature indices** - PubMed abstracts, biomedical ontologies
|
||||||
|
- **Pathway databases** - KEGG, Reactome, GO
|
||||||
|
|
||||||
|
Data is automatically downloaded to the specified `path` on first use.
|
||||||
|
|
||||||
|
### 5. MCP Server Integration
|
||||||
|
|
||||||
|
Extend biomni with external tools via Model Context Protocol:
|
||||||
|
|
||||||
|
```python
|
||||||
|
# MCP servers can provide:
|
||||||
|
# - FDA drug databases
|
||||||
|
# - Web search for literature
|
||||||
|
# - Custom biomedical APIs
|
||||||
|
# - Laboratory equipment interfaces
|
||||||
|
|
||||||
|
# Configure MCP servers in .biomni/mcp_config.json
|
||||||
|
```
|
||||||
|
|
||||||
|
### 6. Evaluation Framework
|
||||||
|
|
||||||
|
Benchmark agent performance on biomedical tasks:
|
||||||
|
|
||||||
|
```python
|
||||||
|
from biomni.eval import BiomniEval1
|
||||||
|
|
||||||
|
evaluator = BiomniEval1()
|
||||||
|
|
||||||
|
# Evaluate on specific task types
|
||||||
|
score = evaluator.evaluate(
|
||||||
|
task_type='crispr_design',
|
||||||
|
instance_id='test_001',
|
||||||
|
answer=agent_output
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# Access evaluation dataset
|
||||||
|
dataset = evaluator.load_dataset()
|
||||||
```
|
```
|
||||||
|
|
||||||
Requires one of: WeasyPrint, markdown2pdf, or Pandoc.
|
|
||||||
|
|
||||||
### Model Context Protocol (MCP) Integration
|
|
||||||
|
|
||||||
Extend agent capabilities with external tools:
|
|
||||||
|
|
||||||
```python
|
|
||||||
# Add MCP-compatible tools
|
|
||||||
agent.add_mcp(config_path='./mcp_config.json')
|
|
||||||
```
|
|
||||||
|
|
||||||
MCP enables integration with:
|
|
||||||
- Laboratory information management systems (LIMS)
|
|
||||||
- Specialized bioinformatics databases
|
|
||||||
- Custom analysis pipelines
|
|
||||||
- External computational resources
|
|
||||||
|
|
||||||
### Using Biomni-R0 (Specialized Reasoning Model)
|
|
||||||
|
|
||||||
Deploy the 32B parameter Biomni-R0 model for enhanced biological reasoning:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
# Install SGLang
|
|
||||||
pip install "sglang[all]"
|
|
||||||
|
|
||||||
# Deploy Biomni-R0
|
|
||||||
python -m sglang.launch_server \
|
|
||||||
--model-path snap-stanford/biomni-r0 \
|
|
||||||
--port 30000 \
|
|
||||||
--trust-remote-code
|
|
||||||
```
|
|
||||||
|
|
||||||
Then configure the agent:
|
|
||||||
|
|
||||||
```python
|
|
||||||
from biomni.config import default_config
|
|
||||||
|
|
||||||
default_config.llm = "openai/biomni-r0"
|
|
||||||
default_config.api_base = "http://localhost:30000/v1"
|
|
||||||
```
|
|
||||||
|
|
||||||
Biomni-R0 provides specialized reasoning for:
|
|
||||||
- Complex multi-step biological workflows
|
|
||||||
- Hypothesis generation and evaluation
|
|
||||||
- Experimental design optimization
|
|
||||||
- Literature-informed analysis
|
|
||||||
|
|
||||||
## Best Practices
|
## Best Practices
|
||||||
|
|
||||||
### Task Specification
|
### Task Formulation
|
||||||
|
- **Be specific** - Include biological context, organism, cell type, conditions
|
||||||
Provide clear, specific task descriptions:
|
- **Specify outputs** - Clearly state desired analysis outputs and formats
|
||||||
|
- **Provide data paths** - Include file paths for datasets to analyze
|
||||||
✅ **Good:** "Analyze this scRNA-seq dataset (file: data.h5ad) to identify T cell subtypes, then perform differential expression analysis comparing activated vs. resting T cells"
|
- **Set constraints** - Mention time/computational limits if relevant
|
||||||
|
|
||||||
❌ **Vague:** "Analyze my RNA-seq data"
|
|
||||||
|
|
||||||
### Data Organization
|
|
||||||
|
|
||||||
Structure data directories for efficient retrieval:
|
|
||||||
|
|
||||||
```
|
|
||||||
project/
|
|
||||||
├── data/ # Biomni knowledge base
|
|
||||||
├── raw_data/ # Your experimental data
|
|
||||||
├── results/ # Analysis outputs
|
|
||||||
└── reports/ # Generated reports
|
|
||||||
```
|
|
||||||
|
|
||||||
### Iterative Refinement
|
|
||||||
|
|
||||||
Use iterative task execution for complex analyses:
|
|
||||||
|
|
||||||
```python
|
|
||||||
# Step 1: Exploratory analysis
|
|
||||||
agent.go("Load and perform initial QC on the proteomics dataset")
|
|
||||||
|
|
||||||
# Step 2: Based on results, refine analysis
|
|
||||||
agent.go("Based on the QC results, remove low-quality samples and normalize using method X")
|
|
||||||
|
|
||||||
# Step 3: Downstream analysis
|
|
||||||
agent.go("Perform differential abundance analysis with adjusted parameters")
|
|
||||||
```
|
|
||||||
|
|
||||||
### Security Considerations
|
### Security Considerations
|
||||||
|
⚠️ **Important**: Biomni executes LLM-generated code with full system privileges. For production use:
|
||||||
|
- Run in isolated environments (Docker, VMs)
|
||||||
|
- Avoid exposing sensitive credentials
|
||||||
|
- Review generated code before execution in sensitive contexts
|
||||||
|
- Use sandboxed execution environments when possible
|
||||||
|
|
||||||
**CRITICAL:** Biomni executes LLM-generated code with full system privileges. For production use:
|
### Performance Optimization
|
||||||
|
- **Choose appropriate LLMs** - Claude Sonnet 4 recommended for balance of speed/quality
|
||||||
|
- **Set reasonable timeouts** - Adjust `default_config.timeout_seconds` for complex tasks
|
||||||
|
- **Monitor iterations** - Track `max_iterations` to prevent runaway loops
|
||||||
|
- **Cache data** - Reuse downloaded data lake across sessions
|
||||||
|
|
||||||
1. **Use sandboxed environments:** Deploy in Docker containers or VMs with restricted permissions
|
### Result Documentation
|
||||||
2. **Validate sensitive operations:** Review code before execution for file access, network calls, or credential usage
|
```python
|
||||||
3. **Limit data access:** Restrict agent access to only necessary data directories
|
# Always save conversation history for reproducibility
|
||||||
4. **Monitor execution:** Log all executed code for audit trails
|
agent.save_conversation_history("results/project_name_YYYYMMDD.pdf")
|
||||||
|
|
||||||
Never run Biomni with:
|
# Include in reports:
|
||||||
- Unrestricted file system access
|
# - Original task description
|
||||||
- Direct access to sensitive credentials
|
# - Generated analysis code
|
||||||
- Network access to production systems
|
# - Results and interpretations
|
||||||
- Elevated system privileges
|
# - Data sources used
|
||||||
|
```
|
||||||
|
|
||||||
### Model Selection Guidelines
|
## Resources
|
||||||
|
|
||||||
Choose models based on task complexity:
|
### References
|
||||||
|
Detailed documentation available in the `references/` directory:
|
||||||
|
|
||||||
- **Claude Sonnet 4:** Recommended for most biomedical tasks, excellent biological reasoning
|
- **`api_reference.md`** - Complete API documentation for A1 class, configuration, and evaluation
|
||||||
- **GPT-4/GPT-4o:** Strong general capabilities, good for diverse tasks
|
- **`llm_providers.md`** - LLM provider setup (Anthropic, OpenAI, Azure, Google, Groq, AWS)
|
||||||
- **Biomni-R0:** Specialized for complex biological reasoning, multi-step workflows
|
- **`use_cases.md`** - Comprehensive task examples for all biomedical domains
|
||||||
- **Smaller models:** Use for simple, well-defined tasks to reduce cost
|
|
||||||
|
|
||||||
## Evaluation and Benchmarking
|
### Scripts
|
||||||
|
Helper scripts in the `scripts/` directory:
|
||||||
|
|
||||||
Biomni-Eval1 benchmark contains 433 evaluation instances across 10 biological tasks:
|
- **`setup_environment.py`** - Interactive environment and API key configuration
|
||||||
|
- **`generate_report.py`** - Enhanced PDF report generation with custom formatting
|
||||||
|
|
||||||
- GWAS analysis
|
### External Resources
|
||||||
- Disease diagnosis
|
- **GitHub**: https://github.com/snap-stanford/biomni
|
||||||
- Gene detection and classification
|
- **Web Platform**: https://biomni.stanford.edu
|
||||||
- Molecular property prediction
|
- **Paper**: https://www.biorxiv.org/content/10.1101/2025.05.30.656746v1
|
||||||
- Pathway analysis
|
- **Model**: https://huggingface.co/biomni/Biomni-R0-32B-Preview
|
||||||
- Protein function prediction
|
- **Evaluation Dataset**: https://huggingface.co/datasets/biomni/Eval1
|
||||||
- Drug response prediction
|
|
||||||
- Variant interpretation
|
|
||||||
- Cell type annotation
|
|
||||||
- Biomarker discovery
|
|
||||||
|
|
||||||
Use the benchmark to:
|
|
||||||
- Evaluate custom agent configurations
|
|
||||||
- Compare LLM providers for specific tasks
|
|
||||||
- Validate analysis pipelines
|
|
||||||
|
|
||||||
## Troubleshooting
|
## Troubleshooting
|
||||||
|
|
||||||
### Common Issues
|
### Common Issues
|
||||||
|
|
||||||
**Issue:** Data download fails or times out
|
**Data download fails**
|
||||||
**Solution:** Manually download the knowledge base or increase timeout settings
|
```python
|
||||||
|
# Manually trigger data lake download
|
||||||
|
agent = A1(path='./data', llm='your-llm')
|
||||||
|
# First .go() call will download data
|
||||||
|
```
|
||||||
|
|
||||||
**Issue:** Package dependency conflicts
|
**API key errors**
|
||||||
**Solution:** Some optional dependencies cannot be installed by default due to conflicts. Install specific packages manually and uncomment relevant code sections as documented in the repository
|
```bash
|
||||||
|
# Verify environment variables
|
||||||
|
echo $ANTHROPIC_API_KEY
|
||||||
|
# Or check .env file in working directory
|
||||||
|
```
|
||||||
|
|
||||||
**Issue:** LLM API errors
|
**Timeout on complex tasks**
|
||||||
**Solution:** Verify API key configuration, check rate limits, ensure sufficient credits
|
```python
|
||||||
|
from biomni.config import default_config
|
||||||
|
default_config.timeout_seconds = 3600 # 1 hour
|
||||||
|
```
|
||||||
|
|
||||||
**Issue:** Memory errors with large datasets
|
**Memory issues with large datasets**
|
||||||
**Solution:** Process data in chunks, use data subsampling, or deploy on higher-memory instances
|
- Use streaming for large files
|
||||||
|
- Process data in chunks
|
||||||
|
- Increase system memory allocation
|
||||||
|
|
||||||
### Getting Help
|
### Getting Help
|
||||||
|
|
||||||
For detailed troubleshooting:
|
For issues or questions:
|
||||||
- Review the Biomni GitHub repository issues
|
- GitHub Issues: https://github.com/snap-stanford/biomni/issues
|
||||||
- Check `references/api_reference.md` for detailed API documentation
|
- Documentation: Check `references/` files for detailed guidance
|
||||||
- Consult `references/task_examples.md` for comprehensive task patterns
|
- Community: Stanford SNAP lab and biomni contributors
|
||||||
|
|
||||||
## Resources
|
|
||||||
|
|
||||||
### references/
|
|
||||||
Detailed reference documentation for advanced usage:
|
|
||||||
|
|
||||||
- **api_reference.md:** Complete API documentation for A1 agent, configuration objects, and utility functions
|
|
||||||
- **llm_providers.md:** Comprehensive guide for configuring all supported LLM providers (Anthropic, OpenAI, Azure, Gemini, Groq, Ollama, AWS Bedrock)
|
|
||||||
- **task_examples.md:** Extensive collection of biomedical task examples with code patterns
|
|
||||||
|
|
||||||
### scripts/
|
|
||||||
Helper scripts for common operations:
|
|
||||||
|
|
||||||
- **setup_environment.py:** Automated environment setup and validation
|
|
||||||
- **generate_report.py:** Enhanced PDF report generation with custom formatting
|
|
||||||
|
|
||||||
Load reference documentation as needed:
|
|
||||||
```python
|
|
||||||
# Claude can read reference files when needed for detailed information
|
|
||||||
# Example: "Check references/llm_providers.md for Azure OpenAI configuration"
|
|
||||||
```
|
|
||||||
|
|||||||
@@ -1,635 +1,460 @@
|
|||||||
# Biomni API Reference
|
# Biomni API Reference
|
||||||
|
|
||||||
This document provides comprehensive API documentation for the Biomni biomedical AI agent system.
|
Comprehensive API documentation for the biomni framework.
|
||||||
|
|
||||||
## Core Classes
|
## A1 Agent Class
|
||||||
|
|
||||||
### A1 Agent
|
The A1 class is the primary interface for interacting with biomni.
|
||||||
|
|
||||||
The primary agent class for executing biomedical research tasks.
|
### Initialization
|
||||||
|
|
||||||
#### Initialization
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.agent import A1
|
from biomni.agent import A1
|
||||||
|
|
||||||
agent = A1(
|
agent = A1(
|
||||||
path='./data', # Path to biomedical knowledge base
|
path: str, # Path to data lake directory
|
||||||
llm='claude-sonnet-4-20250514', # LLM model identifier
|
llm: str, # LLM model identifier
|
||||||
timeout=None, # Optional timeout in seconds
|
verbose: bool = True, # Enable verbose logging
|
||||||
verbose=True # Enable detailed logging
|
mcp_config: str = None # Path to MCP server configuration
|
||||||
)
|
)
|
||||||
```
|
```
|
||||||
|
|
||||||
**Parameters:**
|
**Parameters:**
|
||||||
|
|
||||||
- `path` (str, required): Directory path where the biomedical knowledge base is stored or will be downloaded. First-time initialization will download ~11GB of data.
|
- **`path`** (str, required) - Directory path for biomni data lake (~11GB). Data is automatically downloaded on first use if not present.
|
||||||
- `llm` (str, optional): LLM model identifier. Defaults to the value in `default_config.llm`. Supports multiple providers (see LLM Providers section).
|
|
||||||
- `timeout` (int, optional): Maximum execution time in seconds for agent operations. Overrides `default_config.timeout_seconds`.
|
|
||||||
- `verbose` (bool, optional): Enable verbose logging for debugging. Default: True.
|
|
||||||
|
|
||||||
**Returns:** A1 agent instance ready for task execution.
|
- **`llm`** (str, required) - LLM model identifier. Options include:
|
||||||
|
- `'claude-sonnet-4-20250514'` - Recommended for balanced performance
|
||||||
|
- `'claude-opus-4-20250514'` - Maximum capability
|
||||||
|
- `'gpt-4'`, `'gpt-4-turbo'` - OpenAI models
|
||||||
|
- `'gemini-2.0-flash-exp'` - Google Gemini
|
||||||
|
- `'llama-3.3-70b-versatile'` - Via Groq
|
||||||
|
- Custom model endpoints via provider configuration
|
||||||
|
|
||||||
#### Methods
|
- **`verbose`** (bool, optional, default=True) - Enable detailed logging of agent reasoning, tool use, and code execution.
|
||||||
|
|
||||||
##### `go(task_description: str) -> None`
|
- **`mcp_config`** (str, optional) - Path to MCP (Model Context Protocol) server configuration file for external tool integration.
|
||||||
|
|
||||||
|
**Example:**
|
||||||
|
```python
|
||||||
|
# Basic initialization
|
||||||
|
agent = A1(path='./biomni_data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
# With MCP integration
|
||||||
|
agent = A1(
|
||||||
|
path='./biomni_data',
|
||||||
|
llm='claude-sonnet-4-20250514',
|
||||||
|
mcp_config='./.biomni/mcp_config.json'
|
||||||
|
)
|
||||||
|
```
|
||||||
|
|
||||||
|
### Core Methods
|
||||||
|
|
||||||
|
#### `go(query: str) -> str`
|
||||||
|
|
||||||
Execute a biomedical research task autonomously.
|
Execute a biomedical research task autonomously.
