mirror of
https://github.com/K-Dense-AI/claude-scientific-skills.git
synced 2026-01-26 16:58:56 +08:00
Consolidate skills
This commit is contained in:
867
scientific-skills/biomni/references/use_cases.md
Normal file
867
scientific-skills/biomni/references/use_cases.md
Normal file
@@ -0,0 +1,867 @@
|
||||
# Biomni Use Cases and Examples
|
||||
|
||||
Comprehensive examples demonstrating biomni across biomedical research domains.
|
||||
|
||||
## Table of Contents
|
||||
|
||||
1. [CRISPR Screening and Gene Editing](#crispr-screening-and-gene-editing)
|
||||
2. [Single-Cell RNA-seq Analysis](#single-cell-rna-seq-analysis)
|
||||
3. [Drug Discovery and ADMET](#drug-discovery-and-admet)
|
||||
4. [GWAS and Genetic Analysis](#gwas-and-genetic-analysis)
|
||||
5. [Clinical Genomics and Diagnostics](#clinical-genomics-and-diagnostics)
|
||||
6. [Protein Structure and Function](#protein-structure-and-function)
|
||||
7. [Literature and Knowledge Synthesis](#literature-and-knowledge-synthesis)
|
||||
8. [Multi-Omics Integration](#multi-omics-integration)
|
||||
|
||||
---
|
||||
|
||||
## CRISPR Screening and Gene Editing
|
||||
|
||||
### Example 1: Genome-Wide CRISPR Screen Design
|
||||
|
||||
**Task:** Design a CRISPR knockout screen to identify genes regulating autophagy.
|
||||
|
||||
```python
|
||||
from biomni.agent import A1
|
||||
|
||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||
|
||||
result = agent.go("""
|
||||
Design a genome-wide CRISPR knockout screen to identify genes regulating
|
||||
autophagy in HEK293 cells.
|
||||
|
||||
Requirements:
|
||||
1. Generate comprehensive sgRNA library targeting all protein-coding genes
|
||||
2. Design 4 sgRNAs per gene with optimal on-target and minimal off-target scores
|
||||
3. Include positive controls (known autophagy regulators: ATG5, BECN1, ULK1)
|
||||
4. Include negative controls (non-targeting sgRNAs)
|
||||
5. Prioritize genes based on:
|
||||
- Existing autophagy pathway annotations
|
||||
- Protein-protein interactions with known autophagy factors
|
||||
- Expression levels in HEK293 cells
|
||||
6. Output sgRNA sequences, scores, and gene prioritization rankings
|
||||
|
||||
Provide analysis as Python code and interpret results.
|
||||
""")
|
||||
|
||||
agent.save_conversation_history("autophagy_screen_design.pdf")
|
||||
```
|
||||
|
||||
**Expected Output:**
|
||||
- sgRNA library with ~80,000 guides (4 per gene × ~20,000 genes)
|
||||
- On-target and off-target scores for each sgRNA
|
||||
- Prioritized gene list based on pathway enrichment
|
||||
- Quality control metrics for library design
|
||||
|
||||
### Example 2: CRISPR Off-Target Prediction
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Analyze potential off-target effects for this sgRNA sequence:
|
||||
GCTGAAGATCCAGTTCGATG
|
||||
|
||||
Tasks:
|
||||
1. Identify all genomic locations with ≤3 mismatches
|
||||
2. Score each potential off-target site
|
||||
3. Assess likelihood of cleavage at off-target sites
|
||||
4. Recommend whether sgRNA is suitable for use
|
||||
5. If unsuitable, suggest alternative sgRNAs for the same gene
|
||||
""")
|
||||
```
|
||||
|
||||
### Example 3: Screen Hit Analysis
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Analyze CRISPR screen results from autophagy phenotype screen.
