mirror of
https://github.com/K-Dense-AI/claude-scientific-skills.git
synced 2026-03-27 07:09:27 +08:00
455 lines
12 KiB
Markdown
455 lines
12 KiB
Markdown
---
|
|
name: pytdc
|
|
description: "Therapeutics Data Commons. AI-ready drug discovery datasets (ADME, toxicity, DTI), benchmarks, scaffold splits, molecular oracles, for therapeutic ML and pharmacological prediction."
|
|
---
|
|
|
|
# PyTDC (Therapeutics Data Commons)
|
|
|
|
## Overview
|
|
|
|
PyTDC is an open-science platform providing AI-ready datasets and benchmarks for drug discovery and development. Access curated datasets spanning the entire therapeutics pipeline with standardized evaluation metrics and meaningful data splits, organized into three categories: single-instance prediction (molecular/protein properties), multi-instance prediction (drug-target interactions, DDI), and generation (molecule generation, retrosynthesis).
|
|
|
|
## When to Use This Skill
|
|
|
|
This skill should be used when:
|
|
- Working with drug discovery or therapeutic ML datasets
|
|
- Benchmarking machine learning models on standardized pharmaceutical tasks
|
|
- Predicting molecular properties (ADME, toxicity, bioactivity)
|
|
- Predicting drug-target or drug-drug interactions
|
|
- Generating novel molecules with desired properties
|
|
- Accessing curated datasets with proper train/test splits (scaffold, cold-split)
|
|
- Using molecular oracles for property optimization
|
|
|
|
## Installation & Setup
|
|
|
|
Install PyTDC using pip:
|
|
|
|
```bash
|
|
uv pip install PyTDC
|
|
```
|
|
|
|
To upgrade to the latest version:
|
|
|
|
```bash
|
|
uv pip install PyTDC --upgrade
|
|
```
|
|
|
|
Core dependencies (automatically installed):
|
|
- numpy, pandas, tqdm, seaborn, scikit_learn, fuzzywuzzy
|
|
|
|
Additional packages are installed automatically as needed for specific features.
|
|
|
|
## Quick Start
|
|
|
|
The basic pattern for accessing any TDC dataset follows this structure:
|
|
|
|
```python
|
|
from tdc.<problem> import <Task>
|
|
data = <Task>(name='<Dataset>')
|
|
split = data.get_split(method='scaffold', seed=1, frac=[0.7, 0.1, 0.2])
|
|
df = data.get_data(format='df')
|
|
```
|
|
|
|
Where:
|
|
- `<problem>`: One of `single_pred`, `multi_pred`, or `generation`
|
|
- `<Task>`: Specific task category (e.g., ADME, DTI, MolGen)
|
|
- `<Dataset>`: Dataset name within that task
|
|
|
|
**Example - Loading ADME data:**
|
|
|
|
```python
|
|
from tdc.single_pred import ADME
|
|
data = ADME(name='Caco2_Wang')
|
|
split = data.get_split(method='scaffold')
|
|
# Returns dict with 'train', 'valid', 'test' DataFrames
|
|
```
|
|
|
|
## Single-Instance Prediction Tasks
|
|
|
|
Single-instance prediction involves forecasting properties of individual biomedical entities (molecules, proteins, etc.).
|
|
|
|
### Available Task Categories
|
|
|
|
#### 1. ADME (Absorption, Distribution, Metabolism, Excretion)
|
|
|
|
Predict pharmacokinetic properties of drug molecules.
|
|
|
|
```python
|
|
from tdc.single_pred import ADME
|
|
data = ADME(name='Caco2_Wang') # Intestinal permeability
|
|
# Other datasets: HIA_Hou, Bioavailability_Ma, Lipophilicity_AstraZeneca, etc.
|
|
```
|
|
|
|
**Common ADME datasets:**
|
|
- Caco2 - Intestinal permeability
|
|
- HIA - Human intestinal absorption
|
|
- Bioavailability - Oral bioavailability
|
|
- Lipophilicity - Octanol-water partition coefficient
|
|
- Solubility - Aqueous solubility
|
|
- BBB - Blood-brain barrier penetration
|
|
- CYP - Cytochrome P450 metabolism
|
|
|
|
#### 2. Toxicity (Tox)
|
|
|
|
Predict toxicity and adverse effects of compounds.
