Initial commit for rowan

This commit is contained in:
dfty
2026-01-28 12:44:07 +08:00
commit b9e786d88b
7 changed files with 3278 additions and 0 deletions

413
references/api_reference.md Normal file
View File

@@ -0,0 +1,413 @@
# Rowan API Reference
## Table of Contents
1. [Workflow Class](#workflow-class)
2. [Workflow Submission Functions](#workflow-submission-functions)
3. [Workflow Retrieval Functions](#workflow-retrieval-functions)
4. [Batch Operations](#batch-operations)
5. [Utility Functions](#utility-functions)
---
## Workflow Class
The `Workflow` class represents a submitted computational job.
### Attributes
| Attribute | Type | Description |
|-----------|------|-------------|
| `uuid` | str | Unique identifier |
| `name` | str | User-assigned name |
| `status` | str | Current status: "pending", "running", "completed", "failed" |
| `created_at` | datetime | Submission timestamp |
| `completed_at` | datetime | Completion timestamp (None if not finished) |
| `credits_charged` | float | Credits consumed |
| `data` | dict | Workflow results (lazy-loaded) |
| `workflow_type` | str | Type of calculation |
| `folder_uuid` | str | Parent folder UUID |
**Note:** Workflow data is not loaded by default to avoid unnecessary downloads. Call `fetch_latest()` to load results.
### Methods
#### Status Management
```python
# Get current status
status = workflow.get_status()
# Check if finished
if workflow.is_finished():
print("Done!")
# Block until completion
workflow.wait_for_result(timeout=3600) # Optional timeout in seconds
# Refresh from API
workflow.fetch_latest(in_place=True)
```
#### Data Operations
```python
# Update metadata
workflow.update(
name="New name",
notes="Additional notes",
starred=True
)
# Delete workflow
workflow.delete()
# Delete only results data (keep metadata)
workflow.delete_data()
# Download trajectory files (for MD workflows)
workflow.download_dcd_files(output_dir="trajectories/")
# Download SDF file
workflow.download_sdf_file(output_path="molecule.sdf")
```
#### Execution Control
```python
# Stop a running workflow
workflow.stop()
```
---
## Workflow Submission Functions
### Generic Submission
```python
rowan.submit_workflow(
name: str, # Workflow name
initial_molecule: Molecule, # stjames.Molecule object
workflow_type: str, # e.g., "pka", "optimization", "conformer_search"
workflow_data: dict = {}, # Workflow-specific parameters
folder_uuid: str = None, # Optional folder
max_credits: float = None # Credit limit
) -> Workflow
```
### Specialized Submission Functions
All functions return a `Workflow` object.
#### Property Prediction
```python
# pKa calculation
rowan.submit_pka_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Redox potential
rowan.submit_redox_potential_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Solubility prediction
rowan.submit_solubility_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Fukui indices (reactivity)
rowan.submit_fukui_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Bond dissociation energy
rowan.submit_bde_workflow(
initial_molecule: Molecule,
bond_indices: tuple, # (atom1_idx, atom2_idx)
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
```
#### Molecular Modeling
```python
# Geometry optimization
rowan.submit_basic_calculation_workflow(
initial_molecule: Molecule,
workflow_type: str = "optimization", # or "single_point", "frequency"
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Conformer search
rowan.submit_conformer_search_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Tautomer search
rowan.submit_tautomer_search_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Dihedral scan
rowan.submit_dihedral_scan_workflow(
initial_molecule: Molecule,
dihedral_indices: tuple, # (a1, a2, a3, a4)
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Transition state search
rowan.submit_ts_search_workflow(
initial_molecule: Molecule, # Starting guess
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
```
#### Protein-Ligand Workflows
```python
# Docking
rowan.submit_docking_workflow(
protein: str, # Protein UUID
pocket: dict, # {"center": [x,y,z], "size": [dx,dy,dz]}
initial_molecule: Molecule,
executable: str = "vina", # "vina" or "qvina2"
scoring_function: str = "vinardo",
exhaustiveness: int = 8,
do_csearch: bool = True,
do_optimization: bool = True,
do_pose_refinement: bool = True,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Batch docking
rowan.submit_batch_docking_workflow(
protein: str,
pocket: dict,
smiles_list: list, # List of SMILES strings
executable: str = "qvina2",
scoring_function: str = "vina",
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Protein cofolding
rowan.submit_protein_cofolding_workflow(
initial_protein_sequences: list, # List of amino acid sequences
initial_smiles_list: list = None, # Optional ligand SMILES
ligand_binding_affinity_index: int = None,
use_msa_server: bool = False,
use_potentials: bool = True,
compute_strain: bool = False,
do_pose_refinement: bool = False,
model: str = "boltz_2", # "boltz_1x", "boltz_2", "chai_1r"
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
```
#### Spectroscopy & Analysis
```python
# NMR prediction
rowan.submit_nmr_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Ion mobility (collision cross-section)
rowan.submit_ion_mobility_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
# Molecular descriptors
rowan.submit_descriptors_workflow(
initial_molecule: Molecule,
name: str = None,
folder_uuid: str = None,
max_credits: float = None
)
```
---
## Workflow Retrieval Functions
```python
# Retrieve single workflow by UUID
workflow = rowan.retrieve_workflow(uuid: str) -> Workflow
# Retrieve multiple workflows
workflows = rowan.retrieve_workflows(uuids: list) -> list[Workflow]
# List workflows with filtering
workflows = rowan.list_workflows(
name: str = None, # Filter by name (partial match)
status: str = None, # "pending", "running", "completed", "failed"
workflow_type: str = None, # e.g., "pka", "docking"
starred: bool = None, # Filter by starred status
folder_uuid: str = None, # Filter by folder
page: int = 1, # Pagination
size: int = 20 # Results per page
) -> list[Workflow]
```
---
## Batch Operations
```python
# Submit multiple workflows at once
workflows = rowan.batch_submit_workflow(
molecules: list, # List of stjames.Molecule objects
workflow_type: str, # Workflow type for all
workflow_data: dict = {},
folder_uuid: str = None,
max_credits: float = None
) -> list[Workflow]
# Poll status of multiple workflows
statuses = rowan.batch_poll_status(
uuids: list # List of workflow UUIDs
) -> dict # {uuid: status}
```
---
## Utility Functions
```python
# Get current user info
user = rowan.whoami() -> User
# user.username, user.email, user.credits, user.weekly_credits
# Convert SMILES to stjames.Molecule
mol = rowan.smiles_to_stjames(smiles: str) -> Molecule
# Get API key from environment
api_key = rowan.get_api_key() -> str
# Low-level API client
client = rowan.api_client() -> httpx.Client
# Molecule name lookup
smiles = rowan.molecule_lookup(name: str) -> str
# e.g., rowan.molecule_lookup("aspirin") -> "CC(=O)Oc1ccccc1C(=O)O"
```
---
## User Class
Returned by `rowan.whoami()`.
### Attributes
| Attribute | Type | Description |
|-----------|------|-------------|
| `username` | str | Username |
| `email` | str | Email address |
| `firstname` | str | First name |
| `lastname` | str | Last name |
| `credits` | float | Available credits |
| `weekly_credits` | float | Weekly credit allocation |
| `organization` | dict | Organization details |
| `individual_subscription` | dict | Subscription information |
---
## Error Handling
```python
import rowan
try:
workflow = rowan.submit_pka_workflow(mol, name="test")
except rowan.RowanAPIError as e:
print(f"API error: {e}")
except rowan.AuthenticationError as e:
print(f"Authentication failed: {e}")
except rowan.RateLimitError as e:
print(f"Rate limited, retry after: {e.retry_after}")
```
---
## Common Patterns
### Waiting for Multiple Workflows
```python
import rowan
import time
workflows = [rowan.submit_pka_workflow(mol) for mol in molecules]
# Poll until all complete
while True:
statuses = rowan.batch_poll_status([wf.uuid for wf in workflows])
if all(s in ["completed", "failed"] for s in statuses.values()):
break
time.sleep(10)
# Fetch results
for wf in workflows:
wf.fetch_latest(in_place=True)
if wf.status == "completed":
print(wf.data)
```
### Organizing Workflows in Folders
```python
import rowan
# Create project structure
project = rowan.create_project("Drug Discovery")
lead_folder = rowan.create_folder("Lead Compounds", project_uuid=project.uuid)
backup_folder = rowan.create_folder("Backup Series", project_uuid=project.uuid)
# Submit to specific folder
workflow = rowan.submit_pka_workflow(
mol,
name="Lead 1 pKa",
folder_uuid=lead_folder.uuid
)
```

View File

@@ -0,0 +1,429 @@
# Rowan Molecule Handling Reference
## Overview
Rowan uses the `stjames` library for molecular representations. The `stjames.Molecule` class provides a unified interface for creating molecules from various sources and accessing molecular properties.