|
||||
|
||||
Input file: screen_results.csv
|
||||
Columns: sgRNA_ID, gene, log2_fold_change, p_value, FDR
|
||||
|
||||
Tasks:
|
||||
1. Identify significant hits (FDR < 0.05, |LFC| > 1.5)
|
||||
2. Perform gene ontology enrichment on hit genes
|
||||
3. Map hits to known autophagy pathways
|
||||
4. Identify novel candidates not previously linked to autophagy
|
||||
5. Predict functional relationships between hit genes
|
||||
6. Generate visualization of hit genes in pathway context
|
||||
""")
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
## Single-Cell RNA-seq Analysis
|
||||
|
||||
### Example 1: Cell Type Annotation
|
||||
|
||||
**Task:** Analyze single-cell RNA-seq data and annotate cell populations.
|
||||
|
||||
```python
|
||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||
|
||||
result = agent.go("""
|
||||
Analyze single-cell RNA-seq dataset from human PBMC sample.
|
||||
|
||||
File: pbmc_data.h5ad (10X Genomics format)
|
||||
|
||||
Workflow:
|
||||
1. Quality control:
|
||||
- Filter cells with <200 or >5000 detected genes
|
||||
- Remove cells with >20% mitochondrial content
|
||||
- Filter genes detected in <3 cells
|
||||
|
||||
2. Normalization and preprocessing:
|
||||
- Normalize to 10,000 reads per cell
|
||||
- Log-transform
|
||||
- Identify highly variable genes
|
||||
- Scale data
|
||||
|
||||
3. Dimensionality reduction:
|
||||
- PCA (50 components)
|
||||
- UMAP visualization
|
||||
|
||||
4. Clustering:
|
||||
- Leiden algorithm with resolution=0.8
|
||||
- Identify cluster markers (Wilcoxon rank-sum test)
|
||||
|
||||
5. Cell type annotation:
|
||||
- Annotate clusters using marker genes:
|
||||
* T cells (CD3D, CD3E)
|
||||
* B cells (CD79A, MS4A1)
|
||||
* NK cells (GNLY, NKG7)
|
||||
* Monocytes (CD14, LYZ)
|
||||
* Dendritic cells (FCER1A, CST3)
|
||||
|
||||
6. Generate UMAP plots with annotations and export results
|
||||
""")
|
||||
|
||||
agent.save_conversation_history("pbmc_scrna_analysis.pdf")
|
||||
```
|
||||
|
||||
### Example 2: Differential Expression Analysis
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Perform differential expression analysis between conditions in scRNA-seq data.
|
||||
|
||||
Data: pbmc_treated_vs_control.h5ad
|
||||
Conditions: treated (drug X) vs control
|
||||
|
||||
Tasks:
|
||||
1. Identify differentially expressed genes for each cell type
|
||||
2. Use statistical tests appropriate for scRNA-seq (MAST or Wilcoxon)
|
||||
3. Apply multiple testing correction (Benjamini-Hochberg)
|
||||
4. Threshold: |log2FC| > 0.5, adjusted p < 0.05
|
||||
5. Perform pathway enrichment on DE genes per cell type
|
||||
6. Identify cell-type-specific drug responses
|
||||
7. Generate volcano plots and heatmaps
|
||||
""")
|
||||
```
|
||||
|
||||
### Example 3: Trajectory Analysis
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Perform pseudotime trajectory analysis on differentiation dataset.
|
||||
|
||||
Data: hematopoiesis_scrna.h5ad
|
||||
Starting population: Hematopoietic stem cells (HSCs)
|
||||
|
||||
Analysis:
|
||||
1. Subset to hematopoietic lineages
|
||||
2. Compute diffusion map or PAGA for trajectory inference
|
||||
3. Order cells along pseudotime
|
||||
4. Identify genes with dynamic expression along trajectory
|
||||
5. Cluster genes by expression patterns
|
||||
6. Map trajectories to known differentiation pathways
|
||||
7. Visualize key transcription factors driving differentiation
|
||||
""")
