mirror of
https://github.com/K-Dense-AI/claude-scientific-skills.git
synced 2026-03-28 07:33:45 +08:00
685 lines
16 KiB
Markdown
685 lines
16 KiB
Markdown
# TDC Utilities and Data Functions
|
|
|
|
This document provides comprehensive documentation for TDC's data processing, evaluation, and utility functions.
|
|
|
|
## Overview
|
|
|
|
TDC provides utilities organized into four main categories:
|
|
1. **Dataset Splits** - Train/validation/test partitioning strategies
|
|
2. **Model Evaluation** - Standardized performance metrics
|
|
3. **Data Processing** - Molecule conversion, filtering, and transformation
|
|
4. **Entity Retrieval** - Database queries and conversions
|
|
|
|
## 1. Dataset Splits
|
|
|
|
Dataset splitting is crucial for evaluating model generalization. TDC provides multiple splitting strategies designed for therapeutic ML.
|
|
|
|
### Basic Split Usage
|
|
|
|
```python
|
|
from tdc.single_pred import ADME
|
|
|
|
data = ADME(name='Caco2_Wang')
|
|
|
|
# Get split with default parameters
|
|
split = data.get_split()
|
|
# Returns: {'train': DataFrame, 'valid': DataFrame, 'test': DataFrame}
|
|
|
|
# Customize split parameters
|
|
split = data.get_split(
|
|
method='scaffold',
|
|
seed=42,
|
|
frac=[0.7, 0.1, 0.2]
|
|
)
|
|
```
|
|
|
|
### Split Methods
|
|
|
|
#### Random Split
|
|
Random shuffling of data - suitable for general ML tasks.
|
|
|
|
```python
|
|
split = data.get_split(method='random', seed=1)
|
|
```
|
|
|
|
**When to use:**
|
|
- Baseline model evaluation
|
|
- When chemical/temporal structure is not important
|
|
- Quick prototyping
|
|
|
|
**Not recommended for:**
|
|
- Realistic drug discovery scenarios
|
|
- Evaluating generalization to new chemical matter
|
|
|
|
#### Scaffold Split
|
|
Splits based on molecular scaffolds (Bemis-Murcko scaffolds) - ensures test molecules are structurally distinct from training.
|
|
|
|
```python
|
|
split = data.get_split(method='scaffold', seed=1)
|
|
```
|
|
|
|
**When to use:**
|
|
- Default for most single prediction tasks
|
|
- Evaluating generalization to new chemical series
|
|
- Realistic drug discovery scenarios
|
|
|
|
**How it works:**
|
|
1. Extract Bemis-Murcko scaffold from each molecule
|
|
2. Group molecules by scaffold
|
|
3. Assign scaffolds to train/valid/test sets
|
|
4. Ensures test molecules have unseen scaffolds
|
|
|
|
#### Cold Splits (DTI/DDI Tasks)
|
|
For multi-instance prediction, cold splits ensure test set contains unseen drugs, targets, or both.
|
|
|
|
**Cold Drug Split:**
|
|
```python
|
|
from tdc.multi_pred import DTI
|
|
data = DTI(name='BindingDB_Kd')
|
|
split = data.get_split(method='cold_drug', seed=1)
|
|
```
|
|
- Test set contains drugs not seen during training
|
|
- Evaluates generalization to new compounds
|
|
|
|
**Cold Target Split:**
|
|
```python
|
|
split = data.get_split(method='cold_target', seed=1)
|
|
```
|
|
- Test set contains targets not seen during training
|
|
- Evaluates generalization to new proteins
|
|
|
|
**Cold Drug-Target Split:**
|
|
```python
|
|
split = data.get_split(method='cold_drug_target', seed=1)
|
|
```
|
|
- Test set contains novel drug-target pairs
|
|
- Most challenging evaluation scenario
|
|
|
|
#### Temporal Split
|
|
For datasets with temporal information - ensures test data is from later time points.