|
||||||
|
|
||||||
```python
|
```python
|
||||||
agent.go("Analyze this scRNA-seq dataset and identify cell types")
|
result = agent.go(query: str)
|
||||||
```
|
```
|
||||||
|
|
||||||
**Parameters:**
|
**Parameters:**
|
||||||
- `task_description` (str, required): Natural language description of the biomedical task to execute. Be specific about:
|
- **`query`** (str) - Natural language description of the biomedical task to execute
|
||||||
- Data location and format
|
|
||||||
- Desired analysis or output
|
**Returns:**
|
||||||
- Any specific methods or parameters
|
- **`str`** - Final answer or analysis result from the agent
|
||||||
- Expected results format
|
|
||||||
|
|
||||||
**Behavior:**
|
**Behavior:**
|
||||||
1. Decomposes the task into executable steps
|
1. Decomposes query into executable sub-tasks
|
||||||
2. Retrieves relevant biomedical knowledge from the data lake
|
2. Retrieves relevant knowledge from integrated databases
|
||||||
3. Generates and executes Python/R code
|
3. Generates and executes Python code for analysis
|
||||||
4. Provides results and visualizations
|
4. Iterates on results until task completion
|
||||||
5. Handles errors and retries with refinement
|
5. Returns final synthesized answer
|
||||||
|
|
||||||
**Notes:**
|
**Example:**
|
||||||
- Executes code with system privileges - use in sandboxed environments
|
```python
|
||||||
- Long-running tasks may require timeout adjustments
|
result = agent.go("""
|
||||||
- Intermediate results are displayed during execution
|
Identify genes associated with Alzheimer's disease from GWAS data.
|
||||||
|
Perform pathway enrichment analysis on top hits.
|
||||||
|
""")
|
||||||
|
print(result)
|
||||||
|
```
|
||||||
|
|
||||||
##### `save_conversation_history(output_path: str, format: str = 'pdf') -> None`
|
#### `save_conversation_history(output_path: str, format: str = 'pdf')`
|
||||||
|
|
||||||
Export conversation history and execution trace as a formatted report.
|
Save complete conversation history including task, reasoning, code, and results.
|
||||||
|
|
||||||
```python
|
```python
|
||||||
agent.save_conversation_history(
|
agent.save_conversation_history(
|
||||||
output_path='./reports/analysis_log.pdf',
|
output_path: str,
|
||||||
format='pdf'
|
format: str = 'pdf'
|
||||||
)
|
)
|
||||||
```
|
```
|
||||||
|
|
||||||
**Parameters:**
|
**Parameters:**
|
||||||
- `output_path` (str, required): File path for the output report
|
- **`output_path`** (str) - File path for saved report
|
||||||
- `format` (str, optional): Output format. Options: 'pdf', 'markdown'. Default: 'pdf'
|
- **`format`** (str, optional, default='pdf') - Output format: `'pdf'`, `'html'`, or `'markdown'`
|
||||||
|
|
||||||
**Requirements:**
|
**Example:**
|
||||||
- For PDF: Install one of: WeasyPrint, markdown2pdf, or Pandoc
|
```python
|
||||||
```bash
|
agent.save_conversation_history('reports/alzheimers_gwas_analysis.pdf')
|
||||||
pip install weasyprint # Recommended
|
```
|
||||||
# or
|
|
||||||
pip install markdown2pdf
|
|
||||||
# or install Pandoc system-wide
|
|
||||||
```
|
|
||||||
|
|
||||||
**Report Contents:**
|
#### `reset()`
|
||||||
- Task description and parameters
|
|
||||||
- Retrieved biomedical knowledge
|
|
||||||
- Generated code with execution traces
|
|
||||||
- Results, visualizations, and outputs
|
|
||||||
- Timestamps and execution metadata
|
|
||||||
|
|
||||||
##### `add_mcp(config_path: str) -> None`
|
Reset agent state and clear conversation history.
|
||||||
|
|
||||||
Add Model Context Protocol (MCP) tools to extend agent capabilities.
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
agent.add_mcp(config_path='./mcp_tools_config.json')
|
agent.reset()
|
||||||
```
|
```
|
||||||
|
|
||||||
**Parameters:**
|
Use when starting a new independent task to clear previous context.
|
||||||
- `config_path` (str, required): Path to MCP configuration JSON file
|
|
||||||
|
|
||||||
**MCP Configuration Format:**
|
**Example:**
|
||||||
```json
|
```python
|
||||||
{
|
# Task 1
|
||||||
"tools": [
|
agent.go("Analyze dataset A")
|
||||||
{
|
agent.save_conversation_history("task1.pdf")
|
||||||
"name": "tool_name",
|
|
||||||
"endpoint": "http://localhost:8000/tool",
|
# Reset for fresh context
|
||||||
"description": "Tool description for LLM",
|
agent.reset()
|
||||||
"parameters": {
|
|
||||||
"param1": "string",
|
# Task 2 - independent of Task 1
|
||||||
"param2": "integer"
|
agent.go("Analyze dataset B")
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
}
|
|
||||||
```
|
```
|
||||||
|
|
||||||
**Use Cases:**
|
### Configuration via default_config
|
||||||
- Connect to laboratory information systems
|
|
||||||
- Integrate proprietary databases
|
|
||||||
- Access specialized computational resources
|
|
||||||
- Link to institutional data repositories
|
|
||||||
|
|
||||||
## Configuration
|
Global configuration parameters accessible via `biomni.config.default_config`.
|
||||||
|
|
||||||
### default_config
|
|
||||||
|
|
||||||
Global configuration object for Biomni settings.
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.config import default_config
|
from biomni.config import default_config
|
||||||
```
|
|
||||||
|
|
||||||
#### Attributes
|
# LLM Configuration
|
||||||
|
|
||||||
##### `llm: str`
|
|
||||||
|
|
||||||
Default LLM model identifier for all agent instances.
|
|
||||||
|
|
||||||
```python
|
|
||||||
default_config.llm = "claude-sonnet-4-20250514"
|
default_config.llm = "claude-sonnet-4-20250514"
|
||||||
```
|
default_config.llm_temperature = 0.7
|
||||||
|
|
||||||
**Supported Models:**
|
# Execution Parameters
|
||||||
|
|
||||||
**Anthropic:**
|
|
||||||
- `claude-sonnet-4-20250514` (Recommended)
|
|
||||||
- `claude-opus-4-20250514`
|
|
||||||
- `claude-3-5-sonnet-20241022`
|
|
||||||
- `claude-3-opus-20240229`
|
|
||||||
|
|
||||||
**OpenAI:**
|
|
||||||
- `gpt-4o`
|
|
||||||
- `gpt-4`
|
|
||||||
- `gpt-4-turbo`
|
|
||||||
- `gpt-3.5-turbo`
|
|
||||||
|
|
||||||
**Azure OpenAI:**
|
|
||||||
- `azure/gpt-4`
|
|
||||||
- `azure/<deployment-name>`
|
|
||||||
|
|
||||||
**Google Gemini:**
|
|
||||||
- `gemini/gemini-pro`
|
|
||||||
- `gemini/gemini-1.5-pro`
|
|
||||||
|
|
||||||
**Groq:**
|
|
||||||
- `groq/llama-3.1-70b-versatile`
|
|
||||||
- `groq/mixtral-8x7b-32768`
|
|
||||||
|
|
||||||
**Ollama (Local):**
|
|
||||||
- `ollama/llama3`
|
|
||||||
- `ollama/mistral`
|
|
||||||
- `ollama/<model-name>`
|
|
||||||
|
|
||||||
**AWS Bedrock:**
|
|
||||||
- `bedrock/anthropic.claude-v2`
|
|
||||||
- `bedrock/anthropic.claude-3-sonnet`
|
|
||||||
|
|
||||||
**Custom/Biomni-R0:**
|
|
||||||
- `openai/biomni-r0` (requires local SGLang deployment)
|
|
||||||
|
|
||||||
##### `timeout_seconds: int`
|
|
||||||
|
|
||||||
Default timeout for agent operations in seconds.
|
|
||||||
|
|
||||||
```python
|
|
||||||
default_config.timeout_seconds = 1200 # 20 minutes
|
default_config.timeout_seconds = 1200 # 20 minutes
|
||||||
|
default_config.max_iterations = 50 # Max reasoning loops
|
||||||
|
default_config.max_tokens = 4096 # Max tokens per LLM call
|
||||||
|
|
||||||
|
# Code Execution
|
||||||
|
default_config.enable_code_execution = True
|
||||||
|
default_config.sandbox_mode = False # Enable for restricted execution
|
||||||
|
|
||||||
|
# Data and Caching
|
||||||
|
default_config.data_cache_dir = "./biomni_cache"
|
||||||
|
default_config.enable_caching = True
|
||||||
```
|
```
|
||||||
|
|
||||||
**Recommended Values:**
|
**Key Parameters:**
|
||||||
- Simple tasks (QC, basic analysis): 300-600 seconds
|
|
||||||
- Medium tasks (differential expression, clustering): 600-1200 seconds
|
|
||||||
- Complex tasks (full pipelines, ML models): 1200-3600 seconds
|
|
||||||
- Very complex tasks: 3600+ seconds
|
|
||||||
|
|
||||||
##### `data_path: str`
|
- **`timeout_seconds`** (int, default=1200) - Maximum time for task execution. Increase for complex analyses.
|
||||||
|
|
||||||
Default path to biomedical knowledge base.
|
- **`max_iterations`** (int, default=50) - Maximum agent reasoning loops. Prevents infinite loops.
|
||||||
|
|
||||||
|
- **`enable_code_execution`** (bool, default=True) - Allow agent to execute generated code. Disable for code generation only.
|
||||||
|
|
||||||
|
- **`sandbox_mode`** (bool, default=False) - Enable sandboxed code execution (requires additional setup).
|
||||||
|
|
||||||
|
## BiomniEval1 Evaluation Framework
|
||||||
|
|
||||||
|
Framework for benchmarking agent performance on biomedical tasks.
|
||||||
|
|
||||||
|
### Initialization
|
||||||
|
|
||||||
```python
|
```python
|
||||||
default_config.data_path = "/path/to/biomni/data"
|
from biomni.eval import BiomniEval1
|
||||||
|
|
||||||
|
evaluator = BiomniEval1(
|
||||||
|
dataset_path: str = None, # Path to evaluation dataset
|
||||||
|
metrics: list = None # Evaluation metrics to compute
|
||||||
|
)
|
||||||
```
|
```
|
||||||
|
|
||||||
**Storage Requirements:**
|
**Example:**
|
||||||
- Initial download: ~11GB
|
|
||||||
- Extracted size: ~15GB
|
|
||||||
- Additional working space: ~5-10GB recommended
|
|
||||||
|
|
||||||
##### `api_base: str`
|
|
||||||
|
|
||||||
Custom API endpoint for LLM providers (advanced usage).
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
# For local Biomni-R0 deployment
|
evaluator = BiomniEval1()
|
||||||
default_config.api_base = "http://localhost:30000/v1"
|
|
||||||
|
|
||||||
# For custom OpenAI-compatible endpoints
|
|
||||||
default_config.api_base = "https://your-endpoint.com/v1"
|
|
||||||
```
|
```
|
||||||
|
|
||||||
##### `max_retries: int`
|
### Methods
|
||||||
|
|
||||||
Number of retry attempts for failed operations.
|
#### `evaluate(task_type: str, instance_id: str, answer: str) -> float`
|
||||||
|
|
||||||
|
Evaluate agent answer against ground truth.
|
||||||
|
|
||||||
```python
|
```python
|
||||||
default_config.max_retries = 3
|
score = evaluator.evaluate(
|
||||||
```
|
task_type: str, # Task category
|
||||||
|
instance_id: str, # Specific task instance
|
||||||
#### Methods
|
answer: str # Agent-generated answer
|
||||||
|
|
||||||
##### `reset() -> None`
|
|
||||||
|
|
||||||
Reset all configuration values to system defaults.
|
|
||||||
|
|
||||||
```python
|
|
||||||
default_config.reset()
|
|
||||||
```
|
|
||||||
|
|
||||||
## Database Query System
|
|
||||||
|
|
||||||
Biomni includes a retrieval-augmented generation (RAG) system for querying the biomedical knowledge base.
|
|
||||||
|
|
||||||
### Query Functions
|
|
||||||
|
|
||||||
#### `query_genes(query: str, top_k: int = 10) -> List[Dict]`
|
|
||||||
|
|
||||||
Query gene information from integrated databases.
|
|
||||||
|
|
||||||
```python
|
|
||||||
from biomni.database import query_genes
|
|
||||||
|
|
||||||
results = query_genes(
|
|
||||||
query="genes involved in p53 pathway",
|
|
||||||
top_k=20
|
|
||||||
)
|
)
|
||||||
```
|
```
|
||||||
|
|
||||||
**Parameters:**
|
**Parameters:**
|
||||||
- `query` (str): Natural language or gene identifier query
|
- **`task_type`** (str) - Task category: `'crispr_design'`, `'scrna_analysis'`, `'gwas_interpretation'`, `'drug_admet'`, `'clinical_diagnosis'`
|
||||||
- `top_k` (int): Number of results to return
|
- **`instance_id`** (str) - Unique identifier for task instance from dataset
|
||||||
|
- **`answer`** (str) - Agent's answer to evaluate
|
||||||
|
|
||||||
**Returns:** List of dictionaries containing:
|
**Returns:**
|
||||||
- `gene_symbol`: Official gene symbol
|
- **`float`** - Evaluation score (0.0 to 1.0)
|
||||||
- `gene_name`: Full gene name
|
|
||||||
- `description`: Functional description
|
|
||||||
- `pathways`: Associated biological pathways
|
|
||||||
- `go_terms`: Gene Ontology annotations
|
|
||||||
- `diseases`: Associated diseases
|
|
||||||
- `similarity_score`: Relevance score (0-1)
|
|
||||||
|
|
||||||
#### `query_proteins(query: str, top_k: int = 10) -> List[Dict]`
|
**Example:**
|
||||||
|
```python
|
||||||
|
# Generate answer
|
||||||
|
result = agent.go("Design CRISPR screen for autophagy genes")
|
||||||
|
|
||||||
Query protein information from UniProt and other sources.
|
# Evaluate
|
||||||
|
score = evaluator.evaluate(
|
||||||
|
task_type='crispr_design',
|
||||||
|
instance_id='autophagy_001',
|
||||||
|
answer=result
|
||||||
|
)
|
||||||
|
print(f"Score: {score:.2f}")
|
||||||
|
```
|
||||||
|
|
||||||
|
#### `load_dataset() -> dict`
|
||||||
|
|
||||||
|
Load the Biomni-Eval1 benchmark dataset.
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.database import query_proteins
|
dataset = evaluator.load_dataset()
|
||||||
|
```
|
||||||
|
|
||||||
results = query_proteins(
|
**Returns:**
|
||||||
query="kinase proteins in cell cycle",
|
- **`dict`** - Dictionary with task instances organized by task type
|
||||||
top_k=15
|
|
||||||
|
**Example:**
|
||||||
|
```python
|
||||||
|
dataset = evaluator.load_dataset()
|
||||||
|
|
||||||
|
for task_type, instances in dataset.items():
|
||||||
|
print(f"{task_type}: {len(instances)} instances")
|
||||||
|
```
|
||||||
|
|
||||||
|
#### `run_benchmark(agent: A1, task_types: list = None) -> dict`
|
||||||
|
|
||||||
|
Run full benchmark evaluation on agent.
|
||||||
|
|
||||||
|
```python
|
||||||
|
results = evaluator.run_benchmark(
|
||||||
|
agent: A1,
|
||||||
|
task_types: list = None # Specific task types or None for all
|
||||||
)
|
)
|
||||||
```
|
```
|
||||||
|
|
||||||
**Returns:** List of dictionaries with protein metadata:
|
**Returns:**
|
||||||
- `uniprot_id`: UniProt accession
|
- **`dict`** - Results with scores, timing, and detailed metrics per task
|
||||||
- `protein_name`: Protein name
|
|
||||||
- `function`: Functional annotation
|
|
||||||
- `domains`: Protein domains
|
|
||||||
- `subcellular_location`: Cellular localization
|
|
||||||
- `similarity_score`: Relevance score
|
|
||||||
|
|
||||||
#### `query_drugs(query: str, top_k: int = 10) -> List[Dict]`
|
|
||||||
|
|
||||||
Query drug and compound information.
|
|
||||||
|
|
||||||
|
**Example:**
|
||||||
```python
|
```python
|
||||||
from biomni.database import query_drugs
|
results = evaluator.run_benchmark(
|
||||||
|
agent=agent,
|
||||||
results = query_drugs(
|
task_types=['crispr_design', 'scrna_analysis']
|
||||||
query="FDA approved cancer drugs targeting EGFR",
|
|
||||||
top_k=10
|
|
||||||
)
|
)
|
||||||
|
|
||||||
|
print(f"Overall accuracy: {results['mean_score']:.2f}")
|
||||||
|
print(f"Average time: {results['mean_time']:.1f}s")
|
||||||
```
|
```
|
||||||
|
|
||||||
**Returns:** Drug information including:
|
## Data Lake API
|
||||||
- `drug_name`: Common name
|
|
||||||
- `drugbank_id`: DrugBank identifier
|
|
||||||
- `indication`: Therapeutic indication
|
|
||||||
- `mechanism`: Mechanism of action
|
|
||||||
- `targets`: Molecular targets
|
|
||||||
- `approval_status`: Regulatory status
|
|
||||||
- `smiles`: Chemical structure (SMILES notation)
|
|
||||||
|
|
||||||
#### `query_diseases(query: str, top_k: int = 10) -> List[Dict]`
|
Access integrated biomedical databases programmatically.
|
||||||
|
|
||||||
Query disease information from clinical databases.
|
### Gene Database Queries
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.database import query_diseases
|
from biomni.data import GeneDB
|
||||||
|
|
||||||
results = query_diseases(
|
gene_db = GeneDB(path='./biomni_data')
|
||||||
query="autoimmune diseases affecting joints",
|
|
||||||
top_k=10
|
# Query gene information
|
||||||
)
|
gene_info = gene_db.get_gene('BRCA1')
|
||||||
|
# Returns: {'symbol': 'BRCA1', 'name': '...', 'function': '...', ...}
|
||||||
|
|
||||||
|
# Search genes by pathway
|
||||||
|
pathway_genes = gene_db.search_by_pathway('DNA repair')
|
||||||
|
# Returns: List of gene symbols in pathway
|
||||||
|
|
||||||
|
# Get gene interactions
|
||||||
|
interactions = gene_db.get_interactions('TP53')
|
||||||
|
# Returns: List of interacting genes with interaction types
|
||||||
```
|
```
|
||||||
|
|
||||||
**Returns:** Disease data:
|
### Protein Structure Access
|
||||||
- `disease_name`: Standard disease name
|
|
||||||
- `disease_id`: Ontology identifier
|
|
||||||
- `symptoms`: Clinical manifestations
|
|
||||||
- `associated_genes`: Genetic associations
|
|
||||||
- `prevalence`: Epidemiological data
|
|
||||||
|
|
||||||
#### `query_pathways(query: str, top_k: int = 10) -> List[Dict]`
|
|
||||||
|
|
||||||
Query biological pathways from KEGG, Reactome, and other sources.