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
## Drug Discovery and ADMET
|
||||
|
||||
### Example 1: ADMET Property Prediction
|
||||
|
||||
**Task:** Predict ADMET properties for drug candidates.
|
||||
|
||||
```python
|
||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||
|
||||
result = agent.go("""
|
||||
Predict ADMET properties for these drug candidates:
|
||||
|
||||
Compounds (SMILES format):
|
||||
1. CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5
|
||||
2. CN1CCN(CC1)C2=C(C=C3C(=C2)N=CN=C3NC4=CC=C(C=C4)F)OC
|
||||
3. CC(C)(C)NC(=O)N(CC1=CC=CC=C1)C2CCN(CC2)C(=O)C3=CC4=C(C=C3)OCO4
|
||||
|
||||
For each compound, predict:
|
||||
|
||||
**Absorption:**
|
||||
- Caco-2 permeability (cm/s)
|
||||
- Human intestinal absorption (HIA %)
|
||||
- Oral bioavailability
|
||||
|
||||
**Distribution:**
|
||||
- Plasma protein binding (%)
|
||||
- Blood-brain barrier penetration (BBB+/-)
|
||||
- Volume of distribution (L/kg)
|
||||
|
||||
**Metabolism:**
|
||||
- CYP450 substrate/inhibitor predictions (2D6, 3A4, 2C9, 2C19)
|
||||
- Metabolic stability (T1/2)
|
||||
|
||||
**Excretion:**
|
||||
- Clearance (mL/min/kg)
|
||||
- Half-life (hours)
|
||||
|
||||
**Toxicity:**
|
||||
- hERG IC50 (cardiotoxicity risk)
|
||||
- Hepatotoxicity prediction
|
||||
- Ames mutagenicity
|
||||
- LD50 estimates
|
||||
|
||||
Provide predictions with confidence scores and flag any red flags.
|
||||
""")
|
||||
|
||||
agent.save_conversation_history("admet_predictions.pdf")
|
||||
```
|
||||
|
||||
### Example 2: Target Identification
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Identify potential protein targets for Alzheimer's disease drug development.
|
||||
|
||||
Tasks:
|
||||
1. Query GWAS data for Alzheimer's-associated genes
|
||||
2. Identify genes with druggable domains (kinases, GPCRs, ion channels, etc.)
|
||||
3. Check for brain expression patterns
|
||||
4. Assess disease relevance via literature mining
|
||||
5. Evaluate existing chemical probe availability
|
||||
6. Rank targets by:
|
||||
- Genetic evidence strength
|
||||
- Druggability
|
||||
- Lack of existing therapies
|
||||
7. Suggest target validation experiments
|
||||
""")
|
||||
```
|
||||
|
||||
### Example 3: Virtual Screening
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Perform virtual screening for EGFR kinase inhibitors.
|
||||
|
||||
Database: ZINC15 lead-like subset (~6M compounds)
|
||||
Target: EGFR kinase domain (PDB: 1M17)
|
||||
|
||||
Workflow:
|
||||
1. Prepare protein structure (remove waters, add hydrogens)
|
||||
2. Define binding pocket (based on erlotinib binding site)
|
||||
3. Generate pharmacophore model from known EGFR inhibitors
|
||||
4. Filter ZINC database by:
|
||||
- Molecular weight: 200-500 Da
|
||||
- LogP: 0-5
|
||||
- Lipinski's rule of five
|
||||
- Pharmacophore match
|
||||
5. Dock top 10,000 compounds
|
||||
6. Score by docking energy and predicted binding affinity
|
||||
7. Select top 100 for further analysis
|
||||
8. Predict ADMET properties for top hits
|
||||
9. Recommend top 10 compounds for experimental validation
|
||||
""")
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
## GWAS and Genetic Analysis
|
||||
|
||||
### Example 1: GWAS Summary Statistics Analysis
|
||||
|
||||
**Task:** Interpret GWAS results and identify causal genes.
|
||||
|
||||
```python
|
||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||
|
||||
result = agent.go("""
|
||||
Analyze GWAS summary statistics for Type 2 Diabetes.