|
|
|
|
```python
|
|
split = data.get_split(method='temporal', seed=1)
|
|
```
|
|
|
|
**When to use:**
|
|
- Datasets with time stamps
|
|
- Simulating prospective prediction
|
|
- Clinical trial outcome prediction
|
|
|
|
### Custom Split Fractions
|
|
|
|
```python
|
|
# 80% train, 10% valid, 10% test
|
|
split = data.get_split(method='scaffold', frac=[0.8, 0.1, 0.1])
|
|
|
|
# 70% train, 15% valid, 15% test
|
|
split = data.get_split(method='scaffold', frac=[0.7, 0.15, 0.15])
|
|
```
|
|
|
|
### Stratified Splits
|
|
|
|
For classification tasks with imbalanced labels:
|
|
|
|
```python
|
|
split = data.get_split(method='scaffold', stratified=True)
|
|
```
|
|
|
|
Maintains label distribution across train/valid/test sets.
|
|
|
|
## 2. Model Evaluation
|
|
|
|
TDC provides standardized evaluation metrics for different task types.
|
|
|
|
### Basic Evaluator Usage
|
|
|
|
```python
|
|
from tdc import Evaluator
|
|
|
|
# Initialize evaluator
|
|
evaluator = Evaluator(name='ROC-AUC')
|
|
|
|
# Evaluate predictions
|
|
score = evaluator(y_true, y_pred)
|
|
```
|
|
|
|
### Classification Metrics
|
|
|
|
#### ROC-AUC
|
|
Receiver Operating Characteristic - Area Under Curve
|
|
|
|
```python
|
|
evaluator = Evaluator(name='ROC-AUC')
|
|
score = evaluator(y_true, y_pred_proba)
|
|
```
|
|
|
|
**Best for:**
|
|
- Binary classification
|
|
- Imbalanced datasets
|
|
- Overall discriminative ability
|
|
|
|
**Range:** 0-1 (higher is better, 0.5 is random)
|
|
|
|
#### PR-AUC
|
|
Precision-Recall Area Under Curve
|
|
|
|
```python
|
|
evaluator = Evaluator(name='PR-AUC')
|
|
score = evaluator(y_true, y_pred_proba)
|
|
```
|
|
|
|
**Best for:**
|
|
- Highly imbalanced datasets
|
|
- When positive class is rare
|
|
- Complements ROC-AUC
|
|
|
|
**Range:** 0-1 (higher is better)
|
|
|
|
#### F1 Score
|
|
Harmonic mean of precision and recall
|
|
|
|
```python
|
|
evaluator = Evaluator(name='F1')
|
|
score = evaluator(y_true, y_pred_binary)
|
|
```
|
|
|
|
**Best for:**
|
|
- Balance between precision and recall
|
|
- Multi-class classification
|
|
|
|
**Range:** 0-1 (higher is better)
|
|
|
|
#### Accuracy
|
|
Fraction of correct predictions
|
|
|
|
```python
|
|
evaluator = Evaluator(name='Accuracy')
|
|
score = evaluator(y_true, y_pred_binary)
|
|
```
|
|
|
|
**Best for:**
|
|
- Balanced datasets
|
|
- Simple baseline metric
|
|
|
|
**Not recommended for:** Imbalanced datasets
|
|
|
|
#### Cohen's Kappa
|
|
Agreement between predictions and ground truth, accounting for chance
|
|
|
|
```python
|
|
evaluator = Evaluator(name='Kappa')
|
|
score = evaluator(y_true, y_pred_binary)
|
|
```
|
|
|
|
**Range:** -1 to 1 (higher is better, 0 is random)
|
|
|
|
### Regression Metrics
|
|
|
|
#### RMSE - Root Mean Squared Error
|
|
```python
|
|
evaluator = Evaluator(name='RMSE')
|
|
score = evaluator(y_true, y_pred)
|
|
```
|
|
|
|
**Best for:**
|
|
- Continuous predictions
|
|