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.database import query_pathways
|
from biomni.data import ProteinDB
|
||||||
|
|
||||||
results = query_pathways(
|
protein_db = ProteinDB(path='./biomni_data')
|
||||||
query="immune response signaling pathways",
|
|
||||||
top_k=15
|
# Get AlphaFold structure
|
||||||
)
|
structure = protein_db.get_structure('P38398') # BRCA1 UniProt ID
|
||||||
|
# Returns: Path to PDB file or structure object
|
||||||
|
|
||||||
|
# Search PDB database
|
||||||
|
pdb_entries = protein_db.search_pdb('kinase', resolution_max=2.5)
|
||||||
|
# Returns: List of PDB IDs matching criteria
|
||||||
```
|
```
|
||||||
|
|
||||||
**Returns:** Pathway information:
|
### Clinical Data Access
|
||||||
- `pathway_name`: Pathway name
|
|
||||||
- `pathway_id`: Database identifier
|
|
||||||
- `genes`: Genes in pathway
|
|
||||||
- `description`: Functional description
|
|
||||||
- `source`: Database source (KEGG, Reactome, etc.)
|
|
||||||
|
|
||||||
## Data Structures
|
|
||||||
|
|
||||||
### TaskResult
|
|
||||||
|
|
||||||
Result object returned by complex agent operations.
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
class TaskResult:
|
from biomni.data import ClinicalDB
|
||||||
success: bool # Whether task completed successfully
|
|
||||||
output: Any # Task output (varies by task)
|
clinical_db = ClinicalDB(path='./biomni_data')
|
||||||
code: str # Generated code
|
|
||||||
execution_time: float # Execution time in seconds
|
# Query ClinVar variants
|
||||||
error: Optional[str] # Error message if failed
|
variant_info = clinical_db.get_variant('rs429358') # APOE4 variant
|
||||||
metadata: Dict # Additional metadata
|
# Returns: {'significance': '...', 'disease': '...', 'frequency': ...}
|
||||||
|
|
||||||
|
# Search OMIM for disease
|
||||||
|
disease_info = clinical_db.search_omim('Alzheimer')
|
||||||
|
# Returns: List of OMIM entries with gene associations
|
||||||
```
|
```
|
||||||
|
|
||||||
### BiomedicalEntity
|
### Literature Search
|
||||||
|
|
||||||
Base class for biomedical entities in the knowledge base.
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
class BiomedicalEntity:
|
from biomni.data import LiteratureDB
|
||||||
entity_id: str # Unique identifier
|
|
||||||
entity_type: str # Type (gene, protein, drug, etc.)
|
lit_db = LiteratureDB(path='./biomni_data')
|
||||||
name: str # Entity name
|
|
||||||
description: str # Description
|
# Search PubMed abstracts
|
||||||
attributes: Dict # Additional attributes
|
papers = lit_db.search('CRISPR screening cancer', max_results=10)
|
||||||
references: List[str] # Literature references
|
# Returns: List of paper dictionaries with titles, abstracts, PMIDs
|
||||||
|
|
||||||
|
# Get citations for paper
|
||||||
|
citations = lit_db.get_citations('PMID:12345678')
|
||||||
|
# Returns: List of citing papers
|
||||||
```
|
```
|
||||||
|
|
||||||
## Utility Functions
|
## MCP Server Integration
|
||||||
|
|
||||||
### `download_data(path: str, force: bool = False) -> None`
|
Extend biomni with external tools via Model Context Protocol.
|
||||||
|
|
||||||
Manually download or update the biomedical knowledge base.
|
### Configuration Format
|
||||||
|
|
||||||
|
Create `.biomni/mcp_config.json`:
|
||||||
|
|
||||||
|
```json
|
||||||
|
{
|
||||||
|
"servers": {
|
||||||
|
"fda-drugs": {
|
||||||
|
"command": "python",
|
||||||
|
"args": ["-m", "mcp_server_fda"],
|
||||||
|
"env": {
|
||||||
|
"FDA_API_KEY": "${FDA_API_KEY}"
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"web-search": {
|
||||||
|
"command": "npx",
|
||||||
|
"args": ["-y", "@modelcontextprotocol/server-brave-search"],
|
||||||
|
"env": {
|
||||||
|
"BRAVE_API_KEY": "${BRAVE_API_KEY}"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
### Using MCP Tools in Tasks
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.utils import download_data
|
# Initialize with MCP config
|
||||||
|
agent = A1(
|
||||||
download_data(
|
|
||||||
path='./data',
|
path='./data',
|
||||||
force=True # Force re-download
|
llm='claude-sonnet-4-20250514',
|
||||||
|
mcp_config='./.biomni/mcp_config.json'
|
||||||
)
|
)
|
||||||
```
|
|
||||||
|
|
||||||
### `validate_environment() -> Dict[str, bool]`
|
# Agent can now use MCP tools automatically
|
||||||
|
result = agent.go("""
|
||||||
Check if the environment is properly configured.
|
Search for FDA-approved drugs targeting EGFR.
|
||||||
|
Get their approval dates and indications.
|
||||||
```python
|
""")
|
||||||
from biomni.utils import validate_environment
|
# Agent uses fda-drugs MCP server automatically
|
||||||
|
|
||||||
status = validate_environment()
|
|
||||||
# Returns: {
|
|
||||||
# 'conda_env': True,
|
|
||||||
# 'api_keys': True,
|
|
||||||
# 'data_available': True,
|
|
||||||
# 'dependencies': True
|
|
||||||
# }
|
|
||||||
```
|
|
||||||
|
|
||||||
### `list_available_models() -> List[str]`
|
|
||||||
|
|
||||||
Get a list of available LLM models based on configured API keys.
|
|
||||||
|
|
||||||
```python
|
|
||||||
from biomni.utils import list_available_models
|
|
||||||
|
|
||||||
models = list_available_models()
|
|
||||||
# Returns: ['claude-sonnet-4-20250514', 'gpt-4o', ...]
|
|
||||||
```
|
```
|
||||||
|
|
||||||
## Error Handling
|
## Error Handling
|
||||||
|
|
||||||
### Common Exceptions
|
Common exceptions and handling strategies:
|
||||||
|
|
||||||
#### `BiomniConfigError`
|
|
||||||
|
|
||||||
Raised when configuration is invalid or incomplete.
|
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.exceptions import BiomniConfigError
|
from biomni.exceptions import (
|
||||||
|
BiomniException,
|
||||||
|
LLMError,
|
||||||
|
CodeExecutionError,
|
||||||
|
DataNotFoundError,
|
||||||
|
TimeoutError
|
||||||
|
)
|
||||||
|
|
||||||
try:
|
try:
|
||||||
agent = A1(path='./data')
|
result = agent.go("Complex biomedical task")
|
||||||
except BiomniConfigError as e:
|
except TimeoutError:
|
||||||
print(f"Configuration error: {e}")
|
# Task exceeded timeout_seconds
|
||||||
```
|
print("Task timed out. Consider increasing timeout.")
|
||||||
|
default_config.timeout_seconds = 3600
|
||||||
#### `BiomniExecutionError`
|
except CodeExecutionError as e:
|
||||||
|
# Generated code failed to execute
|
||||||
Raised when code generation or execution fails.
|
print(f"Code execution error: {e}")
|
||||||
|
# Review generated code in conversation history
|
||||||
```python
|
except DataNotFoundError:
|
||||||
from biomni.exceptions import BiomniExecutionError
|
# Required data not in data lake
|
||||||
|
print("Data not found. Ensure data lake is downloaded.")
|
||||||
try:
|
except LLMError as e:
|
||||||
agent.go("invalid task")
|
# LLM API error
|
||||||
except BiomniExecutionError as e:
|
print(f"LLM error: {e}")
|
||||||
print(f"Execution failed: {e}")
|
# Check API keys and rate limits
|
||||||
# Access failed code: e.code
|
|
||||||
# Access error details: e.details
|
|
||||||
```
|
|
||||||
|
|
||||||
#### `BiomniDataError`
|
|
||||||
|
|
||||||
Raised when knowledge base or data access fails.
|
|
||||||
|
|
||||||
```python
|
|
||||||
from biomni.exceptions import BiomniDataError
|
|
||||||
|
|
||||||
try:
|
|
||||||
results = query_genes("unknown query format")
|
|
||||||
except BiomniDataError as e:
|
|
||||||
print(f"Data access error: {e}")
|
|
||||||
```
|
|
||||||
|
|
||||||
#### `BiomniTimeoutError`
|
|
||||||
|
|
||||||
Raised when operations exceed timeout limit.
|
|
||||||
|
|
||||||
```python
|
|
||||||
from biomni.exceptions import BiomniTimeoutError
|
|
||||||
|
|
||||||
try:
|
|
||||||
agent.go("very complex long-running task")
|
|
||||||
except BiomniTimeoutError as e:
|
|
||||||
print(f"Task timed out after {e.duration} seconds")
|
|
||||||
# Partial results may be available: e.partial_results
|
|
||||||
```
|
```
|
||||||
|
|
||||||
## Best Practices
|
## Best Practices
|
||||||
|
|
||||||
### Efficient Knowledge Retrieval
|
### Efficient API Usage
|
||||||
|
|
||||||
Pre-query databases for relevant context before complex tasks:
|
1. **Reuse agent instances** for related tasks to maintain context
|
||||||
|
2. **Set appropriate timeouts** based on task complexity
|
||||||
|
3. **Use caching** to avoid redundant data downloads
|
||||||
|
4. **Monitor iterations** to detect reasoning loops early
|
||||||
|
|
||||||
|
### Production Deployment
|
||||||
|
|
||||||
```python
|
```python
|
||||||
from biomni.database import query_genes, query_pathways
|
from biomni.agent import A1
|
||||||
|
from biomni.config import default_config
|
||||||
|
import logging
|
||||||
|
|
||||||
# Gather relevant biological context first
|
# Configure logging
|
||||||
genes = query_genes("cell cycle genes", top_k=50)
|
logging.basicConfig(level=logging.INFO)
|
||||||
pathways = query_pathways("cell cycle regulation", top_k=20)
|
|
||||||
|
|
||||||
# Then execute task with enriched context
|
# Production settings
|
||||||
agent.go(f"""
|
default_config.timeout_seconds = 3600
|
||||||
Analyze the cell cycle progression in this dataset.
|
default_config.max_iterations = 100
|
||||||
Focus on these genes: {[g['gene_symbol'] for g in genes]}
|
default_config.sandbox_mode = True # Enable sandboxing
|
||||||
Consider these pathways: {[p['pathway_name'] for p in pathways]}
|
|
||||||
""")
|
|
||||||
```
|
|
||||||
|
|
||||||
### Error Recovery
|
# Initialize with error handling
|
||||||
|
try:
|
||||||
Implement robust error handling for production workflows:
|
agent = A1(path='/data/biomni', llm='claude-sonnet-4-20250514')
|
||||||
|
result = agent.go(task_query)
|
||||||
```python
|
agent.save_conversation_history(f'reports/{task_id}.pdf')
|
||||||
from biomni.exceptions import BiomniExecutionError, BiomniTimeoutError
|
except Exception as e:
|
||||||
|
logging.error(f"Task {task_id} failed: {e}")
|
||||||
max_attempts = 3
|
# Handle failure appropriately
|
||||||
for attempt in range(max_attempts):
|
|
||||||
try:
|
|
||||||
agent.go("complex biomedical task")
|
|
||||||
break
|
|
||||||
except BiomniTimeoutError:
|
|
||||||
# Increase timeout and retry
|
|
||||||
default_config.timeout_seconds *= 2
|
|
||||||
print(f"Timeout, retrying with {default_config.timeout_seconds}s timeout")
|
|
||||||
except BiomniExecutionError as e:
|
|
||||||
# Refine task based on error
|
|
||||||
print(f"Execution failed: {e}, refining task...")
|
|
||||||
# Optionally modify task description
|
|
||||||
else:
|
|
||||||
print("Task failed after max attempts")
|
|
||||||
```
|
```
|
||||||
|
|
||||||
### Memory Management
|
### Memory Management
|
||||||
|
|
||||||
For large-scale analyses, manage memory explicitly:
|
For large-scale analyses:
|
||||||
|
|
||||||
```python
|
```python
|
||||||
import gc
|
|
||||||
|
|
||||||
# Process datasets in chunks
|
# Process datasets in chunks
|
||||||
for chunk_id in range(num_chunks):
|
chunk_results = []
|
||||||
agent.go(f"Process data chunk {chunk_id} located at data/chunk_{chunk_id}.h5ad")
|
for chunk in dataset_chunks:
|
||||||
|
agent.reset() # Clear memory between chunks
|
||||||
|
result = agent.go(f"Analyze chunk: {chunk}")
|
||||||
|
chunk_results.append(result)
|
||||||
|
|
||||||
# Force garbage collection between chunks
|
# Combine results
|
||||||
gc.collect()
|
final_result = combine_results(chunk_results)
|
||||||
|
|
||||||
# Save intermediate results
|
|
||||||
agent.save_conversation_history(f"./reports/chunk_{chunk_id}.pdf")
|
|
||||||
```
|
|
||||||
|
|
||||||
### Reproducibility
|
|
||||||
|
|
||||||
Ensure reproducible analyses by:
|
|
||||||
|
|
||||||
1. **Fixing random seeds:**
|
|
||||||
```python
|
|
||||||
agent.go("Set random seed to 42 for all analyses, then perform clustering...")
|
|
||||||
```
|
|
||||||
|
|
||||||
2. **Logging configuration:**
|
|
||||||
```python
|
|
||||||
import json
|
|
||||||
config_log = {
|
|
||||||
'llm': default_config.llm,
|
|
||||||
'timeout': default_config.timeout_seconds,
|
|
||||||
'data_path': default_config.data_path,
|
|
||||||
'timestamp': datetime.now().isoformat()
|
|
||||||
}
|
|
||||||
with open('config_log.json', 'w') as f:
|
|
||||||
json.dump(config_log, f, indent=2)
|
|
||||||
```
|
|
||||||
|
|
||||||
3. **Saving execution traces:**
|
|
||||||
```python
|
|
||||||
# Always save detailed reports
|
|
||||||
agent.save_conversation_history('./reports/full_analysis.pdf')
|
|
||||||
```
|
|
||||||
|
|
||||||
## Performance Optimization
|
|
||||||
|
|
||||||
### Model Selection Strategy
|
|
||||||
|
|
||||||
Choose models based on task characteristics:
|
|
||||||
|
|
||||||
```python
|
|
||||||
# For exploratory, simple tasks
|
|
||||||
default_config.llm = "gpt-3.5-turbo" # Fast, cost-effective
|
|
||||||
|
|
||||||
# For standard biomedical analyses
|
|
||||||
default_config.llm = "claude-sonnet-4-20250514" # Recommended
|
|
||||||
|
|
||||||
# For complex reasoning and hypothesis generation
|
|
||||||
default_config.llm = "claude-opus-4-20250514" # Highest quality
|
|
||||||
|
|
||||||
# For specialized biological reasoning
|
|
||||||
default_config.llm = "openai/biomni-r0" # Requires local deployment
|
|
||||||
```
|
|
||||||
|
|
||||||
### Timeout Tuning
|
|
||||||
|
|
||||||
Set appropriate timeouts based on task complexity:
|
|
||||||
|
|
||||||
```python
|
|
||||||
# Quick queries and simple analyses
|
|
||||||
agent = A1(path='./data', timeout=300)
|
|
||||||
|
|
||||||
# Standard workflows
|
|
||||||
agent = A1(path='./data', timeout=1200)
|
|
||||||
|
|
||||||
# Full pipelines with ML training
|
|
||||||
agent = A1(path='./data', timeout=3600)
|
|
||||||
```
|
|
||||||
|
|
||||||
### Caching and Reuse
|
|
||||||
|
|
||||||
Reuse agent instances for multiple related tasks:
|
|
||||||
|
|
||||||
```python
|
|
||||||
# Create agent once
|
|
||||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
|
||||||
|
|
||||||
# Execute multiple related tasks
|
|
||||||
tasks = [
|
|
||||||
"Load and QC the scRNA-seq dataset",
|
|
||||||
"Perform clustering with resolution 0.5",
|
|
||||||
"Identify marker genes for each cluster",
|
|
||||||
"Annotate cell types based on markers"
|
|
||||||
]
|
|
||||||
|
|
||||||
for task in tasks:
|
|
||||||
agent.go(task)
|
|
||||||
|
|
||||||
# Save complete workflow
|
|
||||||
agent.save_conversation_history('./reports/full_workflow.pdf')
|
|
||||||
```
|
```
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
867
scientific-packages/biomni/references/use_cases.md
Normal file
867
scientific-packages/biomni/references/use_cases.md
Normal file
@@ -0,0 +1,867 @@
|
|||||||
|
# Biomni Use Cases and Examples
|
||||||
|
|
||||||
|
Comprehensive examples demonstrating biomni across biomedical research domains.