|
||||
|
||||
Input file: t2d_gwas_summary.txt
|
||||
Columns: CHR, BP, SNP, P, OR, BETA, SE, A1, A2
|
||||
|
||||
Analysis steps:
|
||||
1. Identify genome-wide significant variants (P < 5e-8)
|
||||
2. Perform LD clumping to identify independent signals
|
||||
3. Map variants to genes using:
|
||||
- Nearest gene
|
||||
- eQTL databases (GTEx)
|
||||
- Hi-C chromatin interactions
|
||||
4. Prioritize causal genes using multiple evidence:
|
||||
- Fine-mapping scores
|
||||
- Coding variant consequences
|
||||
- Gene expression in relevant tissues (pancreas, liver, adipose)
|
||||
- Pathway enrichment
|
||||
5. Identify druggable targets among causal genes
|
||||
6. Compare with known T2D genes and highlight novel associations
|
||||
7. Generate Manhattan plot, QQ plot, and gene prioritization table
|
||||
""")
|
||||
|
||||
agent.save_conversation_history("t2d_gwas_analysis.pdf")
|
||||
```
|
||||
|
||||
### Example 2: Polygenic Risk Score
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Develop and validate polygenic risk score (PRS) for coronary artery disease (CAD).
|
||||
|
||||
Training GWAS: CAD_discovery_summary_stats.txt (N=180,000)
|
||||
Validation cohort: CAD_validation_genotypes.vcf (N=50,000)
|
||||
|
||||
Tasks:
|
||||
1. Select variants for PRS using p-value thresholding (P < 1e-5)
|
||||
2. Perform LD clumping (r² < 0.1, 500kb window)
|
||||
3. Calculate PRS weights from GWAS betas
|
||||
4. Compute PRS for validation cohort individuals
|
||||
5. Evaluate PRS performance:
|
||||
- AUC for CAD case/control discrimination
|
||||
- Odds ratios across PRS deciles
|
||||
- Compare to traditional risk factors (age, sex, BMI, smoking)
|
||||
6. Assess PRS calibration and create risk stratification plot
|
||||
7. Identify high-risk individuals (top 5% PRS)
|
||||
""")
|
||||
```
|
||||
|
||||
### Example 3: Variant Pathogenicity Prediction
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Predict pathogenicity of rare coding variants in candidate disease genes.
|
||||
|
||||
Variants (VCF format):
|
||||
- chr17:41234451:A>G (BRCA1 p.Arg1347Gly)
|
||||
- chr2:179428448:C>T (TTN p.Trp13579*)
|
||||
- chr7:117188679:G>A (CFTR p.Gly542Ser)
|
||||
|
||||
For each variant, assess:
|
||||
1. In silico predictions (SIFT, PolyPhen2, CADD, REVEL)
|
||||
2. Population frequency (gnomAD)
|
||||
3. Evolutionary conservation (PhyloP, PhastCons)
|
||||
4. Protein structure impact (using AlphaFold structures)
|
||||
5. Functional domain location
|
||||
6. ClinVar annotations (if available)
|
||||
7. Literature evidence
|
||||
8. ACMG/AMP classification criteria
|
||||
|
||||
Provide pathogenicity classification (benign, likely benign, VUS, likely pathogenic, pathogenic) with supporting evidence.
|
||||
""")
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
## Clinical Genomics and Diagnostics
|
||||
|
||||
### Example 1: Rare Disease Diagnosis
|
||||
|
||||
**Task:** Diagnose rare genetic disease from whole exome sequencing.
|
||||
|
||||
```python
|
||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||
|
||||
result = agent.go("""
|
||||
Analyze whole exome sequencing (WES) data for rare disease diagnosis.
|
||||
|
||||
Patient phenotypes (HPO terms):
|
||||
- HP:0001250 (Seizures)
|
||||
- HP:0001249 (Intellectual disability)
|
||||
- HP:0001263 (Global developmental delay)
|
||||
- HP:0001252 (Hypotonia)
|
||||
|
||||
VCF file: patient_trio.vcf (proband + parents)
|
||||
|
||||
Analysis workflow:
|
||||
1. Variant filtering:
|
||||
- Quality filters (QUAL > 30, DP > 10, GQ > 20)
|
||||
- Frequency filters (gnomAD AF < 0.01)
|
||||
- Functional impact (missense, nonsense, frameshift, splice site)
|
||||
|
||||
2. Inheritance pattern analysis:
|
||||
- De novo variants
|
||||
- Autosomal recessive (compound het, homozygous)
|
||||
- X-linked
|
||||
|
||||
3. Phenotype-driven prioritization:
|
||||
- Match candidate genes to HPO terms
|
||||
- Use HPO-gene associations
|
||||
- Check gene expression in relevant tissues (brain)
|
||||
|
||||
4. Variant pathogenicity assessment:
|
||||
- In silico predictions
|
||||
- ACMG classification
|
||||
- Literature evidence
|
||||
|
||||
5. Generate diagnostic report with:
|
||||
- Top candidate variants
|
||||
- Supporting evidence
|
||||
- Functional validation suggestions
|
||||
- Genetic counseling recommendations
|
||||
""")
|
||||
|
||||
agent.save_conversation_history("rare_disease_diagnosis.pdf")
|
||||
```
|
||||
|
||||
### Example 2: Cancer Genomics Analysis
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Analyze tumor-normal paired sequencing for cancer genomics.
