mirror of
https://github.com/K-Dense-AI/claude-scientific-skills.git
synced 2026-03-27 07:09:27 +08:00
8.9 KiB
8.9 KiB
Rowan Molecule Handling Reference
Overview
Rowan uses the stjames library for molecular representations. The stjames.Molecule class provides a unified interface for creating molecules from various sources and accessing molecular properties.
Table of Contents
- Creating Molecules
- Molecule Attributes
- Geometry Methods
- File I/O
- Conversion Functions
- Working with Atoms
Creating Molecules
From SMILES
import stjames
# Simple SMILES
mol = stjames.Molecule.from_smiles("CCO") # Ethanol
mol = stjames.Molecule.from_smiles("c1ccccc1") # Benzene
# With stereochemistry
mol = stjames.Molecule.from_smiles("C[C@H](O)[C@@H](O)C") # meso-2,3-butanediol
# Charged molecules
mol = stjames.Molecule.from_smiles("[NH4+]") # Ammonium
mol = stjames.Molecule.from_smiles("CC(=O)[O-]") # Acetate
# Complex drug-like molecules
mol = stjames.Molecule.from_smiles("CC(=O)Oc1ccccc1C(=O)O") # Aspirin
Note: from_smiles() automatically generates 3D coordinates.
From XYZ String
import stjames
xyz_string = """3
Water molecule
O 0.000 0.000 0.117
H 0.000 0.757 -0.469
H 0.000 -0.757 -0.469"""
mol = stjames.Molecule.from_xyz(xyz_string)
XYZ format with optional metadata in comment line:
N_atoms
charge=0 multiplicity=1 energy=-76.4 comment
Element X Y Z
...
From XYZ File
import stjames
mol = stjames.Molecule.from_file("structure.xyz")
From Extended XYZ (EXTXYZ)
Extended XYZ supports additional properties like forces and cell parameters.
import stjames
extxyz_string = """3
Lattice="10.0 0.0 0.0 0.0 10.0 0.0 0.0 0.0 10.0" Properties=species:S:1:pos:R:3:forces:R:3 energy=-76.4
O 0.000 0.000 0.117 0.01 0.02 0.03
H 0.000 0.757 -0.469 0.00 0.00 0.00
H 0.000 -0.757 -0.469 0.00 0.00 0.00"""
mol = stjames.Molecule.from_extxyz(extxyz_string)
# Access cell information
if mol.cell:
print(f"Cell: {mol.cell.lattice_vectors}")
From RDKit Molecule
import stjames
from rdkit import Chem
from rdkit.Chem import AllChem
# Create RDKit molecule with 3D coordinates
rdkit_mol = Chem.MolFromSmiles("CCO")
rdkit_mol = Chem.AddHs(rdkit_mol)
AllChem.EmbedMolecule(rdkit_mol)
AllChem.MMFFOptimizeMolecule(rdkit_mol)
# Convert to stjames
mol = stjames.Molecule.from_rdkit(rdkit_mol)
Specifying Charge and Multiplicity
import stjames
# Neutral singlet (default)
mol = stjames.Molecule.from_smiles("CCO")
# Cation doublet
mol = stjames.Molecule.from_smiles("CCO", charge=1, multiplicity=2)
# Anion singlet
mol = stjames.Molecule.from_smiles("CC(=O)[O-]", charge=-1, multiplicity=1)
# Triplet oxygen
mol = stjames.Molecule.from_smiles("[O][O]", charge=0, multiplicity=3)
Molecule Attributes
Basic Properties
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Charge and spin
print(f"Charge: {mol.charge}") # 0
print(f"Multiplicity: {mol.multiplicity}") # 1
# Number of atoms
print(f"Number of atoms: {len(mol.atoms)}")
Computed Properties (after calculation)
# After running a calculation
print(f"Energy: {mol.energy} Hartree")
print(f"Dipole: {mol.dipole}") # (x, y, z) in Debye
# Atomic properties
print(f"Mulliken charges: {mol.mulliken_charges}")
print(f"Mulliken spin densities: {mol.mulliken_spin_densities}")
Thermochemistry (after frequency calculation)
# After frequency calculation
print(f"ZPE: {mol.zero_point_energy} Hartree")
print(f"Thermal correction to enthalpy: {mol.thermal_correction_enthalpy}")
print(f"Thermal correction to Gibbs: {mol.thermal_correction_gibbs}")
print(f"Gibbs free energy: {mol.gibbs_free_energy} Hartree")
Vibrational Modes (after frequency calculation)
for mode in mol.vibrational_modes:
print(f"Frequency: {mode.frequency} cm⁻¹")
print(f"Reduced mass: {mode.reduced_mass} amu")
print(f"IR intensity: {mode.ir_intensity} km/mol")
print(f"Displacements: {mode.displacements}")
Periodic Cell
if mol.cell:
print(f"Lattice vectors: {mol.cell.lattice_vectors}")
print(f"Is periodic: True")
Geometry Methods
Distance Between Atoms
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Distance between atoms 0 and 1 (in Angstroms)
d = mol.distance(0, 1)
print(f"C-C bond length: {d:.3f} Å")