|
|
|
|
```python
|
|
from tdc.single_pred import Tox
|
|
data = Tox(name='hERG') # Cardiotoxicity
|
|
# Other datasets: AMES, DILI, Carcinogens_Lagunin, etc.
|
|
```
|
|
|
|
**Common toxicity datasets:**
|
|
- hERG - Cardiac toxicity
|
|
- AMES - Mutagenicity
|
|
- DILI - Drug-induced liver injury
|
|
- Carcinogens - Carcinogenicity
|
|
- ClinTox - Clinical trial toxicity
|
|
|
|
#### 3. HTS (High-Throughput Screening)
|
|
|
|
Bioactivity predictions from screening data.
|
|
|
|
```python
|
|
from tdc.single_pred import HTS
|
|
data = HTS(name='SARSCoV2_Vitro_Touret')
|
|
```
|
|
|
|
#### 4. QM (Quantum Mechanics)
|
|
|
|
Quantum mechanical properties of molecules.
|
|
|
|
```python
|
|
from tdc.single_pred import QM
|
|
data = QM(name='QM7')
|
|
```
|
|
|
|
#### 5. Other Single Prediction Tasks
|
|
|
|
- **Yields**: Chemical reaction yield prediction
|
|
- **Epitope**: Epitope prediction for biologics
|
|
- **Develop**: Development-stage predictions
|
|
- **CRISPROutcome**: Gene editing outcome prediction
|
|
|
|
### Data Format
|
|
|
|
Single prediction datasets typically return DataFrames with columns:
|
|
- `Drug_ID` or `Compound_ID`: Unique identifier
|
|
- `Drug` or `X`: SMILES string or molecular representation
|
|
- `Y`: Target label (continuous or binary)
|
|
|
|
## Multi-Instance Prediction Tasks
|
|
|
|
Multi-instance prediction involves forecasting properties of interactions between multiple biomedical entities.
|
|
|
|
### Available Task Categories
|
|
|
|
#### 1. DTI (Drug-Target Interaction)
|
|
|
|
Predict binding affinity between drugs and protein targets.
|
|
|
|
```python
|
|
from tdc.multi_pred import DTI
|
|
data = DTI(name='BindingDB_Kd')
|
|
split = data.get_split()
|
|
```
|
|
|
|
**Available datasets:**
|
|
- BindingDB_Kd - Dissociation constant (52,284 pairs)
|
|
- BindingDB_IC50 - Half-maximal inhibitory concentration (991,486 pairs)
|
|
- BindingDB_Ki - Inhibition constant (375,032 pairs)
|
|
- DAVIS, KIBA - Kinase binding datasets
|
|
|
|
**Data format:** Drug_ID, Target_ID, Drug (SMILES), Target (sequence), Y (binding affinity)
|
|
|
|
#### 2. DDI (Drug-Drug Interaction)
|
|
|
|
Predict interactions between drug pairs.
|
|
|
|
```python
|
|
from tdc.multi_pred import DDI
|
|
data = DDI(name='DrugBank')
|
|
split = data.get_split()
|
|
```
|
|
|
|
Multi-class classification task predicting interaction types. Dataset contains 191,808 DDI pairs with 1,706 drugs.
|
|
|
|
#### 3. PPI (Protein-Protein Interaction)
|
|
|
|
Predict protein-protein interactions.
|
|
|
|
```python
|
|
from tdc.multi_pred import PPI
|
|
data = PPI(name='HuRI')
|
|
```
|
|
|
|
#### 4. Other Multi-Prediction Tasks
|
|
|
|
- **GDA**: Gene-disease associations
|
|
- **DrugRes**: Drug resistance prediction
|
|
- **DrugSyn**: Drug synergy prediction
|
|
- **PeptideMHC**: Peptide-MHC binding
|
|
- **AntibodyAff**: Antibody affinity prediction
|
|
- **MTI**: miRNA-target interactions
|
|
- **Catalyst**: Catalyst prediction
|
|
- **TrialOutcome**: Clinical trial outcome prediction
|
|
|
|
## Generation Tasks
|
|
|
|
Generation tasks involve creating novel biomedical entities with desired properties.
|
|
|
|
### 1. Molecular Generation (MolGen)
|
|
|
|
Generate diverse, novel molecules with desirable chemical properties.
|
|
|
|
```python
|
|
from tdc.generation import MolGen
|
|
data = MolGen(name='ChEMBL_V29')
|
|
split = data.get_split()
|
|
```
|
|
|
|
Use with oracles to optimize for specific properties:
|
|
|
|
```python
|
|
from tdc import Oracle
|
|
oracle = Oracle(name='GSK3B')
|
|
score = oracle('CC(C)Cc1ccc(cc1)C(C)C(O)=O') # Evaluate SMILES
|
|
```
|
|
|
|
See `references/oracles.md` for all available oracle functions.