|
||||
|
||||
Files:
|
||||
- tumor_sample.vcf (somatic variants)
|
||||
- tumor_rnaseq.bam (gene expression)
|
||||
- tumor_cnv.seg (copy number variants)
|
||||
|
||||
Analysis:
|
||||
1. Identify driver mutations:
|
||||
- Known cancer genes (COSMIC, OncoKB)
|
||||
- Recurrent hotspot mutations
|
||||
- Truncating mutations in tumor suppressors
|
||||
|
||||
2. Analyze mutational signatures:
|
||||
- Decompose signatures (COSMIC signatures)
|
||||
- Identify mutagenic processes
|
||||
|
||||
3. Copy number analysis:
|
||||
- Identify amplifications and deletions
|
||||
- Focal vs. arm-level events
|
||||
- Assess oncogene amplifications and TSG deletions
|
||||
|
||||
4. Gene expression analysis:
|
||||
- Identify outlier gene expression
|
||||
- Fusion transcript detection
|
||||
- Pathway dysregulation
|
||||
|
||||
5. Therapeutic implications:
|
||||
- Match alterations to FDA-approved therapies
|
||||
- Identify clinical trial opportunities
|
||||
- Predict response to targeted therapies
|
||||
|
||||
6. Generate precision oncology report
|
||||
""")
|
||||
```
|
||||
|
||||
### Example 3: Pharmacogenomics
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Generate pharmacogenomics report for patient genotype data.
|
||||
|
||||
VCF file: patient_pgx.vcf
|
||||
|
||||
Analyze variants affecting drug metabolism:
|
||||
|
||||
**CYP450 genes:**
|
||||
- CYP2D6 (affects ~25% of drugs)
|
||||
- CYP2C19 (clopidogrel, PPIs, antidepressants)
|
||||
- CYP2C9 (warfarin, NSAIDs)
|
||||
- CYP3A5 (tacrolimus, immunosuppressants)
|
||||
|
||||
**Drug transporter genes:**
|
||||
- SLCO1B1 (statin myopathy risk)
|
||||
- ABCB1 (P-glycoprotein)
|
||||
|
||||
**Drug targets:**
|
||||
- VKORC1 (warfarin dosing)
|
||||
- DPYD (fluoropyrimidine toxicity)
|
||||
- TPMT (thiopurine toxicity)
|
||||
|
||||
For each gene:
|
||||
1. Determine diplotype (*1/*1, *1/*2, etc.)
|
||||
2. Assign metabolizer phenotype (PM, IM, NM, RM, UM)
|
||||
3. Provide dosing recommendations using CPIC/PharmGKB guidelines
|
||||
4. Flag high-risk drug-gene interactions
|
||||
5. Suggest alternative medications if needed
|
||||
|
||||
Generate patient-friendly report with actionable recommendations.
|
||||
""")
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
## Protein Structure and Function
|
||||
|
||||
### Example 1: AlphaFold Structure Analysis
|
||||
|
||||
```python
|
||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||
|
||||
result = agent.go("""
|
||||
Analyze AlphaFold structure prediction for novel protein.