## Table of Contents
1. [Creating Molecules](#creating-molecules)
2. [Molecule Attributes](#molecule-attributes)
3. [Geometry Methods](#geometry-methods)
4. [File I/O](#file-io)
5. [Conversion Functions](#conversion-functions)
6. [Working with Atoms](#working-with-atoms)
---
## Creating Molecules
### From SMILES
```python
import stjames
# Simple SMILES
mol = stjames.Molecule.from_smiles("CCO") # Ethanol
mol = stjames.Molecule.from_smiles("c1ccccc1") # Benzene
# With stereochemistry
mol = stjames.Molecule.from_smiles("C[C@H](O)[C@@H](O)C") # meso-2,3-butanediol
# Charged molecules
mol = stjames.Molecule.from_smiles("[NH4+]") # Ammonium
mol = stjames.Molecule.from_smiles("CC(=O)[O-]") # Acetate
# Complex drug-like molecules
mol = stjames.Molecule.from_smiles("CC(=O)Oc1ccccc1C(=O)O") # Aspirin
```
**Note:** `from_smiles()` automatically generates 3D coordinates.
---
### From XYZ String
```python
import stjames
xyz_string = """3
Water molecule
O 0.000 0.000 0.117
H 0.000 0.757 -0.469
H 0.000 -0.757 -0.469"""
mol = stjames.Molecule.from_xyz(xyz_string)
```
**XYZ format with optional metadata in comment line:**
```
N_atoms
charge=0 multiplicity=1 energy=-76.4 comment
Element X Y Z
...
```
---
### From XYZ File
```python
import stjames
mol = stjames.Molecule.from_file("structure.xyz")
```
---
### From Extended XYZ (EXTXYZ)
Extended XYZ supports additional properties like forces and cell parameters.
```python
import stjames
extxyz_string = """3
Lattice="10.0 0.0 0.0 0.0 10.0 0.0 0.0 0.0 10.0" Properties=species:S:1:pos:R:3:forces:R:3 energy=-76.4
O 0.000 0.000 0.117 0.01 0.02 0.03
H 0.000 0.757 -0.469 0.00 0.00 0.00
H 0.000 -0.757 -0.469 0.00 0.00 0.00"""
mol = stjames.Molecule.from_extxyz(extxyz_string)
# Access cell information
if mol.cell:
print(f"Cell: {mol.cell.lattice_vectors}")
```
---
### From RDKit Molecule
```python
import stjames
from rdkit import Chem
from rdkit.Chem import AllChem
# Create RDKit molecule with 3D coordinates
rdkit_mol = Chem.MolFromSmiles("CCO")
rdkit_mol = Chem.AddHs(rdkit_mol)
AllChem.EmbedMolecule(rdkit_mol)
AllChem.MMFFOptimizeMolecule(rdkit_mol)
# Convert to stjames
mol = stjames.Molecule.from_rdkit(rdkit_mol)
```
---
### Specifying Charge and Multiplicity
```python
import stjames
# Neutral singlet (default)
mol = stjames.Molecule.from_smiles("CCO")
# Cation doublet
mol = stjames.Molecule.from_smiles("CCO", charge=1, multiplicity=2)
# Anion singlet
mol = stjames.Molecule.from_smiles("CC(=O)[O-]", charge=-1, multiplicity=1)
# Triplet oxygen
mol = stjames.Molecule.from_smiles("[O][O]", charge=0, multiplicity=3)
```
---
## Molecule Attributes
### Basic Properties
```python
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Charge and spin
print(f"Charge: {mol.charge}") # 0
print(f"Multiplicity: {mol.multiplicity}") # 1
# Number of atoms
print(f"Number of atoms: {len(mol.atoms)}")
```
### Computed Properties (after calculation)
```python
# After running a calculation
print(f"Energy: {mol.energy} Hartree")
print(f"Dipole: {mol.dipole}") # (x, y, z) in Debye
# Atomic properties
print(f"Mulliken charges: {mol.mulliken_charges}")
print(f"Mulliken spin densities: {mol.mulliken_spin_densities}")
```
### Thermochemistry (after frequency calculation)
```python
# After frequency calculation
print(f"ZPE: {mol.zero_point_energy} Hartree")
print(f"Thermal correction to enthalpy: {mol.thermal_correction_enthalpy}")
print(f"Thermal correction to Gibbs: {mol.thermal_correction_gibbs}")
print(f"Gibbs free energy: {mol.gibbs_free_energy} Hartree")
```
### Vibrational Modes (after frequency calculation)
```python
for mode in mol.vibrational_modes:
print(f"Frequency: {mode.frequency} cm⁻¹")
print(f"Reduced mass: {mode.reduced_mass} amu")
print(f"IR intensity: {mode.ir_intensity} km/mol")
print(f"Displacements: {mode.displacements}")
```
### Periodic Cell
```python
if mol.cell:
print(f"Lattice vectors: {mol.cell.lattice_vectors}")
print(f"Is periodic: True")
```
---
## Geometry Methods
### Distance Between Atoms
```python
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Distance between atoms 0 and 1 (in Angstroms)
d = mol.distance(0, 1)
print(f"C-C bond length: {d:.3f} Å")
```
### Angle Between Three Atoms
```python
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Angle formed by atoms 0-1-2 (C-C-O)
angle = mol.angle(0, 1, 2, degrees=True)
print(f"C-C-O angle: {angle:.1f}°")
# In radians
angle_rad = mol.angle(0, 1, 2, degrees=False)
```
### Dihedral Angle
```python
import stjames
mol = stjames.Molecule.from_smiles("CCCC")
# Dihedral angle for atoms 0-1-2-3
dihedral = mol.dihedral(0, 1, 2, 3, degrees=True)
print(f"Dihedral: {dihedral:.1f}°")
# Use positive domain (0 to 360)
dihedral_pos = mol.dihedral(0, 1, 2, 3, degrees=True, positive_domain=True)
```
### Translation
```python
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Translate by vector
translated = mol.translated([1.0, 0.0, 0.0]) # Move 1 Å in x direction
```
---
## File I/O
### Export to XYZ
```python
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Get XYZ string
xyz_str = mol.to_xyz(comment="Ethanol optimized structure")
print(xyz_str)
# Write to file
mol.to_xyz(comment="Ethanol", out_file="ethanol.xyz")
```
### Export to Extended XYZ
```python
import stjames
mol = stjames.Molecule.from_smiles("CCO")
# Include energy in comment
xyz_str = mol.to_xyz(comment=f"energy={mol.energy}")
```
---
## Conversion Functions
### SMILES to Molecule (Rowan Utility)
```python
import rowan
# Quick conversion using Rowan's utility
mol = rowan.smiles_to_stjames("CCO")
```
### Molecule Lookup by Name
```python
import rowan
# Convert common names to SMILES
smiles = rowan.molecule_lookup("aspirin")
print(smiles) # "CC(=O)Oc1ccccc1C(=O)O"
smiles = rowan.molecule_lookup("caffeine")
print(smiles) # "Cn1cnc2c1c(=O)n(c(=O)n2C)C"
# Use with workflow submission
mol = stjames.Molecule.from_smiles(rowan.molecule_lookup("ibuprofen"))
workflow = rowan.submit_pka_workflow(mol, name="Ibuprofen pKa")
```
---
## Working with Atoms
### Atom Class
Each atom in `mol.atoms` is an `Atom` object.