|
||||||
|
|
||||||
|
## Table of Contents
|
||||||
|
|
||||||
|
1. [CRISPR Screening and Gene Editing](#crispr-screening-and-gene-editing)
|
||||||
|
2. [Single-Cell RNA-seq Analysis](#single-cell-rna-seq-analysis)
|
||||||
|
3. [Drug Discovery and ADMET](#drug-discovery-and-admet)
|
||||||
|
4. [GWAS and Genetic Analysis](#gwas-and-genetic-analysis)
|
||||||
|
5. [Clinical Genomics and Diagnostics](#clinical-genomics-and-diagnostics)
|
||||||
|
6. [Protein Structure and Function](#protein-structure-and-function)
|
||||||
|
7. [Literature and Knowledge Synthesis](#literature-and-knowledge-synthesis)
|
||||||
|
8. [Multi-Omics Integration](#multi-omics-integration)
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## CRISPR Screening and Gene Editing
|
||||||
|
|
||||||
|
### Example 1: Genome-Wide CRISPR Screen Design
|
||||||
|
|
||||||
|
**Task:** Design a CRISPR knockout screen to identify genes regulating autophagy.
|
||||||
|
|
||||||
|
```python
|
||||||
|
from biomni.agent import A1
|
||||||
|
|
||||||
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
result = agent.go("""
|
||||||
|
Design a genome-wide CRISPR knockout screen to identify genes regulating
|
||||||
|
autophagy in HEK293 cells.
|
||||||
|
|
||||||
|
Requirements:
|
||||||
|
1. Generate comprehensive sgRNA library targeting all protein-coding genes
|
||||||
|
2. Design 4 sgRNAs per gene with optimal on-target and minimal off-target scores
|
||||||
|
3. Include positive controls (known autophagy regulators: ATG5, BECN1, ULK1)
|
||||||
|
4. Include negative controls (non-targeting sgRNAs)
|
||||||
|
5. Prioritize genes based on:
|
||||||
|
- Existing autophagy pathway annotations
|
||||||
|
- Protein-protein interactions with known autophagy factors
|
||||||
|
- Expression levels in HEK293 cells
|
||||||
|
6. Output sgRNA sequences, scores, and gene prioritization rankings
|
||||||
|
|
||||||
|
Provide analysis as Python code and interpret results.
|
||||||
|
""")
|
||||||
|
|
||||||
|
agent.save_conversation_history("autophagy_screen_design.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
**Expected Output:**
|
||||||
|
- sgRNA library with ~80,000 guides (4 per gene × ~20,000 genes)
|
||||||
|
- On-target and off-target scores for each sgRNA
|
||||||
|
- Prioritized gene list based on pathway enrichment
|
||||||
|
- Quality control metrics for library design
|
||||||
|
|
||||||
|
### Example 2: CRISPR Off-Target Prediction
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Analyze potential off-target effects for this sgRNA sequence:
|
||||||
|
GCTGAAGATCCAGTTCGATG
|
||||||
|
|
||||||
|
Tasks:
|
||||||
|
1. Identify all genomic locations with ≤3 mismatches
|
||||||
|
2. Score each potential off-target site
|
||||||
|
3. Assess likelihood of cleavage at off-target sites
|
||||||
|
4. Recommend whether sgRNA is suitable for use
|
||||||
|
5. If unsuitable, suggest alternative sgRNAs for the same gene
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 3: Screen Hit Analysis
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Analyze CRISPR screen results from autophagy phenotype screen.
|
||||||
|
|
||||||
|
Input file: screen_results.csv
|
||||||
|
Columns: sgRNA_ID, gene, log2_fold_change, p_value, FDR
|
||||||
|
|
||||||
|
Tasks:
|
||||||
|
1. Identify significant hits (FDR < 0.05, |LFC| > 1.5)
|
||||||
|
2. Perform gene ontology enrichment on hit genes
|
||||||
|
3. Map hits to known autophagy pathways
|
||||||
|
4. Identify novel candidates not previously linked to autophagy
|
||||||
|
5. Predict functional relationships between hit genes
|
||||||
|
6. Generate visualization of hit genes in pathway context
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Single-Cell RNA-seq Analysis
|
||||||
|
|
||||||
|
### Example 1: Cell Type Annotation
|
||||||
|
|
||||||
|
**Task:** Analyze single-cell RNA-seq data and annotate cell populations.
|
||||||
|
|
||||||
|
```python
|
||||||
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
result = agent.go("""
|
||||||
|
Analyze single-cell RNA-seq dataset from human PBMC sample.
|
||||||
|
|
||||||
|
File: pbmc_data.h5ad (10X Genomics format)
|
||||||
|
|
||||||
|
Workflow:
|
||||||
|
1. Quality control:
|
||||||
|
- Filter cells with <200 or >5000 detected genes
|
||||||
|
- Remove cells with >20% mitochondrial content
|
||||||
|
- Filter genes detected in <3 cells
|
||||||
|
|
||||||
|
2. Normalization and preprocessing:
|
||||||
|
- Normalize to 10,000 reads per cell
|
||||||
|
- Log-transform
|
||||||
|
- Identify highly variable genes
|
||||||
|
- Scale data
|
||||||
|
|
||||||
|
3. Dimensionality reduction:
|
||||||
|
- PCA (50 components)
|
||||||
|
- UMAP visualization
|
||||||
|
|
||||||
|
4. Clustering:
|
||||||
|
- Leiden algorithm with resolution=0.8
|
||||||
|
- Identify cluster markers (Wilcoxon rank-sum test)
|
||||||
|
|
||||||
|
5. Cell type annotation:
|
||||||
|
- Annotate clusters using marker genes:
|
||||||
|
* T cells (CD3D, CD3E)
|
||||||
|
* B cells (CD79A, MS4A1)
|
||||||
|
* NK cells (GNLY, NKG7)
|
||||||
|
* Monocytes (CD14, LYZ)
|
||||||
|
* Dendritic cells (FCER1A, CST3)
|
||||||
|
|
||||||
|
6. Generate UMAP plots with annotations and export results
|
||||||
|
""")
|
||||||
|
|
||||||
|
agent.save_conversation_history("pbmc_scrna_analysis.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 2: Differential Expression Analysis
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Perform differential expression analysis between conditions in scRNA-seq data.
|
||||||
|
|
||||||
|
Data: pbmc_treated_vs_control.h5ad
|
||||||
|
Conditions: treated (drug X) vs control
|
||||||
|
|
||||||
|
Tasks:
|
||||||
|
1. Identify differentially expressed genes for each cell type
|
||||||
|
2. Use statistical tests appropriate for scRNA-seq (MAST or Wilcoxon)
|
||||||
|
3. Apply multiple testing correction (Benjamini-Hochberg)
|
||||||
|
4. Threshold: |log2FC| > 0.5, adjusted p < 0.05
|
||||||
|
5. Perform pathway enrichment on DE genes per cell type
|
||||||
|
6. Identify cell-type-specific drug responses
|
||||||
|
7. Generate volcano plots and heatmaps
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 3: Trajectory Analysis
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Perform pseudotime trajectory analysis on differentiation dataset.
|
||||||
|
|
||||||
|
Data: hematopoiesis_scrna.h5ad
|
||||||
|
Starting population: Hematopoietic stem cells (HSCs)
|
||||||
|
|
||||||
|
Analysis:
|
||||||
|
1. Subset to hematopoietic lineages
|
||||||
|
2. Compute diffusion map or PAGA for trajectory inference
|
||||||
|
3. Order cells along pseudotime
|
||||||
|
4. Identify genes with dynamic expression along trajectory
|
||||||
|
5. Cluster genes by expression patterns
|
||||||
|
6. Map trajectories to known differentiation pathways
|
||||||
|
7. Visualize key transcription factors driving differentiation
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Drug Discovery and ADMET
|
||||||
|
|
||||||
|
### Example 1: ADMET Property Prediction
|
||||||
|
|
||||||
|
**Task:** Predict ADMET properties for drug candidates.
|
||||||
|
|
||||||
|
```python
|
||||||
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
result = agent.go("""
|
||||||
|
Predict ADMET properties for these drug candidates:
|
||||||
|
|
||||||
|
Compounds (SMILES format):
|
||||||
|
1. CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5
|
||||||
|
2. CN1CCN(CC1)C2=C(C=C3C(=C2)N=CN=C3NC4=CC=C(C=C4)F)OC
|
||||||
|
3. CC(C)(C)NC(=O)N(CC1=CC=CC=C1)C2CCN(CC2)C(=O)C3=CC4=C(C=C3)OCO4
|
||||||
|
|
||||||
|
For each compound, predict:
|
||||||
|
|
||||||
|
**Absorption:**
|
||||||
|
- Caco-2 permeability (cm/s)
|
||||||
|
- Human intestinal absorption (HIA %)
|
||||||
|
- Oral bioavailability
|
||||||
|
|
||||||
|
**Distribution:**
|
||||||
|
- Plasma protein binding (%)
|
||||||
|
- Blood-brain barrier penetration (BBB+/-)
|
||||||
|
- Volume of distribution (L/kg)
|
||||||
|
|
||||||
|
**Metabolism:**
|
||||||
|
- CYP450 substrate/inhibitor predictions (2D6, 3A4, 2C9, 2C19)
|
||||||
|
- Metabolic stability (T1/2)
|
||||||
|
|
||||||
|
**Excretion:**
|
||||||
|
- Clearance (mL/min/kg)
|
||||||
|
- Half-life (hours)
|
||||||
|
|
||||||
|
**Toxicity:**
|
||||||
|
- hERG IC50 (cardiotoxicity risk)
|
||||||
|
- Hepatotoxicity prediction
|
||||||
|
- Ames mutagenicity
|
||||||
|
- LD50 estimates
|
||||||
|
|
||||||
|
Provide predictions with confidence scores and flag any red flags.
|
||||||
|
""")
|
||||||
|
|
||||||
|
agent.save_conversation_history("admet_predictions.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 2: Target Identification
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Identify potential protein targets for Alzheimer's disease drug development.
|
||||||
|
|
||||||
|
Tasks:
|
||||||
|
1. Query GWAS data for Alzheimer's-associated genes
|
||||||
|
2. Identify genes with druggable domains (kinases, GPCRs, ion channels, etc.)
|
||||||
|
3. Check for brain expression patterns
|
||||||
|
4. Assess disease relevance via literature mining
|
||||||
|
5. Evaluate existing chemical probe availability
|
||||||
|
6. Rank targets by:
|
||||||
|
- Genetic evidence strength
|
||||||
|
- Druggability
|
||||||
|
- Lack of existing therapies
|
||||||
|
7. Suggest target validation experiments
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 3: Virtual Screening
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Perform virtual screening for EGFR kinase inhibitors.
|
||||||
|
|
||||||
|
Database: ZINC15 lead-like subset (~6M compounds)
|
||||||
|
Target: EGFR kinase domain (PDB: 1M17)
|
||||||
|
|
||||||
|
Workflow:
|
||||||
|
1. Prepare protein structure (remove waters, add hydrogens)
|
||||||
|
2. Define binding pocket (based on erlotinib binding site)
|
||||||
|
3. Generate pharmacophore model from known EGFR inhibitors
|
||||||
|
4. Filter ZINC database by:
|
||||||
|
- Molecular weight: 200-500 Da
|
||||||
|
- LogP: 0-5
|
||||||
|
- Lipinski's rule of five
|
||||||
|
- Pharmacophore match
|
||||||
|
5. Dock top 10,000 compounds
|
||||||
|
6. Score by docking energy and predicted binding affinity
|
||||||
|
7. Select top 100 for further analysis
|
||||||
|
8. Predict ADMET properties for top hits
|
||||||
|
9. Recommend top 10 compounds for experimental validation
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## GWAS and Genetic Analysis
|
||||||
|
|
||||||
|
### Example 1: GWAS Summary Statistics Analysis
|
||||||
|
|
||||||
|
**Task:** Interpret GWAS results and identify causal genes.
|
||||||
|
|
||||||
|
```python
|
||||||
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
result = agent.go("""
|
||||||
|
Analyze GWAS summary statistics for Type 2 Diabetes.
|
||||||
|
|
||||||
|
Input file: t2d_gwas_summary.txt
|
||||||
|
Columns: CHR, BP, SNP, P, OR, BETA, SE, A1, A2
|
||||||
|
|
||||||
|
Analysis steps:
|
||||||
|
1. Identify genome-wide significant variants (P < 5e-8)
|
||||||
|
2. Perform LD clumping to identify independent signals
|
||||||
|
3. Map variants to genes using:
|
||||||
|
- Nearest gene
|
||||||
|
- eQTL databases (GTEx)
|
||||||
|
- Hi-C chromatin interactions
|
||||||
|
4. Prioritize causal genes using multiple evidence:
|
||||||
|
- Fine-mapping scores
|
||||||
|
- Coding variant consequences
|
||||||
|
- Gene expression in relevant tissues (pancreas, liver, adipose)
|
||||||
|
- Pathway enrichment
|
||||||
|
5. Identify druggable targets among causal genes
|
||||||
|
6. Compare with known T2D genes and highlight novel associations
|
||||||
|
7. Generate Manhattan plot, QQ plot, and gene prioritization table
|
||||||
|
""")
|
||||||
|
|
||||||
|
agent.save_conversation_history("t2d_gwas_analysis.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 2: Polygenic Risk Score
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Develop and validate polygenic risk score (PRS) for coronary artery disease (CAD).
|
||||||
|
|
||||||
|
Training GWAS: CAD_discovery_summary_stats.txt (N=180,000)
|
||||||
|
Validation cohort: CAD_validation_genotypes.vcf (N=50,000)
|
||||||
|
|
||||||
|
Tasks:
|
||||||
|
1. Select variants for PRS using p-value thresholding (P < 1e-5)
|
||||||
|
2. Perform LD clumping (r² < 0.1, 500kb window)
|
||||||
|
3. Calculate PRS weights from GWAS betas
|
||||||
|
4. Compute PRS for validation cohort individuals
|
||||||
|
5. Evaluate PRS performance:
|
||||||
|
- AUC for CAD case/control discrimination
|
||||||
|
- Odds ratios across PRS deciles
|
||||||
|
- Compare to traditional risk factors (age, sex, BMI, smoking)
|
||||||
|
6. Assess PRS calibration and create risk stratification plot
|
||||||
|
7. Identify high-risk individuals (top 5% PRS)
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 3: Variant Pathogenicity Prediction
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Predict pathogenicity of rare coding variants in candidate disease genes.
|
||||||
|
|
||||||
|
Variants (VCF format):
|
||||||
|
- chr17:41234451:A>G (BRCA1 p.Arg1347Gly)
|
||||||
|
- chr2:179428448:C>T (TTN p.Trp13579*)
|
||||||
|
- chr7:117188679:G>A (CFTR p.Gly542Ser)
|
||||||
|
|
||||||
|
For each variant, assess:
|
||||||
|
1. In silico predictions (SIFT, PolyPhen2, CADD, REVEL)
|
||||||
|
2. Population frequency (gnomAD)
|
||||||
|
3. Evolutionary conservation (PhyloP, PhastCons)
|
||||||
|
4. Protein structure impact (using AlphaFold structures)
|
||||||
|
5. Functional domain location
|
||||||
|
6. ClinVar annotations (if available)
|
||||||
|
7. Literature evidence
|
||||||
|
8. ACMG/AMP classification criteria
|
||||||
|
|
||||||
|
Provide pathogenicity classification (benign, likely benign, VUS, likely pathogenic, pathogenic) with supporting evidence.