|
||||
|
||||
Protein: Hypothetical protein ABC123 (UniProt: Q9XYZ1)
|
||||
|
||||
Tasks:
|
||||
1. Retrieve AlphaFold structure from database
|
||||
2. Assess prediction quality:
|
||||
- pLDDT scores per residue
|
||||
- Identify high-confidence regions (pLDDT > 90)
|
||||
- Flag low-confidence regions (pLDDT < 50)
|
||||
|
||||
3. Structural analysis:
|
||||
- Identify domains using structural alignment
|
||||
- Predict fold family
|
||||
- Identify secondary structure elements
|
||||
|
||||
4. Functional prediction:
|
||||
- Search for structural homologs in PDB
|
||||
- Identify conserved functional sites
|
||||
- Predict binding pockets
|
||||
- Suggest possible ligands/substrates
|
||||
|
||||
5. Variant impact analysis:
|
||||
- Map disease-associated variants to structure
|
||||
- Predict structural consequences
|
||||
- Identify variants affecting binding sites
|
||||
|
||||
6. Generate PyMOL visualization scripts highlighting key features
|
||||
""")
|
||||
|
||||
agent.save_conversation_history("alphafold_analysis.pdf")
|
||||
```
|
||||
|
||||
### Example 2: Protein-Protein Interaction Prediction
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Predict and analyze protein-protein interactions for autophagy pathway.
|
||||
|
||||
Query proteins: ATG5, ATG12, ATG16L1
|
||||
|
||||
Analysis:
|
||||
1. Retrieve known interactions from:
|
||||
- STRING database
|
||||
- BioGRID
|
||||
- IntAct
|
||||
- Literature mining
|
||||
|
||||
2. Predict novel interactions using:
|
||||
- Structural modeling (AlphaFold-Multimer)
|
||||
- Coexpression analysis
|
||||
- Phylogenetic profiling
|
||||
|
||||
3. Analyze interaction interfaces:
|
||||
- Identify binding residues
|
||||
- Assess interface properties (area, hydrophobicity)
|
||||
- Predict binding affinity
|
||||
|
||||
4. Functional analysis:
|
||||
- Map interactions to autophagy pathway steps
|
||||
- Identify regulatory interactions
|
||||
- Predict complex stoichiometry
|
||||
|
||||
5. Therapeutic implications:
|
||||
- Identify druggable interfaces
|
||||
- Suggest peptide inhibitors
|
||||
- Design disruption strategies
|
||||
|
||||
Generate network visualization and interaction details.
|
||||
""")
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
## Literature and Knowledge Synthesis
|
||||
|
||||
### Example 1: Systematic Literature Review
|
||||
|
||||
```python
|
||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||
|
||||
result = agent.go("""
|
||||
Perform systematic literature review on CRISPR base editing applications.
|
||||
|
||||
Search query: "CRISPR base editing" OR "base editor" OR "CBE" OR "ABE"
|
||||
Date range: 2016-2025
|
||||
|
||||
Tasks:
|
||||
1. Search PubMed and retrieve relevant abstracts
|
||||
2. Filter for original research articles
|
||||
3. Extract key information:
|
||||
- Base editor type (CBE, ABE, dual)
|
||||
- Target organism/cell type
|
||||
- Application (disease model, therapy, crop improvement)
|
||||
- Editing efficiency
|
||||
- Off-target assessment
|
||||
|
||||
4. Categorize applications:
|
||||
- Therapeutic applications (by disease)
|
||||
- Agricultural applications
|
||||
- Basic research
|
||||
|
||||
5. Analyze trends:
|
||||
- Publications over time
|
||||
- Most studied diseases
|
||||
- Evolution of base editor technology
|
||||
|
||||
6. Synthesize findings:
|
||||
- Clinical trial status
|
||||
- Remaining challenges
|
||||
- Future directions
|
||||
|
||||
Generate comprehensive review document with citation statistics.
|
||||
""")
|
||||
|
||||
agent.save_conversation_history("crispr_base_editing_review.pdf")
|
||||
```
|
||||
|
||||
### Example 2: Gene Function Synthesis
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Synthesize knowledge about gene function from multiple sources.