```python
import stjames
mol = stjames.Molecule.from_smiles("CCO")
for i, atom in enumerate(mol.atoms):
print(f"Atom {i}: {atom.element}")
print(f" Position: ({atom.x:.3f}, {atom.y:.3f}, {atom.z:.3f})")
```
### Atom Attributes
| Attribute | Type | Description |
|-----------|------|-------------|
| `element` | str | Element symbol (e.g., "C", "O", "H") |
| `x` | float | X coordinate (Å) |
| `y` | float | Y coordinate (Å) |
| `z` | float | Z coordinate (Å) |
| `atomic_number` | int | Atomic number |
### Getting Coordinates as Array
```python
import stjames
import numpy as np
mol = stjames.Molecule.from_smiles("CCO")
# Extract positions as numpy array
positions = np.array([[atom.x, atom.y, atom.z] for atom in mol.atoms])
print(f"Positions shape: {positions.shape}") # (N_atoms, 3)
```
---
## Common Patterns
### Batch Molecule Creation
```python
import stjames
smiles_list = ["CCO", "CC(=O)O", "c1ccccc1", "c1ccccc1O"]
molecules = []
for smi in smiles_list:
try:
mol = stjames.Molecule.from_smiles(smi)
molecules.append(mol)
except Exception as e:
print(f"Failed to create molecule from {smi}: {e}")
print(f"Created {len(molecules)} molecules")
```
### Modifying Charge/Multiplicity
```python
import stjames
# Create neutral molecule
mol = stjames.Molecule.from_smiles("c1ccccc1")
# Create cation version
mol_cation = stjames.Molecule.from_smiles("c1ccccc1", charge=1, multiplicity=2)
# Or modify existing (if supported)
# Note: May need to recreate from coordinates
```
### Combining Geometry Analysis
```python
import stjames
mol = stjames.Molecule.from_smiles("CCCC")
# Analyze butane conformer
print("Butane geometry analysis:")
print(f" C1-C2 bond: {mol.distance(0, 1):.3f} Å")
print(f" C2-C3 bond: {mol.distance(1, 2):.3f} Å")
print(f" C3-C4 bond: {mol.distance(2, 3):.3f} Å")
print(f" C-C-C angle: {mol.angle(0, 1, 2, degrees=True):.1f}°")
print(f" C-C-C-C dihedral: {mol.dihedral(0, 1, 2, 3, degrees=True):.1f}°")
```
---
## Electron Sanity Check
The `stjames.Molecule` class validates that charge and multiplicity are consistent with the number of electrons:
```python
import stjames
# This will fail validation
try:
# Oxygen with wrong multiplicity
mol = stjames.Molecule.from_smiles("[O][O]", charge=0, multiplicity=1)
except ValueError as e:
print(f"Validation error: {e}")
# Correct: triplet oxygen
mol = stjames.Molecule.from_smiles("[O][O]", charge=0, multiplicity=3)
```
The validation ensures:
- Number of electrons = sum(atomic_numbers) - charge
- Multiplicity is compatible with electron count (odd/even)

View File

@@ -0,0 +1,499 @@
# Rowan Proteins and Organization Reference
## Table of Contents
1. [Protein Management](#protein-management)
2. [Folder Organization](#folder-organization)
3. [Project Management](#project-management)
4. [Best Practices](#best-practices)
---
## Protein Management
### Protein Class
The `Protein` class represents a protein structure stored on Rowan.
**Attributes:**
| Attribute | Type | Description |
|-----------|------|-------------|
| `uuid` | str | Unique identifier |
| `name` | str | User-assigned name |
| `data` | str | PDB structure data (lazy-loaded) |
| `sanitized` | bool | Whether structure has been cleaned |
| `public` | bool | Public visibility flag |
| `created_at` | datetime | Upload timestamp |
---
### Upload Protein from File
```python
import rowan
# Upload PDB file
protein = rowan.upload_protein(
name="EGFR Kinase",
file_path="protein.pdb"
)
print(f"Protein UUID: {protein.uuid}")
print(f"Name: {protein.name}")
```
---
### Create from PDB ID
Fetch structure directly from RCSB PDB database.
```python
import rowan
# Download from PDB
protein = rowan.create_protein_from_pdb_id(
name="EGFR Kinase (1M17)",
code="1M17"
)
print(f"Created protein: {protein.uuid}")
```
---
### Retrieve Protein
```python
import rowan
# Get by UUID
protein = rowan.retrieve_protein("protein-uuid")
# List all proteins
proteins = rowan.list_proteins()
for p in proteins:
print(f"{p.name}: {p.uuid}")
# Filter by name
proteins = rowan.list_proteins(name="EGFR")
```
---
### Sanitize Protein
Clean up protein structure (remove waters, artifacts, fix residues).
```python
import rowan
protein = rowan.create_protein_from_pdb_id("Target", "1M17")
# Sanitize the structure
protein.sanitize()
# Check status
print(f"Sanitized: {protein.sanitized}")
```
**Sanitization performs:**
- Removes non-protein molecules (waters, ligands, ions)
- Fixes missing atoms in residues
- Resolves alternate conformations
- Standardizes residue names
---
### Update Protein Metadata
```python
import rowan
protein = rowan.retrieve_protein("protein-uuid")
# Update name
protein.update(name="EGFR Kinase Domain")
# Define binding pocket
protein.update(
pocket={
"center": [10.0, 20.0, 30.0],
"size": [20.0, 20.0, 20.0]
}
)
```
---
### Download Protein Structure
```python
import rowan
protein = rowan.retrieve_protein("protein-uuid")
# Load structure data
protein.refresh() # Fetches PDB data if not loaded
# Download to file
protein.download_pdb_file("output.pdb")
# Or access data directly
pdb_content = protein.data
```
---
### Delete Protein
```python
import rowan
protein = rowan.retrieve_protein("protein-uuid")
protein.delete()
```
---
## Folder Organization
### Folder Class
Folders provide hierarchical organization for workflows.
**Attributes:**
| Attribute | Type | Description |
|-----------|------|-------------|
| `uuid` | str | Unique identifier |
| `name` | str | Folder name |
| `parent_uuid` | str | Parent folder UUID (None for root) |
| `starred` | bool | Starred status |
| `public` | bool | Public visibility |
| `created_at` | datetime | Creation timestamp |
---
### Create Folder
```python
import rowan
# Create root folder
folder = rowan.create_folder(name="Drug Discovery Project")
# Create subfolder
subfolder = rowan.create_folder(
name="Lead Compounds",
parent_uuid=folder.uuid
)
```
---
### Retrieve Folder
```python
import rowan
# Get by UUID
folder = rowan.retrieve_folder("folder-uuid")
# List all folders
folders = rowan.list_folders()
for f in folders:
print(f"{f.name}: {f.uuid}")
# Filter
folders = rowan.list_folders(name="Project", starred=True)
```
---
### Update Folder
```python
import rowan
folder = rowan.retrieve_folder("folder-uuid")
# Rename
folder.update(name="New Name")
# Move to different parent
folder.update(parent_uuid="new-parent-uuid")
# Star folder
folder.update(starred=True)
```
---
### Print Folder Tree
Visualize folder hierarchy.
```python
import rowan
# Print structure starting from root
rowan.print_folder_tree()
# Print from specific folder
rowan.print_folder_tree(root_uuid="folder-uuid")
```
Output:
```
📁 Drug Discovery Project
├── 📁 Lead Compounds
│ ├── 📄 Lead 1 pKa (completed)
│ └── 📄 Lead 2 pKa (completed)
└── 📁 Backup Series
└── 📄 Backup 1 conformers (running)
```
---
### Delete Folder
**Warning:** Deleting a folder removes all workflows inside!
```python
import rowan
folder = rowan.retrieve_folder("folder-uuid")
folder.delete() # Deletes folder and all contents
```
---
### Submit Workflow to Folder
```python
import rowan
import stjames
folder = rowan.create_folder(name="pKa Calculations")
mol = stjames.Molecule.from_smiles("CCO")
workflow = rowan.submit_pka_workflow(
initial_molecule=mol,
name="Ethanol pKa",
folder_uuid=folder.uuid # Organize in folder
)
```
---
### List Workflows in Folder
```python
import rowan
folder = rowan.retrieve_folder("folder-uuid")
workflows = rowan.list_workflows(folder_uuid=folder.uuid)
for wf in workflows:
print(f"{wf.name}: {wf.status}")
```
---
## Project Management
### Project Class
Projects are top-level containers for organizing folders and workflows.