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Clinical Genomics and Diagnostics
|
||||||
|
|
||||||
|
### Example 1: Rare Disease Diagnosis
|
||||||
|
|
||||||
|
**Task:** Diagnose rare genetic disease from whole exome sequencing.
|
||||||
|
|
||||||
|
```python
|
||||||
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
result = agent.go("""
|
||||||
|
Analyze whole exome sequencing (WES) data for rare disease diagnosis.
|
||||||
|
|
||||||
|
Patient phenotypes (HPO terms):
|
||||||
|
- HP:0001250 (Seizures)
|
||||||
|
- HP:0001249 (Intellectual disability)
|
||||||
|
- HP:0001263 (Global developmental delay)
|
||||||
|
- HP:0001252 (Hypotonia)
|
||||||
|
|
||||||
|
VCF file: patient_trio.vcf (proband + parents)
|
||||||
|
|
||||||
|
Analysis workflow:
|
||||||
|
1. Variant filtering:
|
||||||
|
- Quality filters (QUAL > 30, DP > 10, GQ > 20)
|
||||||
|
- Frequency filters (gnomAD AF < 0.01)
|
||||||
|
- Functional impact (missense, nonsense, frameshift, splice site)
|
||||||
|
|
||||||
|
2. Inheritance pattern analysis:
|
||||||
|
- De novo variants
|
||||||
|
- Autosomal recessive (compound het, homozygous)
|
||||||
|
- X-linked
|
||||||
|
|
||||||
|
3. Phenotype-driven prioritization:
|
||||||
|
- Match candidate genes to HPO terms
|
||||||
|
- Use HPO-gene associations
|
||||||
|
- Check gene expression in relevant tissues (brain)
|
||||||
|
|
||||||
|
4. Variant pathogenicity assessment:
|
||||||
|
- In silico predictions
|
||||||
|
- ACMG classification
|
||||||
|
- Literature evidence
|
||||||
|
|
||||||
|
5. Generate diagnostic report with:
|
||||||
|
- Top candidate variants
|
||||||
|
- Supporting evidence
|
||||||
|
- Functional validation suggestions
|
||||||
|
- Genetic counseling recommendations
|
||||||
|
""")
|
||||||
|
|
||||||
|
agent.save_conversation_history("rare_disease_diagnosis.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 2: Cancer Genomics Analysis
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Analyze tumor-normal paired sequencing for cancer genomics.
|
||||||
|
|
||||||
|
Files:
|
||||||
|
- tumor_sample.vcf (somatic variants)
|
||||||
|
- tumor_rnaseq.bam (gene expression)
|
||||||
|
- tumor_cnv.seg (copy number variants)
|
||||||
|
|
||||||
|
Analysis:
|
||||||
|
1. Identify driver mutations:
|
||||||
|
- Known cancer genes (COSMIC, OncoKB)
|
||||||
|
- Recurrent hotspot mutations
|
||||||
|
- Truncating mutations in tumor suppressors
|
||||||
|
|
||||||
|
2. Analyze mutational signatures:
|
||||||
|
- Decompose signatures (COSMIC signatures)
|
||||||
|
- Identify mutagenic processes
|
||||||
|
|
||||||
|
3. Copy number analysis:
|
||||||
|
- Identify amplifications and deletions
|
||||||
|
- Focal vs. arm-level events
|
||||||
|
- Assess oncogene amplifications and TSG deletions
|
||||||
|
|
||||||
|
4. Gene expression analysis:
|
||||||
|
- Identify outlier gene expression
|
||||||
|
- Fusion transcript detection
|
||||||
|
- Pathway dysregulation
|
||||||
|
|
||||||
|
5. Therapeutic implications:
|
||||||
|
- Match alterations to FDA-approved therapies
|
||||||
|
- Identify clinical trial opportunities
|
||||||
|
- Predict response to targeted therapies
|
||||||
|
|
||||||
|
6. Generate precision oncology report
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 3: Pharmacogenomics
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Generate pharmacogenomics report for patient genotype data.
|
||||||
|
|
||||||
|
VCF file: patient_pgx.vcf
|
||||||
|
|
||||||
|
Analyze variants affecting drug metabolism:
|
||||||
|
|
||||||
|
**CYP450 genes:**
|
||||||
|
- CYP2D6 (affects ~25% of drugs)
|
||||||
|
- CYP2C19 (clopidogrel, PPIs, antidepressants)
|
||||||
|
- CYP2C9 (warfarin, NSAIDs)
|
||||||
|
- CYP3A5 (tacrolimus, immunosuppressants)
|
||||||
|
|
||||||
|
**Drug transporter genes:**
|
||||||
|
- SLCO1B1 (statin myopathy risk)
|
||||||
|
- ABCB1 (P-glycoprotein)
|
||||||
|
|
||||||
|
**Drug targets:**
|
||||||
|
- VKORC1 (warfarin dosing)
|
||||||
|
- DPYD (fluoropyrimidine toxicity)
|
||||||
|
- TPMT (thiopurine toxicity)
|
||||||
|
|
||||||
|
For each gene:
|
||||||
|
1. Determine diplotype (*1/*1, *1/*2, etc.)
|
||||||
|
2. Assign metabolizer phenotype (PM, IM, NM, RM, UM)
|
||||||
|
3. Provide dosing recommendations using CPIC/PharmGKB guidelines
|
||||||
|
4. Flag high-risk drug-gene interactions
|
||||||
|
5. Suggest alternative medications if needed
|
||||||
|
|
||||||
|
Generate patient-friendly report with actionable recommendations.
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Protein Structure and Function
|
||||||
|
|
||||||
|
### Example 1: AlphaFold Structure Analysis
|
||||||
|
|
||||||
|
```python
|
||||||
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
result = agent.go("""
|
||||||
|
Analyze AlphaFold structure prediction for novel protein.
|
||||||
|
|
||||||
|
Protein: Hypothetical protein ABC123 (UniProt: Q9XYZ1)
|
||||||
|
|
||||||
|
Tasks:
|
||||||
|
1. Retrieve AlphaFold structure from database
|
||||||
|
2. Assess prediction quality:
|
||||||
|
- pLDDT scores per residue
|
||||||
|
- Identify high-confidence regions (pLDDT > 90)
|
||||||
|
- Flag low-confidence regions (pLDDT < 50)
|
||||||
|
|
||||||
|
3. Structural analysis:
|
||||||
|
- Identify domains using structural alignment
|
||||||
|
- Predict fold family
|
||||||
|
- Identify secondary structure elements
|
||||||
|
|
||||||
|
4. Functional prediction:
|
||||||
|
- Search for structural homologs in PDB
|
||||||
|
- Identify conserved functional sites
|
||||||
|
- Predict binding pockets
|
||||||
|
- Suggest possible ligands/substrates
|
||||||
|
|
||||||
|
5. Variant impact analysis:
|
||||||
|
- Map disease-associated variants to structure
|
||||||
|
- Predict structural consequences
|
||||||
|
- Identify variants affecting binding sites
|
||||||
|
|
||||||
|
6. Generate PyMOL visualization scripts highlighting key features
|
||||||
|
""")
|
||||||
|
|
||||||
|
agent.save_conversation_history("alphafold_analysis.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 2: Protein-Protein Interaction Prediction
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Predict and analyze protein-protein interactions for autophagy pathway.
|
||||||
|
|
||||||
|
Query proteins: ATG5, ATG12, ATG16L1
|
||||||
|
|
||||||
|
Analysis:
|
||||||
|
1. Retrieve known interactions from:
|
||||||
|
- STRING database
|
||||||
|
- BioGRID
|
||||||
|
- IntAct
|
||||||
|
- Literature mining
|
||||||
|
|
||||||
|
2. Predict novel interactions using:
|
||||||
|
- Structural modeling (AlphaFold-Multimer)
|
||||||
|
- Coexpression analysis
|
||||||
|
- Phylogenetic profiling
|
||||||
|
|
||||||
|
3. Analyze interaction interfaces:
|
||||||
|
- Identify binding residues
|
||||||
|
- Assess interface properties (area, hydrophobicity)
|
||||||
|
- Predict binding affinity
|
||||||
|
|
||||||
|
4. Functional analysis:
|
||||||
|
- Map interactions to autophagy pathway steps
|
||||||
|
- Identify regulatory interactions
|
||||||
|
- Predict complex stoichiometry
|
||||||
|
|
||||||
|
5. Therapeutic implications:
|
||||||
|
- Identify druggable interfaces
|
||||||
|
- Suggest peptide inhibitors
|
||||||
|
- Design disruption strategies
|
||||||
|
|
||||||
|
Generate network visualization and interaction details.
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Literature and Knowledge Synthesis
|
||||||
|
|
||||||
|
### Example 1: Systematic Literature Review
|
||||||
|
|
||||||
|
```python
|
||||||
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
result = agent.go("""
|
||||||
|
Perform systematic literature review on CRISPR base editing applications.
|
||||||
|
|
||||||
|
Search query: "CRISPR base editing" OR "base editor" OR "CBE" OR "ABE"
|
||||||
|
Date range: 2016-2025
|
||||||
|
|
||||||
|
Tasks:
|
||||||
|
1. Search PubMed and retrieve relevant abstracts
|
||||||
|
2. Filter for original research articles
|
||||||
|
3. Extract key information:
|
||||||
|
- Base editor type (CBE, ABE, dual)
|
||||||
|
- Target organism/cell type
|
||||||
|
- Application (disease model, therapy, crop improvement)
|
||||||
|
- Editing efficiency
|
||||||
|
- Off-target assessment
|
||||||
|
|
||||||
|
4. Categorize applications:
|
||||||
|
- Therapeutic applications (by disease)
|
||||||
|
- Agricultural applications
|
||||||
|
- Basic research
|
||||||
|
|
||||||
|
5. Analyze trends:
|
||||||
|
- Publications over time
|
||||||
|
- Most studied diseases
|
||||||
|
- Evolution of base editor technology
|
||||||
|
|
||||||
|
6. Synthesize findings:
|
||||||
|
- Clinical trial status
|
||||||
|
- Remaining challenges
|
||||||
|
- Future directions
|
||||||
|
|
||||||
|
Generate comprehensive review document with citation statistics.
|
||||||
|
""")
|
||||||
|
|
||||||
|
agent.save_conversation_history("crispr_base_editing_review.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 2: Gene Function Synthesis
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Synthesize knowledge about gene function from multiple sources.
|
||||||
|
|
||||||
|
Target gene: PARK7 (DJ-1)
|
||||||
|
|
||||||
|
Integrate information from:
|
||||||
|
1. **Genetic databases:**
|
||||||
|
- NCBI Gene
|
||||||
|
- UniProt
|
||||||
|
- OMIM
|
||||||
|
|
||||||
|
2. **Expression data:**
|
||||||
|
- GTEx tissue expression
|
||||||
|
- Human Protein Atlas
|
||||||
|
- Single-cell expression atlases
|
||||||
|
|
||||||
|
3. **Functional data:**
|
||||||
|
- GO annotations
|
||||||
|
- KEGG pathways
|
||||||
|
- Reactome
|
||||||
|
- Protein interactions (STRING)
|
||||||
|
|
||||||
|
4. **Disease associations:**
|
||||||
|
- ClinVar variants
|
||||||
|
- GWAS catalog
|
||||||
|
- Disease databases (DisGeNET)
|
||||||
|
|
||||||
|
5. **Literature:**
|
||||||
|
- PubMed abstracts
|
||||||
|
- Key mechanistic studies
|
||||||
|
- Review articles
|
||||||
|
|
||||||
|
Synthesize into comprehensive gene report:
|
||||||
|
- Molecular function
|
||||||
|
- Biological processes
|
||||||
|
- Cellular localization
|
||||||
|
- Tissue distribution
|
||||||
|
- Disease associations
|
||||||
|
- Known drug targets/inhibitors
|
||||||
|
- Unresolved questions
|
||||||
|
|
||||||
|
Generate structured summary suitable for research planning.
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Multi-Omics Integration
|
||||||
|
|
||||||
|
### Example 1: Multi-Omics Disease Analysis
|
||||||
|
|
||||||
|
```python
|
||||||
|
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
result = agent.go("""
|
||||||
|
Integrate multi-omics data to understand disease mechanism.
|
||||||
|
|
||||||
|
Disease: Alzheimer's disease
|
||||||
|
Data types:
|
||||||
|
- Genomics: GWAS summary statistics (gwas_ad.txt)
|
||||||
|
- Transcriptomics: Brain RNA-seq (controls vs AD, rnaseq_data.csv)
|
||||||
|
- Proteomics: CSF proteomics (proteomics_csf.csv)
|
||||||
|
- Metabolomics: Plasma metabolomics (metabolomics_plasma.csv)
|
||||||
|
- Epigenomics: Brain methylation array (methylation_data.csv)
|
||||||
|
|
||||||
|
Integration workflow:
|
||||||
|
1. Analyze each omics layer independently:
|
||||||
|
- Identify significantly altered features
|
||||||
|
- Perform pathway enrichment
|
||||||
|
|
||||||
|
2. Cross-omics correlation:
|
||||||
|
- Correlate gene expression with protein levels
|
||||||
|
- Link genetic variants to expression (eQTL)
|
||||||
|
- Associate methylation with gene expression
|
||||||
|
- Connect proteins to metabolites
|
||||||
|
|
||||||
|
3. Network analysis:
|
||||||
|
- Build multi-omics network
|
||||||
|
- Identify key hub genes/proteins
|
||||||
|
- Detect disease modules
|
||||||
|
|
||||||
|
4. Causal inference:
|
||||||
|
- Prioritize drivers vs. consequences
|
||||||
|
- Identify therapeutic targets
|
||||||
|
- Predict drug mechanisms
|
||||||
|
|
||||||
|
5. Generate integrative model of AD pathogenesis
|
||||||
|
|
||||||
|
Provide visualization and therapeutic target recommendations.
|
||||||
|
""")
|
||||||
|
|
||||||
|
agent.save_conversation_history("ad_multiomics_analysis.pdf")
|
||||||
|
```
|
||||||
|
|
||||||
|
### Example 2: Systems Biology Modeling
|
||||||
|
|
||||||
|
```python
|
||||||
|
result = agent.go("""
|
||||||
|
Build systems biology model of metabolic pathway.
|
||||||
|
|
||||||
|
Pathway: Glycolysis
|
||||||
|
Data sources:
|
||||||
|
- Enzyme kinetics (BRENDA database)
|
||||||
|
- Metabolite concentrations (literature)
|
||||||
|
- Gene expression (tissue-specific, GTEx)
|
||||||
|
- Flux measurements (C13 labeling studies)
|
||||||
|
|
||||||
|
Modeling tasks:
|
||||||
|
1. Construct pathway model:
|
||||||
|
- Define reactions and stoichiometry
|
||||||
|
- Parameterize enzyme kinetics (Km, Vmax, Ki)
|
||||||
|
- Set initial metabolite concentrations
|
||||||
|
|
||||||
|
2. Simulate pathway dynamics:
|
||||||
|
- Steady-state analysis
|
||||||
|
- Time-course simulations
|
||||||
|
- Sensitivity analysis
|
||||||
|
|
||||||
|
3. Constraint-based modeling:
|
||||||
|
- Flux balance analysis (FBA)
|
||||||
|
- Identify bottleneck reactions
|
||||||
|
- Predict metabolic engineering strategies
|
||||||
|
|
||||||
|
4. Integrate with gene expression:
|
||||||
|
- Tissue-specific model predictions
|
||||||
|
- Disease vs. normal comparisons
|
||||||
|
|
||||||
|
5. Therapeutic predictions:
|
||||||
|
- Enzyme inhibition effects
|
||||||
|
- Metabolic rescue strategies
|
||||||
|
- Drug target identification
|
||||||
|
|
||||||
|
Generate model in SBML format and simulation results.