|
||||
|
||||
Target gene: PARK7 (DJ-1)
|
||||
|
||||
Integrate information from:
|
||||
1. **Genetic databases:**
|
||||
- NCBI Gene
|
||||
- UniProt
|
||||
- OMIM
|
||||
|
||||
2. **Expression data:**
|
||||
- GTEx tissue expression
|
||||
- Human Protein Atlas
|
||||
- Single-cell expression atlases
|
||||
|
||||
3. **Functional data:**
|
||||
- GO annotations
|
||||
- KEGG pathways
|
||||
- Reactome
|
||||
- Protein interactions (STRING)
|
||||
|
||||
4. **Disease associations:**
|
||||
- ClinVar variants
|
||||
- GWAS catalog
|
||||
- Disease databases (DisGeNET)
|
||||
|
||||
5. **Literature:**
|
||||
- PubMed abstracts
|
||||
- Key mechanistic studies
|
||||
- Review articles
|
||||
|
||||
Synthesize into comprehensive gene report:
|
||||
- Molecular function
|
||||
- Biological processes
|
||||
- Cellular localization
|
||||
- Tissue distribution
|
||||
- Disease associations
|
||||
- Known drug targets/inhibitors
|
||||
- Unresolved questions
|
||||
|
||||
Generate structured summary suitable for research planning.
|
||||
""")
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
## Multi-Omics Integration
|
||||
|
||||
### Example 1: Multi-Omics Disease Analysis
|
||||
|
||||
```python
|
||||
agent = A1(path='./data', llm='claude-sonnet-4-20250514')
|
||||
|
||||
result = agent.go("""
|
||||
Integrate multi-omics data to understand disease mechanism.
|
||||
|
||||
Disease: Alzheimer's disease
|
||||
Data types:
|
||||
- Genomics: GWAS summary statistics (gwas_ad.txt)
|
||||
- Transcriptomics: Brain RNA-seq (controls vs AD, rnaseq_data.csv)
|
||||
- Proteomics: CSF proteomics (proteomics_csf.csv)
|
||||
- Metabolomics: Plasma metabolomics (metabolomics_plasma.csv)
|
||||
- Epigenomics: Brain methylation array (methylation_data.csv)
|
||||
|
||||
Integration workflow:
|
||||
1. Analyze each omics layer independently:
|
||||
- Identify significantly altered features
|
||||
- Perform pathway enrichment
|
||||
|
||||
2. Cross-omics correlation:
|
||||
- Correlate gene expression with protein levels
|
||||
- Link genetic variants to expression (eQTL)
|
||||
- Associate methylation with gene expression
|
||||
- Connect proteins to metabolites
|
||||
|
||||
3. Network analysis:
|
||||
- Build multi-omics network
|
||||
- Identify key hub genes/proteins
|
||||
- Detect disease modules
|
||||
|
||||
4. Causal inference:
|
||||
- Prioritize drivers vs. consequences
|
||||
- Identify therapeutic targets
|
||||
- Predict drug mechanisms
|
||||
|
||||
5. Generate integrative model of AD pathogenesis
|
||||
|
||||
Provide visualization and therapeutic target recommendations.
|
||||
""")
|
||||
|
||||
agent.save_conversation_history("ad_multiomics_analysis.pdf")
|
||||
```
|
||||
|
||||
### Example 2: Systems Biology Modeling
|
||||
|
||||
```python
|
||||
result = agent.go("""
|
||||
Build systems biology model of metabolic pathway.
|
||||
|
||||
Pathway: Glycolysis
|
||||
Data sources:
|
||||
- Enzyme kinetics (BRENDA database)
|
||||
- Metabolite concentrations (literature)
|
||||
- Gene expression (tissue-specific, GTEx)
|
||||
- Flux measurements (C13 labeling studies)
|
||||
|
||||
Modeling tasks:
|
||||
1. Construct pathway model:
|
||||
- Define reactions and stoichiometry
|
||||
- Parameterize enzyme kinetics (Km, Vmax, Ki)
|
||||
- Set initial metabolite concentrations
|
||||
|
||||
2. Simulate pathway dynamics:
|
||||
- Steady-state analysis
|
||||
- Time-course simulations
|
||||
- Sensitivity analysis
|
||||
|
||||
3. Constraint-based modeling:
|
||||
- Flux balance analysis (FBA)
|
||||
- Identify bottleneck reactions
|
||||
- Predict metabolic engineering strategies
|
||||
|
||||
4. Integrate with gene expression:
|
||||
- Tissue-specific model predictions
|
||||
- Disease vs. normal comparisons
|
||||
|
||||
5. Therapeutic predictions:
|
||||
- Enzyme inhibition effects
|
||||
- Metabolic rescue strategies
|
||||
- Drug target identification
|
||||
|
||||
Generate model in SBML format and simulation results.