**Attributes:**
| Attribute | Type | Description |
|-----------|------|-------------|
| `uuid` | str | Unique identifier |
| `name` | str | Project name |
| `created_at` | datetime | Creation timestamp |
---
### Create Project
```python
import rowan
project = rowan.create_project(name="Cancer Drug Discovery")
print(f"Project UUID: {project.uuid}")
```
---
### Retrieve Project
```python
import rowan
# Get by UUID
project = rowan.retrieve_project("project-uuid")
# List all projects
projects = rowan.list_projects()
for p in projects:
print(f"{p.name}: {p.uuid}")
# Get default project
default = rowan.default_project()
```
---
### Update Project
```python
import rowan
project = rowan.retrieve_project("project-uuid")
project.update(name="Renamed Project")
```
---
### Delete Project
**Warning:** Deletes all folders and workflows in project!
```python
import rowan
project = rowan.retrieve_project("project-uuid")
project.delete()
```
---
### Create Folder in Project
```python
import rowan
project = rowan.create_project("Drug Discovery")
folder = rowan.create_folder(
name="Phase 1 Compounds",
project_uuid=project.uuid
)
```
---
## Best Practices
### Organizing a Drug Discovery Campaign
```python
import rowan
import stjames
# Create project structure
project = rowan.create_project("EGFR Inhibitor Campaign")
# Create organized folders
target_folder = rowan.create_folder("Target Preparation", project_uuid=project.uuid)
hit_folder = rowan.create_folder("Hit Finding", project_uuid=project.uuid)
lead_folder = rowan.create_folder("Lead Optimization", project_uuid=project.uuid)
# Upload and prepare protein
protein = rowan.create_protein_from_pdb_id("EGFR", "1M17")
protein.sanitize()
# Define binding site
pocket = {
"center": [10.0, 20.0, 30.0], # From crystal ligand
"size": [20.0, 20.0, 20.0]
}
# Submit docking workflows to hit folder
for smiles in hit_compounds:
mol = stjames.Molecule.from_smiles(smiles)
workflow = rowan.submit_docking_workflow(
protein=protein.uuid,
pocket=pocket,
initial_molecule=mol,
name=f"Dock: {smiles[:20]}",
folder_uuid=hit_folder.uuid
)
```
### Reusing Proteins Across Workflows
```python
import rowan
# Upload once
protein = rowan.upload_protein("My Target", "target.pdb")
protein.sanitize()
# Save UUID for later use
protein_uuid = protein.uuid
# Use in multiple workflows
for compound in compounds:
workflow = rowan.submit_docking_workflow(
protein=protein_uuid, # Reuse same protein
pocket=pocket,
initial_molecule=compound,
name=f"Dock: {compound.name}"
)
```
### Folder Naming Conventions
```python
import rowan
from datetime import datetime
# Include date in folder name
date_str = datetime.now().strftime("%Y%m%d")
folder = rowan.create_folder(f"{date_str}_Lead_Optimization")
# Include project phase
folder = rowan.create_folder("Phase2_pKa_Calculations")
# Include target name
folder = rowan.create_folder("EGFR_Conformer_Search")
```
### Cleaning Up Old Workflows
```python
import rowan
from datetime import datetime, timedelta
# Find old completed workflows
old_cutoff = datetime.now() - timedelta(days=30)
workflows = rowan.list_workflows(status="completed")
for wf in workflows:
if wf.completed_at < old_cutoff:
# Delete data but keep metadata
wf.delete_data()
# Or delete entirely
# wf.delete()
```
### Monitoring Credit Usage
```python
import rowan
# Check before submitting
user = rowan.whoami()
print(f"Available credits: {user.credits}")
# Set credit limit per workflow
workflow = rowan.submit_pka_workflow(
initial_molecule=mol,
name="pKa calculation",
max_credits=10.0 # Fail if exceeds 10 credits
)
```

438
references/rdkit_native.md Normal file
View File

@@ -0,0 +1,438 @@
# Rowan RDKit-Native API Reference
## Overview
The RDKit-native API provides a simplified interface for users working with RDKit molecules. Functions automatically handle:
1. Converting RDKit molecules to Rowan's internal format
2. Allocating cloud compute resources
3. Executing multi-step workflows
4. Monitoring job completion
5. Returning RDKit-compatible results
## Table of Contents
1. [pKa Functions](#pka-functions)
2. [Tautomer Functions](#tautomer-functions)
3. [Conformer Functions](#conformer-functions)
4. [Energy Functions](#energy-functions)
5. [Optimization Functions](#optimization-functions)
6. [Batch Processing Patterns](#batch-processing-patterns)
---
## pKa Functions
### `run_pka`
Calculate pKa for a single molecule.
```python
import rowan
from rdkit import Chem
mol = Chem.MolFromSmiles("c1ccccc1O") # Phenol
result = rowan.run_pka(mol)
print(f"Strongest acid pKa: {result.strongest_acid}")
print(f"Strongest base pKa: {result.strongest_base}")
print(f"Microscopic pKas: {result.microscopic_pkas}")
```
**Parameters:**
- `mol` (rdkit.Chem.Mol): RDKit molecule object
**Returns:** `PKAResult` object with attributes:
- `strongest_acid`: float - pKa of most acidic proton
- `strongest_base`: float - pKa of most basic site
- `microscopic_pkas`: list - Site-specific pKa values
- `tautomer_populations`: dict - Populations at pH 7
---
### `batch_pka`
Calculate pKa for multiple molecules in parallel.
```python
import rowan
from rdkit import Chem
smiles_list = ["CCO", "CC(=O)O", "c1ccccc1O", "c1ccccc1N"]
mols = [Chem.MolFromSmiles(smi) for smi in smiles_list]
results = rowan.batch_pka(mols)
for smi, result in zip(smiles_list, results):
if result is not None:
print(f"{smi}: pKa = {result.strongest_acid:.2f}")
else:
print(f"{smi}: Failed")
```
**Parameters:**
- `mols` (list[rdkit.Chem.Mol]): List of RDKit molecules
**Returns:** `list[PKAResult | None]` - Results for each molecule (None if failed)
---
## Tautomer Functions
### `run_tautomers`
Enumerate and rank tautomers.
```python
import rowan
from rdkit import Chem
mol = Chem.MolFromSmiles("Oc1ncnc2[nH]cnc12") # Hypoxanthine
result = rowan.run_tautomers(mol)
print(f"Number of tautomers: {len(result.tautomers)}")
for i, (taut, pop) in enumerate(zip(result.tautomers, result.populations)):
print(f"Tautomer {i}: {Chem.MolToSmiles(taut)}, Population: {pop:.1%}")
```
**Parameters:**
- `mol` (rdkit.Chem.Mol): RDKit molecule object
**Returns:** `TautomerResult` object with attributes:
- `tautomers`: list[rdkit.Chem.Mol] - Tautomer structures
- `energies`: list[float] - Relative energies (kcal/mol)
- `populations`: list[float] - Boltzmann populations at 298 K
---
### `batch_tautomers`
Enumerate tautomers for multiple molecules.
```python
import rowan
from rdkit import Chem
mols = [Chem.MolFromSmiles(smi) for smi in smiles_list]
results = rowan.batch_tautomers(mols)
for smi, result in zip(smiles_list, results):
if result:
print(f"{smi}: {len(result.tautomers)} tautomers")
```
**Parameters:**
- `mols` (list[rdkit.Chem.Mol]): List of RDKit molecules
**Returns:** `list[TautomerResult | None]`
---
## Conformer Functions
### `run_conformers`
Generate and optimize conformer ensemble.