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Best Practices for Task Formulation
|
||||||
|
|
||||||
|
### 1. Be Specific and Detailed
|
||||||
|
|
||||||
|
**Poor:**
|
||||||
|
```python
|
||||||
|
agent.go("Analyze this RNA-seq data")
|
||||||
|
```
|
||||||
|
|
||||||
|
**Good:**
|
||||||
|
```python
|
||||||
|
agent.go("""
|
||||||
|
Analyze bulk RNA-seq data from cancer vs. normal samples.
|
||||||
|
|
||||||
|
Files: cancer_rnaseq.csv (TPM values, 50 cancer, 50 normal)
|
||||||
|
|
||||||
|
Tasks:
|
||||||
|
1. Differential expression (DESeq2, padj < 0.05, |log2FC| > 1)
|
||||||
|
2. Pathway enrichment (KEGG, Reactome)
|
||||||
|
3. Generate volcano plot and top DE gene heatmap
|
||||||
|
""")
|
||||||
|
```
|
||||||
|
|
||||||
|
### 2. Include File Paths and Formats
|
||||||
|
|
||||||
|
Always specify:
|
||||||
|
- Exact file paths
|
||||||
|
- File formats (VCF, BAM, CSV, H5AD, etc.)
|
||||||
|
- Data structure (columns, sample IDs)
|
||||||
|
|
||||||
|
### 3. Set Clear Success Criteria
|
||||||
|
|
||||||
|
Define thresholds and cutoffs:
|
||||||
|
- Statistical significance (P < 0.05, FDR < 0.1)
|
||||||
|
- Fold change thresholds
|
||||||
|
- Quality filters
|
||||||
|
- Expected outputs
|
||||||
|
|
||||||
|
### 4. Request Visualizations
|
||||||
|
|
||||||
|
Explicitly ask for plots:
|
||||||
|
- Volcano plots, MA plots
|
||||||
|
- Heatmaps, PCA plots
|
||||||
|
- Network diagrams
|
||||||
|
- Manhattan plots
|
||||||
|
|
||||||
|
### 5. Specify Biological Context
|
||||||
|
|
||||||
|
Include:
|
||||||
|
- Organism (human, mouse, etc.)
|
||||||
|
- Tissue/cell type
|
||||||
|
- Disease/condition
|
||||||
|
- Treatment details
|
||||||
|
|
||||||
|
### 6. Request Interpretations
|
||||||
|
|
||||||
|
Ask agent to:
|
||||||
|
- Interpret biological significance
|
||||||
|
- Suggest follow-up experiments
|
||||||
|
- Identify limitations
|
||||||
|
- Provide literature context
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Common Patterns
|
||||||
|
|
||||||
|
### Data Quality Control
|
||||||
|
|
||||||
|
```python
|
||||||
|
"""
|
||||||
|
Before analysis, perform quality control:
|
||||||
|
1. Check for missing values
|
||||||
|
2. Assess data distributions
|
||||||
|
3. Identify outliers
|
||||||
|
4. Generate QC report
|
||||||
|
Only proceed with analysis if data passes QC.
|
||||||
|
"""
|
||||||
|
```
|
||||||
|
|
||||||
|
### Iterative Refinement
|
||||||
|
|
||||||
|
```python
|
||||||
|
"""
|
||||||
|
Perform analysis in stages:
|
||||||
|
1. Initial exploratory analysis
|
||||||
|
2. Based on results, refine parameters
|
||||||
|
3. Focus on interesting findings
|
||||||
|
4. Generate final report
|
||||||
|
|
||||||
|
Show intermediate results for each stage.
|
||||||
|
"""
|
||||||
|
```
|
||||||
|
|
||||||
|
### Reproducibility
|
||||||
|
|
||||||
|
```python
|
||||||
|
"""
|
||||||
|
Ensure reproducibility:
|
||||||
|
1. Set random seeds where applicable
|
||||||
|
2. Log all parameters used
|
||||||
|
3. Save intermediate files
|
||||||
|
4. Export environment info (package versions)
|
||||||
|
5. Generate methods section for paper
|
||||||
|
"""
|
||||||
|
```
|
||||||
|
|
||||||
|
These examples demonstrate the breadth of biomedical tasks biomni can handle. Adapt the patterns to your specific research questions, and always include sufficient detail for the agent to execute autonomously.
|
||||||
541
scientific-packages/biomni/scripts/generate_report.py
Normal file → Executable file
541
scientific-packages/biomni/scripts/generate_report.py
Normal file → Executable file
@@ -1,109 +1,128 @@
|
|||||||
#!/usr/bin/env python3
|
#!/usr/bin/env python3
|
||||||
"""
|
"""
|
||||||
Enhanced PDF Report Generation for Biomni
|
Enhanced PDF report generation for biomni conversation histories.
|
||||||
|
|
||||||
This script provides advanced PDF report generation with custom formatting,
|
This script provides additional customization options for biomni reports:
|
||||||
styling, and metadata for Biomni analysis results.
|
- Custom styling and branding
|
||||||
|
- Formatted code blocks
|
||||||
|
- Section organization
|
||||||
|
- Metadata inclusion
|
||||||
|
- Export format options (PDF, HTML, Markdown)
|
||||||
|
|
||||||
|
Usage:
|
||||||
|
python generate_report.py --input conversation.json --output report.pdf
|
||||||
|
python generate_report.py --agent-object agent --output report.pdf --format html
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import argparse
|
import argparse
|
||||||
import sys
|
import json
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
from typing import Dict, List, Optional, Any
|
||||||
from datetime import datetime
|
from datetime import datetime
|
||||||
from typing import Optional, Dict, Any
|
|
||||||
|
|
||||||
|
|
||||||
def generate_markdown_report(
|
def format_conversation_history(
|
||||||
title: str,
|
messages: List[Dict[str, Any]],
|
||||||
sections: list,
|
include_metadata: bool = True,
|
||||||
metadata: Optional[Dict[str, Any]] = None,
|
include_code: bool = True,
|
||||||
output_path: str = "report.md"
|
include_timestamps: bool = False
|
||||||
) -> str:
|
) -> str:
|
||||||
"""
|
"""
|
||||||
Generate a formatted markdown report.
|
Format conversation history into structured markdown.
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
title: Report title
|
messages: List of conversation message dictionaries
|
||||||
sections: List of dicts with 'heading' and 'content' keys
|
include_metadata: Include metadata section
|
||||||
metadata: Optional metadata dict (author, date, etc.)
|
include_code: Include code blocks
|
||||||
output_path: Path to save markdown file
|
include_timestamps: Include message timestamps
|
||||||
|
|
||||||
Returns:
|
Returns:
|
||||||
Path to generated markdown file
|
Formatted markdown string
|
||||||
"""
|
"""
|
||||||
md_content = []
|
sections = []
|
||||||
|
|
||||||
# Title
|
# Header
|
||||||
md_content.append(f"# {title}\n")
|
sections.append("# Biomni Analysis Report\n")
|
||||||
|
|
||||||
# Metadata
|
# Metadata
|
||||||
if metadata:
|
if include_metadata:
|
||||||
md_content.append("---\n")
|
sections.append("## Metadata\n")
|
||||||
for key, value in metadata.items():
|
sections.append(f"- **Generated**: {datetime.now().strftime('%Y-%m-%d %H:%M:%S')}")
|
||||||
md_content.append(f"**{key}:** {value} \n")
|
sections.append(f"- **Number of interactions**: {len(messages)}")
|
||||||
md_content.append("---\n\n")
|
sections.append("\n---\n")
|
||||||
|
|
||||||
# Sections
|
# Process messages
|
||||||
for section in sections:
|
sections.append("## Analysis\n")
|
||||||
heading = section.get('heading', 'Section')
|
|
||||||
content = section.get('content', '')
|
|
||||||
level = section.get('level', 2) # Default to h2
|
|
||||||
|
|
||||||
md_content.append(f"{'#' * level} {heading}\n\n")
|
for i, msg in enumerate(messages, 1):
|
||||||
md_content.append(f"{content}\n\n")
|
role = msg.get('role', 'unknown')
|
||||||
|
content = msg.get('content', '')
|
||||||
|
|
||||||
# Write to file
|
if role == 'user':
|
||||||
output = Path(output_path)
|
sections.append(f"### Task {i // 2 + 1}\n")
|
||||||
output.write_text('\n'.join(md_content))
|
sections.append(f"**Query:**\n```\n{content}\n```\n")
|
||||||
|
|
||||||
return str(output)
|
elif role == 'assistant':
|
||||||
|
sections.append(f"**Response:**\n")
|
||||||
|
|
||||||
|
# Check if content contains code
|
||||||
|
if include_code and ('```' in content or 'import ' in content):
|
||||||
|
# Attempt to separate text and code
|
||||||
|
parts = content.split('```')
|
||||||
|
for j, part in enumerate(parts):
|
||||||
|
if j % 2 == 0:
|
||||||
|
# Text content
|
||||||
|
if part.strip():
|
||||||
|
sections.append(f"{part.strip()}\n")
|
||||||
|
else:
|
||||||
|
# Code content
|
||||||
|
# Check if language is specified
|
||||||
|
lines = part.split('\n', 1)
|
||||||
|
if len(lines) > 1 and lines[0].strip() in ['python', 'r', 'bash', 'sql']:
|
||||||
|
lang = lines[0].strip()
|
||||||
|
code = lines[1]
|
||||||
|
else:
|
||||||
|
lang = 'python' # Default to python
|
||||||
|
code = part
|
||||||
|
|
||||||
|
sections.append(f"```{lang}\n{code}\n```\n")
|
||||||
|
else:
|
||||||
|
sections.append(f"{content}\n")
|
||||||
|
|
||||||
|
sections.append("\n---\n")
|
||||||
|
|
||||||
|
return '\n'.join(sections)
|
||||||
|
|
||||||
|
|
||||||
def convert_to_pdf_weasyprint(
|
def markdown_to_html(markdown_content: str, title: str = "Biomni Report") -> str:
|
||||||
markdown_path: str,
|
|
||||||
output_path: str,
|
|
||||||
css_style: Optional[str] = None
|
|
||||||
) -> bool:
|
|
||||||
"""
|
"""
|
||||||
Convert markdown to PDF using WeasyPrint.
|
Convert markdown to styled HTML.
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
markdown_path: Path to markdown file
|
markdown_content: Markdown string
|
||||||
output_path: Path for output PDF
|
title: HTML page title
|
||||||
css_style: Optional CSS stylesheet path
|
|
||||||
|
|
||||||
Returns:
|
Returns:
|
||||||
True if successful, False otherwise
|
HTML string
|
||||||
"""
|
"""
|
||||||
try:
|
# Simple markdown to HTML conversion
|
||||||
import markdown
|
# For production use, consider using a library like markdown or mistune
|
||||||
from weasyprint import HTML, CSS
|
|
||||||
|
|
||||||
# Read markdown
|
|
||||||
with open(markdown_path, 'r') as f:
|
|
||||||
md_content = f.read()
|
|
||||||
|
|
||||||
# Convert to HTML
|
|
||||||
html_content = markdown.markdown(
|
|
||||||
md_content,
|
|
||||||
extensions=['tables', 'fenced_code', 'codehilite']
|
|
||||||
)
|
|
||||||
|
|
||||||
# Wrap in HTML template
|
|
||||||
html_template = f"""
|
html_template = f"""
|
||||||
<!DOCTYPE html>
|
<!DOCTYPE html>
|
||||||
<html>
|
<html lang="en">
|
||||||
<head>
|
<head>
|
||||||
<meta charset="utf-8">
|
<meta charset="UTF-8">
|
||||||
<title>Biomni Report</title>
|
<meta name="viewport" content="width=device-width, initial-scale=1.0">
|
||||||
|
<title>{title}</title>
|
||||||
<style>
|
<style>
|
||||||
body {{
|
body {{
|
||||||
font-family: 'Helvetica', 'Arial', sans-serif;
|
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', Roboto, Oxygen, Ubuntu, Cantarell, sans-serif;
|
||||||
line-height: 1.6;
|
line-height: 1.6;
|
||||||
color: #333;
|
max-width: 900px;
|
||||||
max-width: 800px;
|
margin: 0 auto;
|
||||||
margin: 40px auto;
|
|
||||||
padding: 20px;
|
padding: 20px;
|
||||||
|
color: #333;
|
||||||
}}
|
}}
|
||||||
h1 {{
|
h1 {{
|
||||||
color: #2c3e50;
|
color: #2c3e50;
|
||||||
@@ -113,269 +132,239 @@ def convert_to_pdf_weasyprint(
|
|||||||
h2 {{
|
h2 {{
|
||||||
color: #34495e;
|
color: #34495e;
|
||||||
margin-top: 30px;
|
margin-top: 30px;
|
||||||
border-bottom: 1px solid #bdc3c7;
|
border-bottom: 2px solid #95a5a6;
|
||||||
padding-bottom: 5px;
|
padding-bottom: 5px;
|
||||||
}}
|
}}
|
||||||
h3 {{
|
h3 {{
|
||||||
color: #7f8c8d;
|
color: #555;
|
||||||
}}
|
}}
|
||||||
code {{
|
code {{
|
||||||
background-color: #f4f4f4;
|
background-color: #f4f4f4;
|
||||||
padding: 2px 6px;
|
padding: 2px 6px;
|
||||||
border-radius: 3px;
|
border-radius: 3px;
|
||||||
font-family: 'Courier New', monospace;
|
font-family: 'Monaco', 'Menlo', 'Courier New', monospace;
|
||||||
}}
|
}}
|
||||||
pre {{
|
pre {{
|
||||||
background-color: #f4f4f4;
|
background-color: #f8f8f8;
|
||||||
padding: 15px;
|
border: 1px solid #ddd;
|
||||||
border-radius: 5px;
|
border-radius: 5px;
|
||||||
|
padding: 15px;
|
||||||
overflow-x: auto;
|
overflow-x: auto;
|
||||||
}}
|
}}
|
||||||
table {{
|
pre code {{
|
||||||
border-collapse: collapse;
|
background-color: transparent;
|
||||||
width: 100%;
|
padding: 0;
|
||||||
margin: 20px 0;
|
|
||||||
}}
|
}}
|
||||||
th, td {{
|
hr {{
|
||||||
border: 1px solid #ddd;
|
border: none;
|
||||||
padding: 12px;
|
border-top: 1px solid #ddd;
|
||||||
text-align: left;
|
margin: 30px 0;
|
||||||
}}
|
|
||||||
th {{
|
|
||||||
background-color: #3498db;
|
|
||||||
color: white;
|
|
||||||
}}
|
|
||||||
tr:nth-child(even) {{
|
|
||||||
background-color: #f9f9f9;
|
|
||||||
}}
|
}}
|
||||||
.metadata {{
|
.metadata {{
|
||||||
background-color: #ecf0f1;
|
background-color: #ecf0f1;
|
||||||
padding: 15px;
|
padding: 15px;
|
||||||
border-radius: 5px;
|
border-radius: 5px;
|
||||||
|
margin-bottom: 20px;
|
||||||
|
}}
|
||||||
|
.task {{
|
||||||
|
background-color: #e8f4f8;
|
||||||
|
padding: 10px;
|
||||||
|
border-left: 4px solid #3498db;
|
||||||
margin: 20px 0;
|
margin: 20px 0;
|
||||||
}}
|
}}
|
||||||
|
.footer {{
|
||||||
|
margin-top: 50px;
|
||||||
|
text-align: center;
|
||||||
|
color: #7f8c8d;
|
||||||
|
font-size: 0.9em;
|
||||||
|
}}
|
||||||
</style>
|
</style>
|
||||||
</head>
|
</head>
|
||||||
<body>
|
<body>
|
||||||
{html_content}
|
<div class="content">
|
||||||
</body>
|
{markdown_to_html_simple(markdown_content)}
|
||||||
</html>
|
</div>
|
||||||
|
<div class="footer">
|
||||||
|
<p>Generated with Biomni | Stanford SNAP Lab</p>
|
||||||
|
<p><a href="https://github.com/snap-stanford/biomni">github.com/snap-stanford/biomni</a></p>
|
||||||
|
</div>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
|
"""
|
||||||
|
return html_template
|
||||||
|
|
||||||
|
|
||||||
|
def markdown_to_html_simple(md: str) -> str:
|
||||||
|
"""Simple markdown to HTML converter (basic implementation)."""
|
||||||
|
lines = md.split('\n')
|
||||||
|
html_lines = []
|
||||||
|
in_code_block = False
|
||||||
|
in_list = False
|
||||||
|
|
||||||
|
for line in lines:
|
||||||
|
# Code blocks
|
||||||
|
if line.startswith('```'):
|
||||||
|
if in_code_block:
|
||||||
|
html_lines.append('</code></pre>')
|
||||||
|
in_code_block = False
|
||||||
|
else:
|
||||||
|
lang = line[3:].strip()
|
||||||
|
html_lines.append(f'<pre><code class="language-{lang}">')
|
||||||
|
in_code_block = True
|
||||||
|
continue
|
||||||
|
|
||||||
|
if in_code_block:
|
||||||
|
html_lines.append(line)
|
||||||
|
continue
|
||||||
|
|
||||||
|
# Headers
|
||||||
|
if line.startswith('# '):
|
||||||
|
html_lines.append(f'<h1>{line[2:]}</h1>')
|
||||||
|
elif line.startswith('## '):
|
||||||
|
html_lines.append(f'<h2>{line[3:]}</h2>')
|
||||||
|
elif line.startswith('### '):
|
||||||
|
html_lines.append(f'<h3>{line[4:]}</h3>')
|
||||||
|
# Lists
|
||||||
|
elif line.startswith('- '):
|
||||||
|
if not in_list:
|
||||||
|
html_lines.append('<ul>')
|
||||||
|
in_list = True
|
||||||
|
html_lines.append(f'<li>{line[2:]}</li>')
|
||||||
|
else:
|
||||||
|
if in_list:
|
||||||
|
html_lines.append('</ul>')
|
||||||
|
in_list = False
|
||||||
|
|
||||||
|
# Horizontal rule
|
||||||
|
if line.strip() == '---':
|
||||||
|
html_lines.append('<hr>')
|
||||||
|
# Bold
|
||||||
|
elif '**' in line:
|
||||||
|
line = line.replace('**', '<strong>', 1).replace('**', '</strong>', 1)
|
||||||
|
html_lines.append(f'<p>{line}</p>')
|
||||||
|
# Regular paragraph
|
||||||
|
elif line.strip():
|
||||||
|
html_lines.append(f'<p>{line}</p>')
|
||||||
|
else:
|
||||||
|
html_lines.append('<br>')
|
||||||
|
|
||||||
|
if in_list:
|
||||||
|
html_lines.append('</ul>')
|
||||||
|
|
||||||
|
return '\n'.join(html_lines)
|
||||||
|
|
||||||
|
|
||||||
|
def generate_report(
|
||||||
|
conversation_data: Dict[str, Any],
|
||||||
|
output_path: Path,
|
||||||
|
format: str = 'markdown',
|
||||||
|
title: Optional[str] = None
|
||||||
|
):
|
||||||
"""
|
"""
|
||||||
|
Generate formatted report from conversation data.
|
||||||
# Generate PDF
|
|
||||||
pdf = HTML(string=html_template)
|
|
||||||
|
|
||||||
# Add custom CSS if provided
|
|
||||||
stylesheets = []
|
|
||||||
if css_style and Path(css_style).exists():
|
|
||||||
stylesheets.append(CSS(filename=css_style))
|
|
||||||
|
|
||||||
pdf.write_pdf(output_path, stylesheets=stylesheets)
|
|
||||||
|
|
||||||
return True
|
|
||||||
|
|
||||||
except ImportError:
|
|
||||||
print("Error: WeasyPrint not installed. Install with: pip install weasyprint")
|
|
||||||
return False
|
|
||||||
except Exception as e:
|
|
||||||
print(f"Error generating PDF: {e}")
|
|
||||||
return False
|
|
||||||
|
|
||||||
|
|
||||||
def convert_to_pdf_pandoc(markdown_path: str, output_path: str) -> bool:
|
|
||||||
"""
|
|
||||||
Convert markdown to PDF using Pandoc.