|
|
|
|
### 2. Retrosynthesis (RetroSyn)
|
|
|
|
Predict reactants needed to synthesize a target molecule.
|
|
|
|
```python
|
|
from tdc.generation import RetroSyn
|
|
data = RetroSyn(name='USPTO')
|
|
split = data.get_split()
|
|
```
|
|
|
|
Dataset contains 1,939,253 reactions from USPTO database.
|
|
|
|
### 3. Paired Molecule Generation
|
|
|
|
Generate molecule pairs (e.g., prodrug-drug pairs).
|
|
|
|
```python
|
|
from tdc.generation import PairMolGen
|
|
data = PairMolGen(name='Prodrug')
|
|
```
|
|
|
|
For detailed oracle documentation and molecular generation workflows, refer to `references/oracles.md` and `scripts/molecular_generation.py`.
|
|
|
|
## Benchmark Groups
|
|
|
|
Benchmark groups provide curated collections of related datasets for systematic model evaluation.
|
|
|
|
### ADMET Benchmark Group
|
|
|
|
```python
|
|
from tdc.benchmark_group import admet_group
|
|
group = admet_group(path='data/')
|
|
|
|
# Get benchmark datasets
|
|
benchmark = group.get('Caco2_Wang')
|
|
predictions = {}
|
|
|
|
for seed in [1, 2, 3, 4, 5]:
|
|
train, valid = benchmark['train'], benchmark['valid']
|
|
# Train model here
|
|
predictions[seed] = model.predict(benchmark['test'])
|
|
|
|
# Evaluate with required 5 seeds
|
|
results = group.evaluate(predictions)
|
|
```
|
|
|
|
**ADMET Group includes 22 datasets** covering absorption, distribution, metabolism, excretion, and toxicity.
|
|
|
|
### Other Benchmark Groups
|
|
|
|
Available benchmark groups include collections for:
|
|
- ADMET properties
|
|
- Drug-target interactions
|
|
- Drug combination prediction
|
|
- And more specialized therapeutic tasks
|
|
|
|
For benchmark evaluation workflows, see `scripts/benchmark_evaluation.py`.
|
|
|
|
## Data Functions
|
|
|
|
TDC provides comprehensive data processing utilities organized into four categories.
|
|
|
|
### 1. Dataset Splits
|
|
|
|
Retrieve train/validation/test partitions with various strategies:
|
|
|
|
```python
|
|
# Scaffold split (default for most tasks)
|
|
split = data.get_split(method='scaffold', seed=1, frac=[0.7, 0.1, 0.2])
|
|
|
|
# Random split
|
|
split = data.get_split(method='random', seed=42, frac=[0.8, 0.1, 0.1])
|
|
|
|
# Cold split (for DTI/DDI tasks)
|
|
split = data.get_split(method='cold_drug', seed=1) # Unseen drugs in test
|
|
split = data.get_split(method='cold_target', seed=1) # Unseen targets in test
|
|
```
|
|
|
|
**Available split strategies:**
|
|
- `random`: Random shuffling
|
|
- `scaffold`: Scaffold-based (for chemical diversity)
|
|
- `cold_drug`, `cold_target`, `cold_drug_target`: For DTI tasks
|
|
- `temporal`: Time-based splits for temporal datasets
|
|
|
|
### 2. Model Evaluation
|
|
|
|
Use standardized metrics for evaluation:
|
|
|
|
```python
|
|
from tdc import Evaluator
|
|
|
|
# For binary classification
|
|
evaluator = Evaluator(name='ROC-AUC')
|
|
score = evaluator(y_true, y_pred)
|
|
|
|
# For regression
|
|
evaluator = Evaluator(name='RMSE')
|
|
score = evaluator(y_true, y_pred)
|
|
```
|
|
|
|
**Available metrics:** ROC-AUC, PR-AUC, F1, Accuracy, RMSE, MAE, R2, Spearman, Pearson, and more.
|
|
|
|
### 3. Data Processing
|
|
|
|
TDC provides 11 key processing utilities:
|
|
|
|
```python
|
|
from tdc.chem_utils import MolConvert
|
|
|
|
# Molecule format conversion
|
|
converter = MolConvert(src='SMILES', dst='PyG')
|
|
pyg_graph = converter('CC(C)Cc1ccc(cc1)C(C)C(O)=O')
|
|
```
|
|
|
|
**Processing utilities include:**
|
|
- Molecule format conversion (SMILES, SELFIES, PyG, DGL, ECFP, etc.)