```python
import rowan
from rdkit import Chem
mol = Chem.MolFromSmiles("CCCC") # Butane
result = rowan.run_conformers(mol)
print(f"Number of conformers: {len(result.conformers)}")
print(f"Energy range: {result.energy_range:.2f} kcal/mol")
# Get lowest energy conformer
best_conformer = result.lowest_energy_conformer
print(f"Lowest energy: {result.energies[0]:.4f} Hartree")
```
**Parameters:**
- `mol` (rdkit.Chem.Mol): RDKit molecule object
**Returns:** `ConformerResult` object with attributes:
- `conformers`: list[rdkit.Chem.Mol] - Conformer structures (with 3D coordinates)
- `energies`: list[float] - Energies in Hartree
- `lowest_energy_conformer`: rdkit.Chem.Mol - Global minimum
- `energy_range`: float - Energy span in kcal/mol
- `boltzmann_weights`: list[float] - Population weights
---
### `batch_conformers`
Generate conformers for multiple molecules.
```python
import rowan
from rdkit import Chem
mols = [Chem.MolFromSmiles(smi) for smi in smiles_list]
results = rowan.batch_conformers(mols)
for smi, result in zip(smiles_list, results):
if result:
print(f"{smi}: {len(result.conformers)} conformers, range = {result.energy_range:.2f} kcal/mol")
```
**Parameters:**
- `mols` (list[rdkit.Chem.Mol]): List of RDKit molecules
**Returns:** `list[ConformerResult | None]`
---
## Energy Functions
### `run_energy`
Calculate single-point energy.
```python
import rowan
from rdkit import Chem
from rdkit.Chem import AllChem
# Create molecule with 3D coordinates
mol = Chem.MolFromSmiles("CCO")
mol = Chem.AddHs(mol)
AllChem.EmbedMolecule(mol)
AllChem.MMFFOptimizeMolecule(mol)
result = rowan.run_energy(mol)
print(f"Energy: {result.energy:.6f} Hartree")
print(f"Dipole moment: {result.dipole_magnitude:.2f} Debye")
```
**Parameters:**
- `mol` (rdkit.Chem.Mol): RDKit molecule with 3D coordinates
**Returns:** `EnergyResult` object with attributes:
- `energy`: float - Total energy (Hartree)
- `dipole`: tuple[float, float, float] - Dipole vector
- `dipole_magnitude`: float - Dipole magnitude (Debye)
- `mulliken_charges`: list[float] - Atomic charges
---
### `batch_energy`
Calculate energies for multiple molecules.
```python
import rowan
from rdkit import Chem
# Molecules must have 3D coordinates
results = rowan.batch_energy(mols_3d)
for mol, result in zip(mols_3d, results):
if result:
print(f"{Chem.MolToSmiles(mol)}: E = {result.energy:.6f} Ha")
```
**Parameters:**
- `mols` (list[rdkit.Chem.Mol]): List of molecules with 3D coordinates
**Returns:** `list[EnergyResult | None]`
---
## Optimization Functions
### `run_optimization`
Optimize molecular geometry.
```python
import rowan
from rdkit import Chem
from rdkit.Chem import AllChem
# Start from initial guess
mol = Chem.MolFromSmiles("CC(=O)O")
mol = Chem.AddHs(mol)
AllChem.EmbedMolecule(mol)
result = rowan.run_optimization(mol)
print(f"Final energy: {result.energy:.6f} Hartree")
print(f"Converged: {result.converged}")
# Get optimized structure
optimized_mol = result.molecule
```
**Parameters:**
- `mol` (rdkit.Chem.Mol): RDKit molecule (3D coordinates optional)
**Returns:** `OptimizationResult` object with attributes:
- `molecule`: rdkit.Chem.Mol - Optimized structure
- `energy`: float - Final energy (Hartree)
- `converged`: bool - Optimization convergence
- `n_steps`: int - Number of optimization steps
---
### `batch_optimization`
Optimize multiple molecules.
```python
import rowan
from rdkit import Chem
results = rowan.batch_optimization(mols)
for mol, result in zip(mols, results):
if result and result.converged:
print(f"{Chem.MolToSmiles(mol)}: E = {result.energy:.6f} Ha")
```
**Parameters:**
- `mols` (list[rdkit.Chem.Mol]): List of RDKit molecules
**Returns:** `list[OptimizationResult | None]`
---
## Batch Processing Patterns
### Parallel Processing with Progress
```python
import rowan
from rdkit import Chem
from tqdm import tqdm
smiles_list = ["CCO", "CC(=O)O", "c1ccccc1O", "c1ccc(O)c(O)c1"]
mols = [Chem.MolFromSmiles(smi) for smi in smiles_list]
# Batch functions automatically distribute across multiple workers
print("Submitting batch pKa calculations...")
results = rowan.batch_pka(mols)
# Process results
for smi, result in zip(smiles_list, results):
if result:
print(f"{smi}: pKa = {result.strongest_acid:.2f}")
else:
print(f"{smi}: calculation failed")
```
### Error Handling
```python
import rowan
from rdkit import Chem
def safe_pka(smiles):
"""Safely calculate pKa with error handling."""
try:
mol = Chem.MolFromSmiles(smiles)
if mol is None:
return None, "Invalid SMILES"
result = rowan.run_pka(mol)
return result, None
except rowan.RowanAPIError as e:
return None, f"API error: {e}"
except Exception as e:
return None, f"Error: {e}"
# Usage
result, error = safe_pka("c1ccccc1O")
if error:
print(f"Failed: {error}")
else:
print(f"pKa: {result.strongest_acid}")
```
### Combining with RDKit Workflows
```python
import rowan
from rdkit import Chem
from rdkit.Chem import Descriptors, AllChem
# Load molecules
mols = [Chem.MolFromSmiles(smi) for smi in smiles_list]
# Filter by RDKit descriptors first
filtered_mols = [
mol for mol in mols
if mol and Descriptors.MolWt(mol) < 500
]
# Calculate pKa only for filtered set
pka_results = rowan.batch_pka(filtered_mols)
# Combine results
for mol, pka in zip(filtered_mols, pka_results):
if pka:
mw = Descriptors.MolWt(mol)
print(f"{Chem.MolToSmiles(mol)}: MW={mw:.1f}, pKa={pka.strongest_acid:.2f}")
```
### Virtual Screening Pipeline
```python
import rowan
from rdkit import Chem
from rdkit.Chem import Descriptors
import pandas as pd
def screen_compounds(smiles_list):
"""Screen compounds for drug-likeness and calculate pKa."""
results = []
mols = [Chem.MolFromSmiles(smi) for smi in smiles_list]
valid_mols = [(smi, mol) for smi, mol in zip(smiles_list, mols) if mol]
# Batch pKa calculation
pka_results = rowan.batch_pka([mol for _, mol in valid_mols])
for (smi, mol), pka in zip(valid_mols, pka_results):
result = {
'smiles': smi,
'mw': Descriptors.MolWt(mol),
'logp': Descriptors.MolLogP(mol),
'hbd': Descriptors.NumHDonors(mol),
'hba': Descriptors.NumHAcceptors(mol),
'pka': pka.strongest_acid if pka else None
}
results.append(result)
return pd.DataFrame(results)
# Usage
df = screen_compounds(compound_library)
print(df[df['pka'].notna()].sort_values('pka'))
```
---
## Performance Considerations
1. **Batch functions are more efficient** - Submit multiple molecules at once rather than one by one
2. **Fractional credits** - Low-cost calculations may use < 1 credit (e.g., 0.17 credits for fast pKa)
3. **Automatic parallelization** - Batch functions distribute work across Rowan's compute cluster
4. **Results caching** - Previously calculated molecules may return faster
---
## Comparison with Full API
| Feature | RDKit-Native | Full API |
|---------|--------------|----------|
| Input format | RDKit Mol | stjames.Molecule |
| Output format | RDKit Mol + results | Workflow object |
| Workflow control | Automatic | Manual wait/fetch |
| Folder organization | No | Yes |
| Advanced parameters | Default only | Full control |
Use RDKit-native API for quick calculations; use full API for complex workflows or when you need fine-grained control.