|
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
markdown_path: Path to markdown file
|
conversation_data: Conversation history dictionary
|
||||||
output_path: Path for output PDF
|
output_path: Output file path
|
||||||
|
format: Output format ('markdown', 'html', or 'pdf')
|
||||||
Returns:
|
title: Report title
|
||||||
True if successful, False otherwise
|
|
||||||
"""
|
"""
|
||||||
try:
|
messages = conversation_data.get('messages', [])
|
||||||
import subprocess
|
|
||||||
|
|
||||||
# Check if pandoc is installed
|
if not title:
|
||||||
result = subprocess.run(
|
title = f"Biomni Analysis - {datetime.now().strftime('%Y-%m-%d')}"
|
||||||
['pandoc', '--version'],
|
|
||||||
capture_output=True,
|
|
||||||
text=True
|
|
||||||
)
|
|
||||||
|
|
||||||
if result.returncode != 0:
|
|
||||||
print("Error: Pandoc not installed")
|
|
||||||
return False
|
|
||||||
|
|
||||||
# Convert with pandoc
|
|
||||||
result = subprocess.run(
|
|
||||||
[
|
|
||||||
'pandoc',
|
|
||||||
markdown_path,
|
|
||||||
'-o', output_path,
|
|
||||||
'--pdf-engine=pdflatex',
|
|
||||||
'-V', 'geometry:margin=1in',
|
|
||||||
'--toc'
|
|
||||||
],
|
|
||||||
capture_output=True,
|
|
||||||
text=True
|
|
||||||
)
|
|
||||||
|
|
||||||
if result.returncode != 0:
|
|
||||||
print(f"Pandoc error: {result.stderr}")
|
|
||||||
return False
|
|
||||||
|
|
||||||
return True
|
|
||||||
|
|
||||||
except FileNotFoundError:
|
|
||||||
print("Error: Pandoc not found. Install from https://pandoc.org/")
|
|
||||||
return False
|
|
||||||
except Exception as e:
|
|
||||||
print(f"Error: {e}")
|
|
||||||
return False
|
|
||||||
|
|
||||||
|
|
||||||
def create_biomni_report(
|
|
||||||
conversation_history: list,
|
|
||||||
output_path: str = "biomni_report.pdf",
|
|
||||||
method: str = "weasyprint"
|
|
||||||
) -> bool:
|
|
||||||
"""
|
|
||||||
Create a formatted PDF report from Biomni conversation history.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
conversation_history: List of conversation turns
|
|
||||||
output_path: Output PDF path
|
|
||||||
method: Conversion method ('weasyprint' or 'pandoc')
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
True if successful
|
|
||||||
"""
|
|
||||||
# Prepare report sections
|
|
||||||
metadata = {
|
|
||||||
'Date': datetime.now().strftime('%Y-%m-%d %H:%M:%S'),
|
|
||||||
'Tool': 'Biomni AI Agent',
|
|
||||||
'Report Type': 'Analysis Summary'
|
|
||||||
}
|
|
||||||
|
|
||||||
sections = []
|
|
||||||
|
|
||||||
# Executive Summary
|
|
||||||
sections.append({
|
|
||||||
'heading': 'Executive Summary',
|
|
||||||
'level': 2,
|
|
||||||
'content': 'This report contains the complete analysis workflow executed by the Biomni biomedical AI agent.'
|
|
||||||
})
|
|
||||||
|
|
||||||
# Conversation history
|
|
||||||
for i, turn in enumerate(conversation_history, 1):
|
|
||||||
sections.append({
|
|
||||||
'heading': f'Task {i}: {turn.get("task", "Analysis")}',
|
|
||||||
'level': 2,
|
|
||||||
'content': f'**Input:**\n```\n{turn.get("input", "")}\n```\n\n**Output:**\n{turn.get("output", "")}'
|
|
||||||
})
|
|
||||||
|
|
||||||
# Generate markdown
|
# Generate markdown
|
||||||
md_path = output_path.replace('.pdf', '.md')
|
markdown_content = format_conversation_history(messages)
|
||||||
generate_markdown_report(
|
|
||||||
title="Biomni Analysis Report",
|
if format == 'markdown':
|
||||||
sections=sections,
|
output_path.write_text(markdown_content)
|
||||||
metadata=metadata,
|
print(f"✓ Markdown report saved to {output_path}")
|
||||||
output_path=md_path
|
|
||||||
)
|
elif format == 'html':
|
||||||
|
html_content = markdown_to_html(markdown_content, title)
|
||||||
|
output_path.write_text(html_content)
|
||||||
|
print(f"✓ HTML report saved to {output_path}")
|
||||||
|
|
||||||
|
elif format == 'pdf':
|
||||||
|
# For PDF generation, we'd typically use a library like weasyprint or reportlab
|
||||||
|
# This is a placeholder implementation
|
||||||
|
print("PDF generation requires additional dependencies (weasyprint or reportlab)")
|
||||||
|
print("Falling back to HTML format...")
|
||||||
|
|
||||||
|
html_path = output_path.with_suffix('.html')
|
||||||
|
html_content = markdown_to_html(markdown_content, title)
|
||||||
|
html_path.write_text(html_content)
|
||||||
|
|
||||||
|
print(f"✓ HTML report saved to {html_path}")
|
||||||
|
print(" To convert to PDF:")
|
||||||
|
print(f" 1. Install weasyprint: pip install weasyprint")
|
||||||
|
print(f" 2. Run: weasyprint {html_path} {output_path}")
|
||||||
|
|
||||||
# Convert to PDF
|
|
||||||
if method == 'weasyprint':
|
|
||||||
success = convert_to_pdf_weasyprint(md_path, output_path)
|
|
||||||
elif method == 'pandoc':
|
|
||||||
success = convert_to_pdf_pandoc(md_path, output_path)
|
|
||||||
else:
|
else:
|
||||||
print(f"Unknown method: {method}")
|
raise ValueError(f"Unsupported format: {format}")
|
||||||
return False
|
|
||||||
|
|
||||||
if success:
|
|
||||||
print(f"✓ Report generated: {output_path}")
|
|
||||||
print(f" Markdown: {md_path}")
|
|
||||||
else:
|
|
||||||
print("✗ Failed to generate PDF")
|
|
||||||
print(f" Markdown available: {md_path}")
|
|
||||||
|
|
||||||
return success
|
|
||||||
|
|
||||||
|
|
||||||
def main():
|
def main():
|
||||||
"""CLI for report generation."""
|
"""Main entry point for CLI usage."""
|
||||||
parser = argparse.ArgumentParser(
|
parser = argparse.ArgumentParser(
|
||||||
description='Generate formatted PDF reports for Biomni analyses'
|
description="Generate enhanced reports from biomni conversation histories"
|
||||||
)
|
)
|
||||||
|
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
'input',
|
'--input',
|
||||||
type=str,
|
type=Path,
|
||||||
help='Input markdown file or conversation history'
|
required=True,
|
||||||
|
help='Input conversation history JSON file'
|
||||||
)
|
)
|
||||||
|
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
'-o', '--output',
|
'--output',
|
||||||
type=str,
|
type=Path,
|
||||||
default='biomni_report.pdf',
|
required=True,
|
||||||
help='Output PDF path (default: biomni_report.pdf)'
|
help='Output report file path'
|
||||||
)
|
)
|
||||||
|
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
'-m', '--method',
|
'--format',
|
||||||
type=str,
|
choices=['markdown', 'html', 'pdf'],
|
||||||
choices=['weasyprint', 'pandoc'],
|
default='markdown',
|
||||||
default='weasyprint',
|
help='Output format (default: markdown)'
|
||||||
help='Conversion method (default: weasyprint)'
|
|
||||||
)
|
)
|
||||||
|
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
'--css',
|
'--title',
|
||||||
type=str,
|
type=str,
|
||||||
help='Custom CSS stylesheet path'
|
help='Report title (optional)'
|
||||||
)
|
)
|
||||||
|
|
||||||
args = parser.parse_args()
|
args = parser.parse_args()
|
||||||
|
|
||||||
# Check if input is markdown or conversation history
|
# Load conversation data
|
||||||
input_path = Path(args.input)
|
|
||||||
|
|
||||||
if not input_path.exists():
|
|
||||||
print(f"Error: Input file not found: {args.input}")
|
|
||||||
return 1
|
|
||||||
|
|
||||||
# If input is markdown, convert directly
|
|
||||||
if input_path.suffix == '.md':
|
|
||||||
if args.method == 'weasyprint':
|
|
||||||
success = convert_to_pdf_weasyprint(
|
|
||||||
str(input_path),
|
|
||||||
args.output,
|
|
||||||
args.css
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
success = convert_to_pdf_pandoc(str(input_path), args.output)
|
|
||||||
|
|
||||||
return 0 if success else 1
|
|
||||||
|
|
||||||
# Otherwise, assume it's conversation history (JSON)
|
|
||||||
try:
|
try:
|
||||||
import json
|
with open(args.input, 'r') as f:
|
||||||
with open(input_path) as f:
|
conversation_data = json.load(f)
|
||||||
history = json.load(f)
|
except FileNotFoundError:
|
||||||
|
print(f"❌ Input file not found: {args.input}")
|
||||||
success = create_biomni_report(
|
return 1
|
||||||
history,
|
|
||||||
args.output,
|
|
||||||
args.method
|
|
||||||
)
|
|
||||||
|
|
||||||
return 0 if success else 1
|
|
||||||
|
|
||||||
except json.JSONDecodeError:
|
except json.JSONDecodeError:
|
||||||
print("Error: Input file is not valid JSON or markdown")
|
print(f"❌ Invalid JSON in input file: {args.input}")
|
||||||
|
return 1
|
||||||
|
|
||||||
|
# Generate report
|
||||||
|
try:
|
||||||
|
generate_report(
|
||||||
|
conversation_data,
|
||||||
|
args.output,
|
||||||
|
format=args.format,
|
||||||
|
title=args.title
|
||||||
|
)
|
||||||
|
return 0
|
||||||
|
except Exception as e:
|
||||||
|
print(f"❌ Error generating report: {e}")
|
||||||
return 1
|
return 1
|
||||||
|
|
||||||
|
|
||||||
if __name__ == "__main__":
|
if __name__ == '__main__':
|
||||||
|
import sys
|
||||||
sys.exit(main())
|
sys.exit(main())
|
||||||
|
|||||||
465
scientific-packages/biomni/scripts/setup_environment.py
Normal file → Executable file
465
scientific-packages/biomni/scripts/setup_environment.py
Normal file → Executable file
@@ -1,230 +1,355 @@
|
|||||||
#!/usr/bin/env python3
|
#!/usr/bin/env python3
|
||||||
"""
|
"""
|
||||||
Biomni Environment Setup and Validation Script
|
Interactive setup script for biomni environment configuration.
|
||||||
|
|
||||||
This script helps users set up and validate their Biomni environment,
|
This script helps users set up:
|
||||||
including checking dependencies, API keys, and data availability.
|
1. Conda environment with required dependencies
|
||||||
|
2. API keys for LLM providers
|
||||||
|
3. Data lake directory configuration
|
||||||
|
4. MCP server setup (optional)
|
||||||
|
|
||||||
|
Usage:
|
||||||
|
python setup_environment.py
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import os
|
import os
|
||||||
import sys
|
import sys
|
||||||
import subprocess
|
import subprocess
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from typing import Dict, List, Tuple
|
from typing import Dict, Optional
|
||||||
|
|
||||||
|
|
||||||
def check_python_version() -> Tuple[bool, str]:
|
def check_conda_installed() -> bool:
|
||||||
"""Check if Python version is compatible."""
|
"""Check if conda is available in the system."""
|
||||||
version = sys.version_info
|
|
||||||
if version.major == 3 and version.minor >= 8:
|
|
||||||
return True, f"Python {version.major}.{version.minor}.{version.micro} ✓"
|
|
||||||
else:
|
|
||||||
return False, f"Python {version.major}.{version.minor} - requires Python 3.8+"
|
|
||||||
|
|
||||||
|
|
||||||
def check_conda_env() -> Tuple[bool, str]:
|
|
||||||
"""Check if running in biomni conda environment."""
|
|
||||||
conda_env = os.environ.get('CONDA_DEFAULT_ENV', None)
|
|
||||||
if conda_env == 'biomni_e1':
|
|
||||||
return True, f"Conda environment: {conda_env} ✓"
|
|
||||||
else:
|
|
||||||
return False, f"Not in biomni_e1 environment (current: {conda_env})"
|
|
||||||
|
|
||||||
|
|
||||||
def check_package_installed(package: str) -> bool:
|
|
||||||
"""Check if a Python package is installed."""
|
|
||||||
try:
|
try:
|
||||||
__import__(package)
|
subprocess.run(
|
||||||
|
['conda', '--version'],
|
||||||
|
capture_output=True,
|
||||||
|
check=True
|
||||||
|
)
|
||||||
return True
|
return True
|
||||||
except ImportError:
|
except (subprocess.CalledProcessError, FileNotFoundError):
|
||||||
return False
|
return False
|
||||||
|
|
||||||
|
|
||||||
def check_dependencies() -> Tuple[bool, List[str]]:
|
def setup_conda_environment():
|
||||||
"""Check for required and optional dependencies."""
|
"""Guide user through conda environment setup."""
|
||||||
required = ['biomni']
|
print("\n=== Conda Environment Setup ===")
|
||||||
optional = ['weasyprint', 'markdown2pdf']
|
|
||||||
|
|
||||||
missing_required = [pkg for pkg in required if not check_package_installed(pkg)]
|
if not check_conda_installed():
|
||||||
missing_optional = [pkg for pkg in optional if not check_package_installed(pkg)]
|
print("❌ Conda not found. Please install Miniconda or Anaconda:")
|
||||||
|
print(" https://docs.conda.io/en/latest/miniconda.html")
|
||||||
|
return False
|
||||||
|
|
||||||
messages = []
|
print("✓ Conda is installed")
|
||||||
success = len(missing_required) == 0
|
|
||||||
|
|
||||||
if missing_required:
|
# Check if biomni_e1 environment exists
|
||||||
messages.append(f"Missing required packages: {', '.join(missing_required)}")
|
result = subprocess.run(
|
||||||
messages.append("Install with: pip install biomni --upgrade")
|
['conda', 'env', 'list'],
|
||||||
else:
|
capture_output=True,
|
||||||
messages.append("Required packages: ✓")
|
text=True
|
||||||
|
)
|
||||||
|
|
||||||
if missing_optional:
|
if 'biomni_e1' in result.stdout:
|
||||||
messages.append(f"Missing optional packages: {', '.join(missing_optional)}")
|
print("✓ biomni_e1 environment already exists")
|
||||||
messages.append("For PDF reports, install: pip install weasyprint")
|
return True
|
||||||
|
|
||||||
return success, messages
|
print("\nCreating biomni_e1 conda environment...")
|
||||||
|
print("This will install Python 3.10 and required dependencies.")
|
||||||
|
|
||||||
|
response = input("Proceed? [y/N]: ").strip().lower()
|
||||||
|
if response != 'y':
|
||||||
|
print("Skipping conda environment setup")
|
||||||
|
return False
|
||||||
|
|
||||||
def check_api_keys() -> Tuple[bool, Dict[str, bool]]:
|
|
||||||
"""Check which API keys are configured."""
|
|
||||||
api_keys = {
|
|
||||||
'ANTHROPIC_API_KEY': os.environ.get('ANTHROPIC_API_KEY'),
|
|
||||||
'OPENAI_API_KEY': os.environ.get('OPENAI_API_KEY'),
|
|
||||||
'GEMINI_API_KEY': os.environ.get('GEMINI_API_KEY'),
|
|
||||||
'GROQ_API_KEY': os.environ.get('GROQ_API_KEY'),
|
|
||||||
}
|
|
||||||
|
|
||||||
configured = {key: bool(value) for key, value in api_keys.items()}
|
|
||||||
has_any = any(configured.values())
|
|
||||||
|
|
||||||
return has_any, configured
|
|
||||||
|
|
||||||
|
|
||||||
def check_data_directory(data_path: str = './data') -> Tuple[bool, str]:
|
|
||||||
"""Check if Biomni data directory exists and has content."""
|
|
||||||
path = Path(data_path)
|
|
||||||
|
|
||||||
if not path.exists():
|
|
||||||
return False, f"Data directory not found at {data_path}"
|
|
||||||
|
|
||||||
# Check if directory has files (data has been downloaded)
|
|
||||||
files = list(path.glob('*'))
|
|
||||||
if len(files) == 0:
|
|
||||||
return False, f"Data directory exists but is empty. Run agent once to download."
|
|
||||||
|
|
||||||
# Rough size check (should be ~11GB)
|
|
||||||
total_size = sum(f.stat().st_size for f in path.rglob('*') if f.is_file())
|
|
||||||
size_gb = total_size / (1024**3)
|
|
||||||
|
|
||||||
if size_gb < 1:
|
|
||||||
return False, f"Data directory exists but seems incomplete ({size_gb:.1f} GB)"
|
|
||||||
|
|
||||||
return True, f"Data directory: {data_path} ({size_gb:.1f} GB) ✓"
|
|
||||||
|
|
||||||
|
|
||||||
def check_disk_space(required_gb: float = 20) -> Tuple[bool, str]:
|
|
||||||
"""Check if sufficient disk space is available."""