Angle Between Three Atoms
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Angle formed by atoms 0-1-2 (C-C-O)
angle = mol.angle(0, 1, 2, degrees=True)
print(f"C-C-O angle: {angle:.1f}°")
# In radians
angle_rad = mol.angle(0, 1, 2, degrees=False)
Dihedral Angle
import stjames
mol = stjames.Molecule.from_smiles("CCCC")
# Dihedral angle for atoms 0-1-2-3
dihedral = mol.dihedral(0, 1, 2, 3, degrees=True)
print(f"Dihedral: {dihedral:.1f}°")
# Use positive domain (0 to 360)
dihedral_pos = mol.dihedral(0, 1, 2, 3, degrees=True, positive_domain=True)
Translation
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Translate by vector
translated = mol.translated([1.0, 0.0, 0.0]) # Move 1 Å in x direction
File I/O
Export to XYZ
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Get XYZ string
xyz_str = mol.to_xyz(comment="Ethanol optimized structure")
print(xyz_str)
# Write to file
mol.to_xyz(comment="Ethanol", out_file="ethanol.xyz")
Export to Extended XYZ
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Include energy in comment
xyz_str = mol.to_xyz(comment=f"energy={mol.energy}")
Conversion Functions
SMILES to Molecule (Rowan Utility)
import rowan
# Quick conversion using Rowan's utility
mol = rowan.smiles_to_stjames("CCO")
Molecule Lookup by Name
import rowan
# Convert common names to SMILES
smiles = rowan.molecule_lookup("aspirin")
print(smiles) # "CC(=O)Oc1ccccc1C(=O)O"
smiles = rowan.molecule_lookup("caffeine")
print(smiles) # "Cn1cnc2c1c(=O)n(c(=O)n2C)C"
# Use with workflow submission
mol = stjames.Molecule.from_smiles(rowan.molecule_lookup("ibuprofen"))
workflow = rowan.submit_pka_workflow(mol, name="Ibuprofen pKa")
Working with Atoms
Atom Class
Each atom in mol.atoms is an Atom object.
import stjames
mol = stjames.Molecule.from_smiles("CCO")
for i, atom in enumerate(mol.atoms):
print(f"Atom {i}: {atom.element}")
print(f" Position: ({atom.x:.3f}, {atom.y:.3f}, {atom.z:.3f})")
Atom Attributes
| Attribute | Type | Description |
|---|---|---|
element |
str | Element symbol (e.g., "C", "O", "H") |
x |
float | X coordinate (Å) |
y |
float | Y coordinate (Å) |
z |
float | Z coordinate (Å) |
atomic_number |
int | Atomic number |
Getting Coordinates as Array
import stjames
import numpy as np
mol = stjames.Molecule.from_smiles("CCO")
# Extract positions as numpy array
positions = np.array([[atom.x, atom.y, atom.z] for atom in mol.atoms])
print(f"Positions shape: {positions.shape}") # (N_atoms, 3)
Common Patterns
Batch Molecule Creation
import stjames
smiles_list = ["CCO", "CC(=O)O", "c1ccccc1", "c1ccccc1O"]
molecules = []
for smi in smiles_list:
try:
mol = stjames.Molecule.from_smiles(smi)
molecules.append(mol)
except Exception as e:
print(f"Failed to create molecule from {smi}: {e}")
print(f"Created {len(molecules)} molecules")
Modifying Charge/Multiplicity
import stjames
# Create neutral molecule
mol = stjames.Molecule.from_smiles("c1ccccc1")
# Create cation version
mol_cation = stjames.Molecule.from_smiles("c1ccccc1", charge=1, multiplicity=2)
# Or modify existing (if supported)
# Note: May need to recreate from coordinates
Combining Geometry Analysis
import stjames
mol = stjames.Molecule.from_smiles("CCCC")
# Analyze butane conformer
print("Butane geometry analysis:")
print(f" C1-C2 bond: {mol.distance(0, 1):.3f} Å")
print(f" C2-C3 bond: {mol.distance(1, 2):.3f} Å")
print(f" C3-C4 bond: {mol.distance(2, 3):.3f} Å")
print(f" C-C-C angle: {mol.angle(0, 1, 2, degrees=True):.1f}°")
print(f" C-C-C-C dihedral: {mol.dihedral(0, 1, 2, 3, degrees=True):.1f}°")
Electron Sanity Check
The stjames.Molecule class validates that charge and multiplicity are consistent with the number of electrons:
import stjames
# This will fail validation
try:
# Oxygen with wrong multiplicity
mol = stjames.Molecule.from_smiles("[O][O]", charge=0, multiplicity=1)
except ValueError as e:
print(f"Validation error: {e}")
# Correct: triplet oxygen
mol = stjames.Molecule.from_smiles("[O][O]", charge=0, multiplicity=3)
The validation ensures:
- Number of electrons = sum(atomic_numbers) - charge
- Multiplicity is compatible with electron count (odd/even)