View File

@@ -0,0 +1,481 @@
# Rowan Results Interpretation Reference
## Table of Contents
1. [Accessing Workflow Results](#accessing-workflow-results)
2. [Property Prediction Results](#property-prediction-results)
3. [Molecular Modeling Results](#molecular-modeling-results)
4. [Docking Results](#docking-results)
5. [Cofolding Results](#cofolding-results)
6. [Validation and Quality Assessment](#validation-and-quality-assessment)
---
## Accessing Workflow Results
### Basic Pattern
```python
import rowan
workflow = rowan.submit_pka_workflow(mol, name="test")
# Wait for completion
workflow.wait_for_result()
# Fetch results (not loaded by default)
workflow.fetch_latest(in_place=True)
# Check status before accessing data
if workflow.status == "completed":
print(workflow.data)
elif workflow.status == "failed":
print(f"Failed: {workflow.error_message}")
```
### Workflow Status Values
| Status | Description |
|--------|-------------|
| `pending` | Queued, waiting for resources |
| `running` | Currently executing |
| `completed` | Successfully finished |
| `failed` | Execution failed |
| `stopped` | Manually stopped |
### Credits Charged
```python
# After completion
print(f"Credits used: {workflow.credits_charged}")
```
---
## Property Prediction Results
### pKa Results
```python
workflow = rowan.submit_pka_workflow(mol, name="pKa")
workflow.wait_for_result()
workflow.fetch_latest(in_place=True)
data = workflow.data
# Macroscopic pKa
strongest_acid = data['strongest_acid'] # Most acidic pKa
strongest_base = data['strongest_base'] # Most basic pKa (if applicable)
# Microscopic pKa (site-specific)
micro_pkas = data['microscopic_pkas']
for site in micro_pkas:
print(f"Site {site['atom_index']}: pKa = {site['pka']:.2f}")
# Tautomer analysis
tautomers = data.get('tautomer_populations', {})
for smiles, pop in tautomers.items():
print(f"{smiles}: {pop:.1%}")
```
**Interpretation:**
- pKa < 0: Strong acid
- pKa 0-7: Acidic
- pKa 7-14: Basic
- pKa > 14: Very weak acid
---
### Redox Potential Results
```python
data = workflow.data
oxidation_potential = data['oxidation_potential'] # V vs SHE
reduction_potential = data['reduction_potential'] # V vs SHE
print(f"Oxidation: {oxidation_potential:.2f} V vs SHE")
print(f"Reduction: {reduction_potential:.2f} V vs SHE")
```
**Interpretation:**
- Higher oxidation potential = harder to oxidize
- Lower reduction potential = harder to reduce
- Compare to reference compounds for context
---
### Solubility Results
```python
data = workflow.data
log_s = data['aqueous_solubility'] # Log10(mol/L)
classification = data['solubility_class']
print(f"Log S: {log_s:.2f}")
print(f"Classification: {classification}") # "High", "Medium", "Low"
```
**Interpretation:**
- Log S > -1: High solubility (>0.1 M)
- Log S -1 to -3: Medium solubility
- Log S < -3: Low solubility (<0.001 M)
---
### Fukui Index Results
```python
data = workflow.data
# Per-atom reactivity indices
fukui_plus = data['fukui_plus'] # Nucleophilic attack sites
fukui_minus = data['fukui_minus'] # Electrophilic attack sites
fukui_dual = data['fukui_dual'] # Dual descriptor
# Find most reactive sites
for i, (fp, fm, fd) in enumerate(zip(fukui_plus, fukui_minus, fukui_dual)):
print(f"Atom {i}: f+ = {fp:.3f}, f- = {fm:.3f}, dual = {fd:.3f}")
```
**Interpretation:**
- High f+ = susceptible to nucleophilic attack
- High f- = susceptible to electrophilic attack
- Dual > 0 = electrophilic character, Dual < 0 = nucleophilic character
---
## Molecular Modeling Results
### Geometry Optimization Results
```python
data = workflow.data
final_mol = data['final_molecule'] # stjames.Molecule
final_energy = data['energy'] # Hartree
converged = data['convergence']
print(f"Final energy: {final_energy:.6f} Hartree")
print(f"Converged: {converged}")
```
---
### Conformer Search Results
```python
data = workflow.data
conformers = data['conformers']
lowest_energy = data['lowest_energy_conformer']
# Analyze conformer distribution
for i, conf in enumerate(conformers):
rel_energy = (conf['energy'] - conformers[0]['energy']) * 627.509 # kcal/mol
print(f"Conformer {i}: ΔE = {rel_energy:.2f} kcal/mol")
# Boltzmann weights
weights = data.get('boltzmann_weights', [])
for i, w in enumerate(weights):
print(f"Conformer {i}: population = {w:.1%}")
```
**Interpretation:**
- Conformers within 3 kcal/mol are typically accessible at room temperature
- Lowest energy conformer may not be most populated in solution
- Consider ensemble averaging for properties
---
### Frequency Calculation Results
```python
data = workflow.data
frequencies = data['frequencies'] # cm⁻¹
ir_intensities = data['ir_intensities'] # km/mol
zpe = data['zpe'] # Hartree
gibbs = data['gibbs_free_energy'] # Hartree
# Check for imaginary frequencies
imaginary = [f for f in frequencies if f < 0]
if imaginary:
print(f"Warning: {len(imaginary)} imaginary frequencies")
print("Structure may be a transition state or saddle point")
else:
print("Structure is a true minimum")
# Thermochemistry at 298 K
print(f"ZPE: {zpe * 627.509:.2f} kcal/mol")
print(f"Gibbs free energy: {gibbs:.6f} Hartree")
```
**Interpretation:**
- 0 imaginary frequencies = minimum
- 1 imaginary frequency = transition state
- >1 imaginary frequencies = higher-order saddle point
---
### Dihedral Scan Results
```python
data = workflow.data
angles = data['angles'] # degrees
energies = data['energies'] # Hartree
# Find barrier
min_e = min(energies)
max_e = max(energies)
barrier = (max_e - min_e) * 627.509 # kcal/mol
print(f"Rotation barrier: {barrier:.2f} kcal/mol")
# Find minima
import numpy as np
rel_energies = [(e - min_e) * 627.509 for e in energies]
for angle, e in zip(angles, rel_energies):
if e < 0.5: # Near minimum
print(f"Minimum at {angle}°")
```
---
## Docking Results
### Single Docking Results
```python
data = workflow.data
# Docking score (more negative = better)
score = data['docking_score'] # kcal/mol
print(f"Docking score: {score:.2f} kcal/mol")
# All poses
poses = data['poses']
for i, pose in enumerate(poses):
print(f"Pose {i}: score = {pose['score']:.2f} kcal/mol")
# Ligand strain
strain = data.get('ligand_strain', 0)
print(f"Ligand strain: {strain:.2f} kcal/mol")
# Download poses
workflow.download_sdf_file("docked_poses.sdf")
```
**Interpretation:**
- Vina scores typically -12 to -6 kcal/mol for drug-like molecules
- More negative = stronger predicted binding
- Ligand strain > 3 kcal/mol suggests unlikely binding mode
---
### Batch Docking Results
```python
data = workflow.data
results = data['results']
for r in results:
smiles = r['smiles']
score = r['best_score']
strain = r.get('ligand_strain', 0)
print(f"{smiles[:30]}: score = {score:.2f}, strain = {strain:.2f}")
# Sort by score
sorted_results = sorted(results, key=lambda x: x['best_score'])
print("\nTop 10 hits:")
for r in sorted_results[:10]:
print(f"{r['smiles']}: {r['best_score']:.2f}")
```
**Scoring Function Differences:**
- **Vina**: Original scoring function
- **Vinardo**: Updated parameters, often more accurate
---
## Cofolding Results
### Protein-Ligand Complex Prediction
```python
data = workflow.data
# Confidence scores
ptm = data['ptm_score'] # Predicted TM score (0-1)
interface_ptm = data['interface_ptm'] # Interface confidence
aggregate = data['aggregate_score'] # Combined score
print(f"Predicted TM score: {ptm:.3f}")
print(f"Interface pTM: {interface_ptm:.3f}")
print(f"Aggregate score: {aggregate:.3f}")