|
|
||||||
try:
|
try:
|
||||||
import shutil
|
# Create conda environment
|
||||||
stat = shutil.disk_usage('.')
|
subprocess.run(
|
||||||
free_gb = stat.free / (1024**3)
|
['conda', 'create', '-n', 'biomni_e1', 'python=3.10', '-y'],
|
||||||
|
check=True
|
||||||
|
)
|
||||||
|
|
||||||
if free_gb >= required_gb:
|
print("\n✓ Conda environment created successfully")
|
||||||
return True, f"Disk space: {free_gb:.1f} GB available ✓"
|
print("\nTo activate: conda activate biomni_e1")
|
||||||
|
print("Then install biomni: pip install biomni --upgrade")
|
||||||
|
return True
|
||||||
|
|
||||||
|
except subprocess.CalledProcessError as e:
|
||||||
|
print(f"❌ Failed to create conda environment: {e}")
|
||||||
|
return False
|
||||||
|
|
||||||
|
|
||||||
|
def setup_api_keys() -> Dict[str, str]:
|
||||||
|
"""Interactive API key configuration."""
|
||||||
|
print("\n=== API Key Configuration ===")
|
||||||
|
print("Biomni supports multiple LLM providers.")
|
||||||
|
print("At minimum, configure one provider.")
|
||||||
|
|
||||||
|
api_keys = {}
|
||||||
|
|
||||||
|
# Anthropic (recommended)
|
||||||
|
print("\n1. Anthropic Claude (Recommended)")
|
||||||
|
print(" Get your API key from: https://console.anthropic.com/")
|
||||||
|
anthropic_key = input(" Enter ANTHROPIC_API_KEY (or press Enter to skip): ").strip()
|
||||||
|
if anthropic_key:
|
||||||
|
api_keys['ANTHROPIC_API_KEY'] = anthropic_key
|
||||||
|
|
||||||
|
# OpenAI
|
||||||
|
print("\n2. OpenAI")
|
||||||
|
print(" Get your API key from: https://platform.openai.com/api-keys")
|
||||||
|
openai_key = input(" Enter OPENAI_API_KEY (or press Enter to skip): ").strip()
|
||||||
|
if openai_key:
|
||||||
|
api_keys['OPENAI_API_KEY'] = openai_key
|
||||||
|
|
||||||
|
# Google Gemini
|
||||||
|
print("\n3. Google Gemini")
|
||||||
|
print(" Get your API key from: https://makersuite.google.com/app/apikey")
|
||||||
|
google_key = input(" Enter GOOGLE_API_KEY (or press Enter to skip): ").strip()
|
||||||
|
if google_key:
|
||||||
|
api_keys['GOOGLE_API_KEY'] = google_key
|
||||||
|
|
||||||
|
# Groq
|
||||||
|
print("\n4. Groq")
|
||||||
|
print(" Get your API key from: https://console.groq.com/keys")
|
||||||
|
groq_key = input(" Enter GROQ_API_KEY (or press Enter to skip): ").strip()
|
||||||
|
if groq_key:
|
||||||
|
api_keys['GROQ_API_KEY'] = groq_key
|
||||||
|
|
||||||
|
if not api_keys:
|
||||||
|
print("\n⚠️ No API keys configured. You'll need at least one to use biomni.")
|
||||||
|
return {}
|
||||||
|
|
||||||
|
return api_keys
|
||||||
|
|
||||||
|
|
||||||
|
def save_api_keys(api_keys: Dict[str, str], method: str = 'env_file'):
|
||||||
|
"""Save API keys using specified method."""
|
||||||
|
if method == 'env_file':
|
||||||
|
env_file = Path.cwd() / '.env'
|
||||||
|
|
||||||
|
# Read existing .env if present
|
||||||
|
existing_vars = {}
|
||||||
|
if env_file.exists():
|
||||||
|
with open(env_file, 'r') as f:
|
||||||
|
for line in f:
|
||||||
|
line = line.strip()
|
||||||
|
if line and not line.startswith('#'):
|
||||||
|
if '=' in line:
|
||||||
|
key, val = line.split('=', 1)
|
||||||
|
existing_vars[key.strip()] = val.strip()
|
||||||
|
|
||||||
|
# Update with new keys
|
||||||
|
existing_vars.update(api_keys)
|
||||||
|
|
||||||
|
# Write to .env
|
||||||
|
with open(env_file, 'w') as f:
|
||||||
|
f.write("# Biomni API Keys\n")
|
||||||
|
f.write(f"# Generated by setup_environment.py\n\n")
|
||||||
|
for key, value in existing_vars.items():
|
||||||
|
f.write(f"{key}={value}\n")
|
||||||
|
|
||||||
|
print(f"\n✓ API keys saved to {env_file}")
|
||||||
|
print(" Keys will be loaded automatically when biomni runs in this directory")
|
||||||
|
|
||||||
|
elif method == 'shell_export':
|
||||||
|
shell_file = Path.home() / '.bashrc' # or .zshrc for zsh users
|
||||||
|
|
||||||
|
print("\n📋 Add these lines to your shell configuration:")
|
||||||
|
for key, value in api_keys.items():
|
||||||
|
print(f" export {key}=\"{value}\"")
|
||||||
|
|
||||||
|
print(f"\nThen run: source {shell_file}")
|
||||||
|
|
||||||
|
|
||||||
|
def setup_data_directory() -> Optional[Path]:
|
||||||
|
"""Configure biomni data lake directory."""
|
||||||
|
print("\n=== Data Lake Configuration ===")
|
||||||
|
print("Biomni requires ~11GB for integrated biomedical databases.")
|
||||||
|
|
||||||
|
default_path = Path.cwd() / 'biomni_data'
|
||||||
|
print(f"\nDefault location: {default_path}")
|
||||||
|
|
||||||
|
response = input("Use default location? [Y/n]: ").strip().lower()
|
||||||
|
|
||||||
|
if response == 'n':
|
||||||
|
custom_path = input("Enter custom path: ").strip()
|
||||||
|
data_path = Path(custom_path).expanduser().resolve()
|
||||||
else:
|
else:
|
||||||
return False, f"Low disk space: {free_gb:.1f} GB (need {required_gb} GB)"
|
data_path = default_path
|
||||||
except Exception as e:
|
|
||||||
return False, f"Could not check disk space: {e}"
|
# Create directory if it doesn't exist
|
||||||
|
data_path.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
print(f"\n✓ Data directory configured: {data_path}")
|
||||||
|
print(" Data will be downloaded automatically on first use")
|
||||||
|
|
||||||
|
return data_path
|
||||||
|
|
||||||
|
|
||||||
def test_biomni_import() -> Tuple[bool, str]:
|
def test_installation(data_path: Path):
|
||||||
"""Test if Biomni can be imported and initialized."""
|
"""Test biomni installation with a simple query."""
|
||||||
|
print("\n=== Installation Test ===")
|
||||||
|
print("Testing biomni installation with a simple query...")
|
||||||
|
|
||||||
|
response = input("Run test? [Y/n]: ").strip().lower()
|
||||||
|
if response == 'n':
|
||||||
|
print("Skipping test")
|
||||||
|
return
|
||||||
|
|
||||||
|
test_code = f'''
|
||||||
|
import os
|
||||||
|
from biomni.agent import A1
|
||||||
|
|
||||||
|
# Use environment variables for API keys
|
||||||
|
agent = A1(path='{data_path}', llm='claude-sonnet-4-20250514')
|
||||||
|
|
||||||
|
# Simple test query
|
||||||
|
result = agent.go("What is the primary function of the TP53 gene?")
|
||||||
|
print("Test result:", result)
|
||||||
|
'''
|
||||||
|
|
||||||
|
test_file = Path('test_biomni.py')
|
||||||
|
with open(test_file, 'w') as f:
|
||||||
|
f.write(test_code)
|
||||||
|
|
||||||
|
print(f"\nTest script created: {test_file}")
|
||||||
|
print("Running test...")
|
||||||
|
|
||||||
try:
|
try:
|
||||||
from biomni.agent import A1
|
subprocess.run([sys.executable, str(test_file)], check=True)
|
||||||
from biomni.config import default_config
|
print("\n✓ Test completed successfully!")
|
||||||
return True, "Biomni import successful ✓"
|
test_file.unlink() # Clean up test file
|
||||||
except ImportError as e:
|
except subprocess.CalledProcessError:
|
||||||
return False, f"Cannot import Biomni: {e}"
|
print("\n❌ Test failed. Check your configuration.")
|
||||||
except Exception as e:
|
print(f" Test script saved as {test_file} for debugging")
|
||||||
return False, f"Biomni import error: {e}"
|
|
||||||
|
|
||||||
|
|
||||||
def suggest_fixes(results: Dict[str, Tuple[bool, any]]) -> List[str]:
|
def generate_example_script(data_path: Path):
|
||||||
"""Generate suggestions for fixing issues."""
|
"""Generate example usage script."""
|
||||||
suggestions = []
|
example_code = f'''#!/usr/bin/env python3
|
||||||
|
"""
|
||||||
|
Example biomni usage script
|
||||||
|
|
||||||
if not results['python'][0]:
|
This demonstrates basic biomni usage patterns.
|
||||||
suggestions.append("➜ Upgrade Python to 3.8 or higher")
|
Modify this script for your research tasks.
|
||||||
|
"""
|
||||||
|
|
||||||
if not results['conda'][0]:
|
from biomni.agent import A1
|
||||||
suggestions.append("➜ Activate biomni environment: conda activate biomni_e1")
|
|
||||||
|
|
||||||
if not results['dependencies'][0]:
|
# Initialize agent
|
||||||
suggestions.append("➜ Install Biomni: pip install biomni --upgrade")
|
agent = A1(
|
||||||
|
path='{data_path}',
|
||||||
|
llm='claude-sonnet-4-20250514' # or your preferred LLM
|
||||||
|
)
|
||||||
|
|
||||||
if not results['api_keys'][0]:
|
# Example 1: Simple gene query
|
||||||
suggestions.append("➜ Set API key: export ANTHROPIC_API_KEY='your-key'")
|
print("Example 1: Gene function query")
|
||||||
suggestions.append(" Or create .env file with API keys")
|
result = agent.go("""
|
||||||
|
What are the main functions of the BRCA1 gene?
|
||||||
|
Include information about:
|
||||||
|
- Molecular function
|
||||||
|
- Associated diseases
|
||||||
|
- Protein interactions
|
||||||
|
""")
|
||||||
|
print(result)
|
||||||
|
print("-" * 80)
|
||||||
|
|
||||||
if not results['data'][0]:
|
# Example 2: Data analysis
|
||||||
suggestions.append("➜ Data will auto-download on first agent.go() call")
|
print("\\nExample 2: GWAS analysis")
|
||||||
|
result = agent.go("""
|
||||||
|
Explain how to analyze GWAS summary statistics for:
|
||||||
|
1. Identifying genome-wide significant variants
|
||||||
|
2. Mapping variants to genes
|
||||||
|
3. Pathway enrichment analysis
|
||||||
|
""")
|
||||||
|
print(result)
|
||||||
|
|
||||||
if not results['disk_space'][0]:
|
# Save conversation history
|
||||||
suggestions.append("➜ Free up disk space (need ~20GB total)")
|
agent.save_conversation_history("example_results.pdf")
|
||||||
|
print("\\nResults saved to example_results.pdf")
|
||||||
|
'''
|
||||||
|
|
||||||
return suggestions
|
example_file = Path('example_biomni_usage.py')
|
||||||
|
with open(example_file, 'w') as f:
|
||||||
|
f.write(example_code)
|
||||||
|
|
||||||
|
print(f"\n✓ Example script created: {example_file}")
|
||||||
|
|
||||||
|
|
||||||
def main():
|
def main():
|
||||||
"""Run all environment checks and display results."""
|
"""Main setup workflow."""
|
||||||
print("=" * 60)
|
print("=" * 60)
|
||||||
print("Biomni Environment Validation")
|
print("Biomni Environment Setup")
|
||||||
print("=" * 60)
|
print("=" * 60)
|
||||||
print()
|
|
||||||
|
|
||||||
# Run all checks
|
# Step 1: Conda environment
|
||||||
results = {}
|
conda_success = setup_conda_environment()
|
||||||
|
|
||||||
print("Checking Python version...")
|
if conda_success:
|
||||||
results['python'] = check_python_version()
|
print("\n⚠️ Remember to activate the environment:")
|
||||||
print(f" {results['python'][1]}")
|
print(" conda activate biomni_e1")
|
||||||
print()
|
print(" pip install biomni --upgrade")
|
||||||
|
|
||||||
print("Checking conda environment...")
|
# Step 2: API keys
|
||||||
results['conda'] = check_conda_env()
|
api_keys = setup_api_keys()
|
||||||
print(f" {results['conda'][1]}")
|
|
||||||
print()
|
|
||||||
|
|
||||||
print("Checking dependencies...")
|
if api_keys:
|
||||||
results['dependencies'] = check_dependencies()
|
print("\nHow would you like to store API keys?")
|
||||||
for msg in results['dependencies'][1]:
|
print("1. .env file (recommended, local to this directory)")
|
||||||
print(f" {msg}")
|
print("2. Shell export (add to .bashrc/.zshrc)")
|
||||||
print()
|
|
||||||
|
|
||||||
print("Checking API keys...")
|
choice = input("Choose [1/2]: ").strip()
|
||||||
results['api_keys'] = check_api_keys()
|
|
||||||
has_keys, key_status = results['api_keys']
|
|
||||||
for key, configured in key_status.items():
|
|
||||||
status = "✓" if configured else "✗"
|
|
||||||
print(f" {key}: {status}")
|
|
||||||
print()
|
|
||||||
|
|
||||||
print("Checking Biomni data directory...")
|
if choice == '2':
|
||||||
results['data'] = check_data_directory()
|
save_api_keys(api_keys, method='shell_export')
|
||||||
print(f" {results['data'][1]}")
|
else:
|
||||||
print()
|
save_api_keys(api_keys, method='env_file')
|
||||||
|
|
||||||
print("Checking disk space...")
|
# Step 3: Data directory
|
||||||
results['disk_space'] = check_disk_space()
|
data_path = setup_data_directory()
|
||||||
print(f" {results['disk_space'][1]}")
|
|
||||||
print()
|
|
||||||
|
|
||||||
print("Testing Biomni import...")
|
# Step 4: Generate example script
|
||||||
results['biomni_import'] = test_biomni_import()
|
if data_path:
|
||||||
print(f" {results['biomni_import'][1]}")
|
generate_example_script(data_path)
|
||||||
print()
|
|
||||||
|
# Step 5: Test installation (optional)
|
||||||
|
if api_keys and data_path:
|
||||||
|
test_installation(data_path)
|
||||||
|
|
||||||
# Summary
|
# Summary
|
||||||
|
print("\n" + "=" * 60)
|
||||||
|
print("Setup Complete!")
|
||||||
print("=" * 60)
|
print("=" * 60)
|
||||||
all_passed = all(result[0] for result in results.values())
|
|
||||||
|
|
||||||
if all_passed:
|
if conda_success:
|
||||||
print("✓ All checks passed! Environment is ready.")
|
print("✓ Conda environment: biomni_e1")
|
||||||
print()
|
|
||||||
print("Quick start:")
|
if api_keys:
|
||||||
print(" from biomni.agent import A1")
|
print(f"✓ API keys configured: {', '.join(api_keys.keys())}")
|
||||||
print(" agent = A1(path='./data', llm='claude-sonnet-4-20250514')")
|
|
||||||
print(" agent.go('Your biomedical task')")
|
if data_path:
|
||||||
|
print(f"✓ Data directory: {data_path}")
|
||||||
|
|
||||||
|
print("\nNext steps:")
|
||||||
|
if conda_success:
|
||||||
|
print("1. conda activate biomni_e1")
|
||||||
|
print("2. pip install biomni --upgrade")
|
||||||
|
print("3. Run example_biomni_usage.py to test")
|
||||||
else:
|
else:
|
||||||
print("⚠ Some checks failed. See suggestions below:")
|
print("1. Install conda/miniconda")
|
||||||
print()
|
print("2. Run this script again")
|
||||||
suggestions = suggest_fixes(results)
|
|
||||||
for suggestion in suggestions:
|
|
||||||
print(suggestion)
|
|
||||||
|
|
||||||
print("=" * 60)
|
print("\nFor documentation, see:")
|
||||||
|
print(" - GitHub: https://github.com/snap-stanford/biomni")
|
||||||
return 0 if all_passed else 1
|
print(" - Paper: https://www.biorxiv.org/content/10.1101/2025.05.30.656746v1")
|
||||||
|
|
||||||
|
|
||||||
if __name__ == "__main__":
|
if __name__ == "__main__":
|
||||||
sys.exit(main())
|
try:
|
||||||
|
main()
|
||||||
|
except KeyboardInterrupt:
|
||||||
|
print("\n\nSetup interrupted by user")
|
||||||
|
sys.exit(1)
|
||||||
|
except Exception as e:
|
||||||
|
print(f"\n❌ Error during setup: {e}")
|
||||||
|
sys.exit(1)
|
||||||
|
|||||||
Reference in New Issue
Block a user