|
||||
""")
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
## Best Practices for Task Formulation
|
||||
|
||||
### 1. Be Specific and Detailed
|
||||
|
||||
**Poor:**
|
||||
```python
|
||||
agent.go("Analyze this RNA-seq data")
|
||||
```
|
||||
|
||||
**Good:**
|
||||
```python
|
||||
agent.go("""
|
||||
Analyze bulk RNA-seq data from cancer vs. normal samples.
|
||||
|
||||
Files: cancer_rnaseq.csv (TPM values, 50 cancer, 50 normal)
|
||||
|
||||
Tasks:
|
||||
1. Differential expression (DESeq2, padj < 0.05, |log2FC| > 1)
|
||||
2. Pathway enrichment (KEGG, Reactome)
|
||||
3. Generate volcano plot and top DE gene heatmap
|
||||
""")
|
||||
```
|
||||
|
||||
### 2. Include File Paths and Formats
|
||||
|
||||
Always specify:
|
||||
- Exact file paths
|
||||
- File formats (VCF, BAM, CSV, H5AD, etc.)
|
||||
- Data structure (columns, sample IDs)
|
||||
|
||||
### 3. Set Clear Success Criteria
|
||||
|
||||
Define thresholds and cutoffs:
|
||||
- Statistical significance (P < 0.05, FDR < 0.1)
|
||||
- Fold change thresholds
|
||||
- Quality filters
|
||||
- Expected outputs
|
||||
|
||||
### 4. Request Visualizations
|
||||
|
||||
Explicitly ask for plots:
|
||||
- Volcano plots, MA plots
|
||||
- Heatmaps, PCA plots
|
||||
- Network diagrams
|
||||
- Manhattan plots
|
||||
|
||||
### 5. Specify Biological Context
|
||||
|
||||
Include:
|
||||
- Organism (human, mouse, etc.)
|
||||
- Tissue/cell type
|
||||
- Disease/condition
|
||||
- Treatment details
|
||||
|
||||
### 6. Request Interpretations
|
||||
|
||||
Ask agent to:
|
||||
- Interpret biological significance
|
||||
- Suggest follow-up experiments
|
||||
- Identify limitations
|
||||
- Provide literature context
|
||||
|
||||
---
|
||||
|
||||
## Common Patterns
|
||||
|
||||
### Data Quality Control
|
||||
|
||||
```python
|
||||
"""
|
||||
Before analysis, perform quality control:
|
||||
1. Check for missing values
|
||||
2. Assess data distributions
|
||||
3. Identify outliers
|
||||
4. Generate QC report
|
||||
Only proceed with analysis if data passes QC.
|
||||
"""
|
||||
```
|
||||
|
||||
### Iterative Refinement
|
||||
|
||||
```python
|
||||
"""
|
||||
Perform analysis in stages:
|
||||
1. Initial exploratory analysis
|
||||
2. Based on results, refine parameters
|
||||
3. Focus on interesting findings
|
||||
4. Generate final report
|
||||
|
||||
Show intermediate results for each stage.
|
||||
"""
|
||||
```
|
||||
|
||||
### Reproducibility
|
||||
|
||||
```python
|
||||
"""
|
||||
Ensure reproducibility:
|
||||
1. Set random seeds where applicable
|
||||
2. Log all parameters used
|
||||
3. Save intermediate files
|
||||
4. Export environment info (package versions)
|
||||
5. Generate methods section for paper
|
||||
"""
|
||||
```
|
||||
|
||||
These examples demonstrate the breadth of biomedical tasks biomni can handle. Adapt the patterns to your specific research questions, and always include sufficient detail for the agent to execute autonomously.
|
||||
Reference in New Issue
Block a user