# Download structure
pdb_content = data['structure_pdb']
with open("complex.pdb", "w") as f:
f.write(pdb_content)
```
**Confidence Score Interpretation:**
| Score Range | Confidence | Recommendation |
|-------------|------------|----------------|
| > 0.8 | High | Likely accurate |
| 0.5 - 0.8 | Moderate | Use with caution |
| < 0.5 | Low | Validate experimentally |
---
### Interpreting Low Confidence
Low confidence may indicate:
- Novel protein fold not well-represented in training data
- Flexible or disordered regions
- Unusual ligand (large, charged, or complex)
- Multiple possible binding modes
**Recommendations for low confidence:**
1. Try multiple models (Chai-1, Boltz-1, Boltz-2)
2. Compare predictions across models
3. Use docking for binding pose refinement
4. Validate with experimental data if available
---
## Validation and Quality Assessment
### Cross-Validation with Multiple Methods
```python
import rowan
import stjames
mol = stjames.Molecule.from_smiles("c1ccccc1O")
# Run with different methods
results = {}
for method in ['gfn2_xtb', 'aimnet2']:
wf = rowan.submit_basic_calculation_workflow(
initial_molecule=mol,
workflow_type="optimization",
workflow_data={"method": method},
name=f"opt_{method}"
)
wf.wait_for_result()
wf.fetch_latest(in_place=True)
results[method] = wf.data['energy']
# Compare energies
for method, energy in results.items():
print(f"{method}: {energy:.6f} Hartree")
```
### Consistency Checks
```python
# For pKa
def validate_pka(data):
pka = data['strongest_acid']
# Check reasonable range
if pka < -5 or pka > 20:
print("Warning: pKa outside typical range")
# Compare with known references
# (implementation depends on reference data)
# For docking
def validate_docking(data):
score = data['docking_score']
strain = data.get('ligand_strain', 0)
if score > 0:
print("Warning: Positive docking score suggests poor binding")
if strain > 5:
print("Warning: High ligand strain - binding mode may be unrealistic")
```
### Experimental Validation Guidelines
| Property | Validation Method |
|----------|-------------------|
| pKa | Potentiometric titration, UV spectroscopy |
| Solubility | Shake-flask, nephelometry |
| Docking pose | X-ray crystallography, cryo-EM |
| Binding affinity | SPR, ITC, fluorescence polarization |
| Cofolding | X-ray, NMR, HDX-MS |
---
## Common Issues and Solutions
### Issue: Workflow Failed
```python
if workflow.status == "failed":
print(f"Error: {workflow.error_message}")
# Common causes:
# - Invalid SMILES
# - Molecule too large
# - Convergence failure
# - Credit limit exceeded
```
### Issue: Unexpected Results
1. **pKa off by >2 units**: Check tautomers, ensure correct protonation state
2. **Docking gives positive scores**: Ligand may not fit binding site
3. **Optimization not converged**: Try different starting geometry
4. **High strain energy**: Conformer may be wrong
### Issue: Missing Data Fields
```python
# Use .get() with defaults
energy = data.get('energy', None)
if energy is None:
print("Energy not available")
```
---
## Data Export Patterns
### Export to CSV
```python
import pandas as pd
# Collect results from multiple workflows
results = []
for wf in workflows:
wf.fetch_latest(in_place=True)
if wf.status == "completed":
results.append({
'name': wf.name,
'pka': wf.data.get('strongest_acid'),
'credits': wf.credits_charged
})
df = pd.DataFrame(results)
df.to_csv("results.csv", index=False)
```
### Export Structures
```python
# Download SDF with all poses
workflow.download_sdf_file("poses.sdf")
# Download trajectory (for MD)
workflow.download_dcd_files(output_dir="trajectories/")
```

View File

@@ -0,0 +1,591 @@
# Rowan Workflow Types Reference
## Table of Contents
1. [Property Prediction Workflows](#property-prediction-workflows)
2. [Molecular Modeling Workflows](#molecular-modeling-workflows)
3. [Protein-Ligand Workflows](#protein-ligand-workflows)
4. [Spectroscopy Workflows](#spectroscopy-workflows)
5. [Advanced Workflows](#advanced-workflows)
---
## Property Prediction Workflows
### pKa Calculation
Predict acid dissociation constants.
```python
workflow = rowan.submit_pka_workflow(
initial_molecule=mol,
name="pKa calculation"
)
```
**Output:**
- `strongest_acid`: pKa of most acidic proton
- `strongest_base`: pKa of most basic site
- `microscopic_pkas`: List of site-specific pKa values
- `tautomer_populations`: Relative populations at pH 7
---
### Redox Potential
Calculate oxidation/reduction potentials.
```python
workflow = rowan.submit_redox_potential_workflow(
initial_molecule=mol,
name="redox potential"
)
```
**Output:**
- `oxidation_potential`: E° for oxidation (V vs SHE)
- `reduction_potential`: E° for reduction (V vs SHE)
---
### Solubility Prediction
Predict aqueous and nonaqueous solubility.
```python
workflow = rowan.submit_solubility_workflow(
initial_molecule=mol,
name="solubility"
)
```
**Output:**
- `aqueous_solubility`: Log S in water
- `solubility_class`: "High", "Medium", or "Low"
---
### Hydrogen-Bond Basicity
Calculate H-bond acceptor strength.
```python
workflow = rowan.submit_workflow(
initial_molecule=mol,
workflow_type="hydrogen_bond_basicity",
workflow_data={},
name="H-bond basicity"
)
```
**Output:**
- `hb_basicity`: pKBHX value
---
### Bond Dissociation Energy (BDE)
Calculate homolytic bond dissociation energies.
```python
workflow = rowan.submit_bde_workflow(
initial_molecule=mol,
bond_indices=(0, 1), # Atom indices of bond
name="BDE calculation"
)
```
**Output:**
- `bde`: Bond dissociation energy (kcal/mol)
- `radical_stability`: Stability of resulting radicals
---
### Fukui Indices
Calculate reactivity indices for nucleophilic/electrophilic attack.
```python
workflow = rowan.submit_fukui_workflow(
initial_molecule=mol,
name="Fukui indices"
)
```
**Output:**
- `fukui_plus`: Electrophilic attack susceptibility per atom
- `fukui_minus`: Nucleophilic attack susceptibility per atom
- `fukui_dual`: Dual descriptor per atom
---
### Spin States
Calculate relative energies of different spin multiplicities.
```python
workflow = rowan.submit_workflow(
initial_molecule=mol,
workflow_type="spin_states",
workflow_data={},
name="spin states"
)
```
**Output:**
- `spin_state_energies`: Energy of each multiplicity
- `ground_state`: Lowest energy multiplicity
---
### ADME-Tox Predictions
Predict absorption, distribution, metabolism, excretion, and toxicity.
```python
workflow = rowan.submit_workflow(
initial_molecule=mol,
workflow_type="admet",
workflow_data={},
name="ADMET"
)
```
**Output:**
- Various ADMET descriptors including:
- `logP`, `logD`
- `herg_inhibition`
- `cyp_inhibition`
- `bioavailability`
- `bbb_permeability`
---
## Molecular Modeling Workflows
### Single-Point Energy
Calculate energy at fixed geometry.
```python
workflow = rowan.submit_basic_calculation_workflow(
initial_molecule=mol,
workflow_type="single_point",
name="single point"
)
```
**Output:**
- `energy`: Total energy (Hartree)
- `dipole`: Dipole moment vector
- `mulliken_charges`: Atomic partial charges
---
### Geometry Optimization
Optimize molecular geometry to minimum energy.
```python
workflow = rowan.submit_basic_calculation_workflow(
initial_molecule=mol,
workflow_type="optimization",
name="optimization"
)
```
**Output:**
- `final_molecule`: Optimized structure
- `energy`: Final energy (Hartree)
- `convergence`: Optimization details
---
### Vibrational Frequencies
Calculate IR/Raman frequencies and thermochemistry.