|
|
- Molecule filters (PAINS, drug-likeness)
|
|
- Label binarization and unit conversion
|
|
- Data balancing (over/under-sampling)
|
|
- Negative sampling for pair data
|
|
- Graph transformation
|
|
- Entity retrieval (CID to SMILES, UniProt to sequence)
|
|
|
|
For comprehensive utilities documentation, see `references/utilities.md`.
|
|
|
|
### 4. Molecule Generation Oracles
|
|
|
|
TDC provides 17+ oracle functions for molecular optimization:
|
|
|
|
```python
|
|
from tdc import Oracle
|
|
|
|
# Single oracle
|
|
oracle = Oracle(name='DRD2')
|
|
score = oracle('CC(C)Cc1ccc(cc1)C(C)C(O)=O')
|
|
|
|
# Multiple oracles
|
|
oracle = Oracle(name='JNK3')
|
|
scores = oracle(['SMILES1', 'SMILES2', 'SMILES3'])
|
|
```
|
|
|
|
For complete oracle documentation, see `references/oracles.md`.
|
|
|
|
## Advanced Features
|
|
|
|
### Retrieve Available Datasets
|
|
|
|
```python
|
|
from tdc.utils import retrieve_dataset_names
|
|
|
|
# Get all ADME datasets
|
|
adme_datasets = retrieve_dataset_names('ADME')
|
|
|
|
# Get all DTI datasets
|
|
dti_datasets = retrieve_dataset_names('DTI')
|
|
```
|
|
|
|
### Label Transformations
|
|
|
|
```python
|
|
# Get label mapping
|
|
label_map = data.get_label_map(name='DrugBank')
|
|
|
|
# Convert labels
|
|
from tdc.chem_utils import label_transform
|
|
transformed = label_transform(y, from_unit='nM', to_unit='p')
|
|
```
|
|
|
|
### Database Queries
|
|
|
|
```python
|
|
from tdc.utils import cid2smiles, uniprot2seq
|
|
|
|
# Convert PubChem CID to SMILES
|
|
smiles = cid2smiles(2244)
|
|
|
|
# Convert UniProt ID to amino acid sequence
|
|
sequence = uniprot2seq('P12345')
|
|
```
|
|
|
|
## Common Workflows
|
|
|
|
### Workflow 1: Train a Single Prediction Model
|
|
|
|
See `scripts/load_and_split_data.py` for a complete example:
|
|
|
|
```python
|
|
from tdc.single_pred import ADME
|
|
from tdc import Evaluator
|
|
|
|
# Load data
|
|
data = ADME(name='Caco2_Wang')
|
|
split = data.get_split(method='scaffold', seed=42)
|
|
|
|
train, valid, test = split['train'], split['valid'], split['test']
|
|
|
|
# Train model (user implements)
|
|
# model.fit(train['Drug'], train['Y'])
|
|
|
|
# Evaluate
|
|
evaluator = Evaluator(name='MAE')
|
|
# score = evaluator(test['Y'], predictions)
|
|
```
|
|
|
|
### Workflow 2: Benchmark Evaluation
|
|
|
|
See `scripts/benchmark_evaluation.py` for a complete example with multiple seeds and proper evaluation protocol.
|
|
|
|
### Workflow 3: Molecular Generation with Oracles
|
|
|
|
See `scripts/molecular_generation.py` for an example of goal-directed generation using oracle functions.
|
|
|
|
## Resources
|
|
|
|
This skill includes bundled resources for common TDC workflows:
|
|
|
|
### scripts/
|
|
|
|
- `load_and_split_data.py`: Template for loading and splitting TDC datasets with various strategies
|
|
- `benchmark_evaluation.py`: Template for running benchmark group evaluations with proper 5-seed protocol
|
|
- `molecular_generation.py`: Template for molecular generation using oracle functions
|
|
|
|
### references/
|
|
|
|
- `datasets.md`: Comprehensive catalog of all available datasets organized by task type
|
|
- `oracles.md`: Complete documentation of all 17+ molecule generation oracles
|
|
- `utilities.md`: Detailed guide to data processing, splitting, and evaluation utilities
|
|
|
|
## Additional Resources
|
|
|
|
- **Official Website**: https://tdcommons.ai
|
|
- **Documentation**: https://tdc.readthedocs.io
|
|
- **GitHub**: https://github.com/mims-harvard/TDC
|
|
- **Paper**: NeurIPS 2021 - "Therapeutics Data Commons: Machine Learning Datasets and Tasks for Drug Discovery and Development"
|