```python
workflow = rowan.submit_basic_calculation_workflow(
initial_molecule=mol,
workflow_type="frequency",
name="frequency"
)
```
**Output:**
- `frequencies`: Vibrational frequencies (cm⁻¹)
- `ir_intensities`: IR intensities
- `zpe`: Zero-point energy
- `thermal_corrections`: Enthalpy, entropy, Gibbs free energy
- `imaginary_frequencies`: Count of negative frequencies
---
### Conformer Search
Generate and optimize conformer ensemble.
```python
workflow = rowan.submit_conformer_search_workflow(
initial_molecule=mol,
name="conformer search"
)
```
**Output:**
- `conformers`: List of conformer structures with energies
- `lowest_energy_conformer`: Global minimum structure
- `boltzmann_weights`: Population weights at 298 K
---
### Tautomer Search
Enumerate and rank tautomers.
```python
workflow = rowan.submit_tautomer_search_workflow(
initial_molecule=mol,
name="tautomer search"
)
```
**Output:**
- `tautomers`: List of tautomer structures
- `energies`: Relative energies
- `populations`: Boltzmann populations
---
### Dihedral Scan
Scan torsion angle energy surface.
```python
workflow = rowan.submit_dihedral_scan_workflow(
initial_molecule=mol,
dihedral_indices=(0, 1, 2, 3), # Atom indices
name="dihedral scan"
)
```
**Output:**
- `angles`: Dihedral angles scanned (degrees)
- `energies`: Energy at each angle
- `barrier_height`: Rotation barrier (kcal/mol)
---
### Multistage Optimization
Progressive refinement with multiple methods.
```python
workflow = rowan.submit_workflow(
initial_molecule=mol,
workflow_type="multistage_optimization",
workflow_data={
"stages": ["gfn2_xtb", "aimnet2", "dft"]
},
name="multistage opt"
)
```
**Output:**
- `final_molecule`: Optimized structure
- `stage_energies`: Energy after each stage
---
### Transition State Search
Find transition state geometry.
```python
workflow = rowan.submit_ts_search_workflow(
initial_molecule=mol, # Starting guess near TS
name="TS search"
)
```
**Output:**
- `ts_structure`: Transition state geometry
- `imaginary_frequency`: Single imaginary frequency
- `barrier_height`: Activation energy
---
### Strain Calculation
Calculate ligand strain energy.
```python
workflow = rowan.submit_workflow(
initial_molecule=mol,
workflow_type="strain",
workflow_data={},
name="strain"
)
```
**Output:**
- `strain_energy`: Conformational strain (kcal/mol)
- `reference_energy`: Lowest energy conformer energy
---
### Orbital Calculation
Calculate molecular orbitals.
```python
workflow = rowan.submit_workflow(
initial_molecule=mol,
workflow_type="orbitals",
workflow_data={},
name="orbitals"
)
```
**Output:**
- `homo_energy`: HOMO energy (eV)
- `lumo_energy`: LUMO energy (eV)
- `homo_lumo_gap`: Band gap (eV)
- `orbital_coefficients`: MO coefficients
---
## Protein-Ligand Workflows
### Docking
Dock ligand to protein binding site.
```python
workflow = rowan.submit_docking_workflow(
protein=protein_uuid,
pocket={
"center": [10.0, 20.0, 30.0],
"size": [20.0, 20.0, 20.0]
},
initial_molecule=mol,
executable="vina", # "vina" or "qvina2"
scoring_function="vinardo", # "vina" or "vinardo"
exhaustiveness=8,
do_csearch=True, # Conformer search before docking
do_optimization=True, # Optimize conformers
do_pose_refinement=True, # Refine poses with QM
name="docking"
)
```
**Output:**
- `docking_score`: Best Vina score (kcal/mol)
- `poses`: List of docked poses with scores
- `ligand_strain`: Strain energy of bound conformer
- `pose_sdf`: SDF file of poses
---
### Batch Docking
Screen multiple ligands against one target.
```python
workflow = rowan.submit_batch_docking_workflow(
protein=protein_uuid,
pocket=pocket_dict,
smiles_list=["CCO", "c1ccccc1", "CC(=O)O"],
executable="qvina2",
scoring_function="vina",
name="batch docking"
)
```
**Output:**
- `results`: List of docking results per ligand
- `rankings`: Sorted by score
---
### Protein Cofolding
Predict protein-ligand complex structure using AI.
```python
workflow = rowan.submit_protein_cofolding_workflow(
initial_protein_sequences=["MSKGEELFT..."],
initial_smiles_list=["CCO"],
model="boltz_2", # "boltz_1x", "boltz_2", "chai_1r"
use_msa_server=False, # Use MSA for better accuracy
use_potentials=True, # Apply physical constraints
compute_strain=False, # Calculate ligand strain
do_pose_refinement=False,
name="cofolding"
)
```
**Models:**
- `chai_1r`: Chai-1 model (~2 min)
- `boltz_1x`: Boltz-1 model (~2 min)
- `boltz_2`: Boltz-2 model (latest, recommended)
**Output:**
- `structure_pdb`: Predicted complex structure
- `ptm_score`: Predicted TM score (0-1, higher = more confident)
- `interface_ptm`: Interface prediction confidence
- `aggregate_score`: Combined confidence metric
- `ligand_rmsd`: If reference available
---
### Pose-Analysis MD
Molecular dynamics simulation of docked pose.
```python
workflow = rowan.submit_workflow(
initial_molecule=mol,
workflow_type="pose_analysis_md",
workflow_data={
"protein_uuid": protein_uuid,
"pose_sdf": pose_sdf_content
},
name="pose MD"
)
```
**Output:**
- `trajectory`: MD trajectory file
- `rmsd_over_time`: Ligand RMSD
- `interactions`: Protein-ligand interactions
---
## Spectroscopy Workflows
### NMR Prediction
Predict NMR chemical shifts.
```python
workflow = rowan.submit_nmr_workflow(
initial_molecule=mol,
name="NMR"
)
```
**Output:**
- `h_shifts`: ¹H chemical shifts (ppm)
- `c_shifts`: ¹³C chemical shifts (ppm)
- `coupling_constants`: J-coupling values
---
### Ion Mobility
Predict collision cross-section for mass spectrometry.
```python
workflow = rowan.submit_ion_mobility_workflow(
initial_molecule=mol,
name="ion mobility"
)
```
**Output:**
- `ccs`: Collision cross-section (Ų)
- `conformer_ccs`: CCS per conformer
---
## Advanced Workflows
### Molecular Descriptors
Calculate comprehensive descriptor set.
```python
workflow = rowan.submit_descriptors_workflow(
initial_molecule=mol,
name="descriptors"
)
```
**Output:**
- 2D descriptors (RDKit-based)
- 3D descriptors (xTB-based)
- Electronic descriptors
---
### MSA (Multiple Sequence Alignment)
Generate MSA for protein sequences.
```python
workflow = rowan.submit_msa_workflow(
sequences=["MSKGEELFT..."],
name="MSA"
)
```
**Output:**
- `msa`: Multiple sequence alignment
- `coverage`: Sequence coverage
---
### Protein Binder Design (BoltzGen)
Design protein binders.
```python
workflow = rowan.submit_workflow(
workflow_type="protein_binder_design",
workflow_data={
"target_sequence": "MSKGEELFT...",
"target_hotspots": [10, 15, 20]
},
name="binder design"
)
```
**Output:**
- `designed_sequences`: Binder sequences
- `confidence_scores`: Per-design confidence
---
## Workflow Parameters Reference
### Common Parameters
All workflow submission functions accept:
| Parameter | Type | Description |
|-----------|------|-------------|
| `name` | str | Workflow name (optional) |
| `folder_uuid` | str | Organize in folder |
| `max_credits` | float | Credit limit |
### Method Selection
For basic calculations, specify method:
```python
workflow = rowan.submit_basic_calculation_workflow(
initial_molecule=mol,
workflow_type="optimization",
workflow_data={
"method": "gfn2_xtb", # or "aimnet2", "dft"
"basis_set": "def2-SVP" # for DFT
}
)
```
**Available Methods:**
- Neural network: `aimnet2`, `egret`
- Semiempirical: `gfn1_xtb`, `gfn2_xtb`
- DFT: `b3lyp`, `pbe`, `wb97x`