- Penalizes large errors heavily
|
|
|
|
**Range:** 0-∞ (lower is better)
|
|
|
|
#### MAE - Mean Absolute Error
|
|
```python
|
|
evaluator = Evaluator(name='MAE')
|
|
score = evaluator(y_true, y_pred)
|
|
```
|
|
|
|
**Best for:**
|
|
- Continuous predictions
|
|
- More robust to outliers than RMSE
|
|
|
|
**Range:** 0-∞ (lower is better)
|
|
|
|
#### R² - Coefficient of Determination
|
|
```python
|
|
evaluator = Evaluator(name='R2')
|
|
score = evaluator(y_true, y_pred)
|
|
```
|
|
|
|
**Best for:**
|
|
- Variance explained by model
|
|
- Comparing different models
|
|
|
|
**Range:** -∞ to 1 (higher is better, 1 is perfect)
|
|
|
|
#### MSE - Mean Squared Error
|
|
```python
|
|
evaluator = Evaluator(name='MSE')
|
|
score = evaluator(y_true, y_pred)
|
|
```
|
|
|
|
**Range:** 0-∞ (lower is better)
|
|
|
|
### Ranking Metrics
|
|
|
|
#### Spearman Correlation
|
|
Rank correlation coefficient
|
|
|
|
```python
|
|
evaluator = Evaluator(name='Spearman')
|
|
score = evaluator(y_true, y_pred)
|
|
```
|
|
|
|
**Best for:**
|
|
- Ranking tasks
|
|
- Non-linear relationships
|
|
- Ordinal data
|
|
|
|
**Range:** -1 to 1 (higher is better)
|
|
|
|
#### Pearson Correlation
|
|
Linear correlation coefficient
|
|
|
|
```python
|
|
evaluator = Evaluator(name='Pearson')
|
|
score = evaluator(y_true, y_pred)
|
|
```
|
|
|
|
**Best for:**
|
|
- Linear relationships
|
|
- Continuous data
|
|
|
|
**Range:** -1 to 1 (higher is better)
|
|
|
|
### Multi-Label Classification
|
|
|
|
```python
|
|
evaluator = Evaluator(name='Micro-F1')
|
|
score = evaluator(y_true_multilabel, y_pred_multilabel)
|
|
```
|
|
|
|
Available: `Micro-F1`, `Macro-F1`, `Micro-AUPR`, `Macro-AUPR`
|
|
|
|
### Benchmark Group Evaluation
|
|
|
|
For benchmark groups, evaluation requires multiple seeds:
|
|
|
|
```python
|
|
from tdc.benchmark_group import admet_group
|
|
|
|
group = admet_group(path='data/')
|
|
benchmark = group.get('Caco2_Wang')
|
|
|
|
# Predictions must be dict with seeds as keys
|
|
predictions = {}
|
|
for seed in [1, 2, 3, 4, 5]:
|
|
# Train model and predict
|
|
predictions[seed] = model_predictions
|
|
|
|
# Evaluate with mean and std across seeds
|
|
results = group.evaluate(predictions)
|
|
print(results) # {'Caco2_Wang': [mean_score, std_score]}
|
|
```
|
|
|
|
## 3. Data Processing
|
|
|
|
TDC provides 11 comprehensive data processing utilities.
|
|
|
|
### Molecule Format Conversion
|
|
|
|
Convert between ~15 molecular representations.
|
|
|
|
```python
|
|
from tdc.chem_utils import MolConvert
|
|
|
|
# SMILES to PyTorch Geometric
|
|
converter = MolConvert(src='SMILES', dst='PyG')
|
|
pyg_graph = converter('CC(C)Cc1ccc(cc1)C(C)C(O)=O')
|
|
|
|
# SMILES to DGL
|
|
converter = MolConvert(src='SMILES', dst='DGL')
|
|
dgl_graph = converter('CC(C)Cc1ccc(cc1)C(C)C(O)=O')
|
|
|
|
# SMILES to Morgan Fingerprint (ECFP)
|
|
converter = MolConvert(src='SMILES', dst='ECFP')
|
|
fingerprint = converter('CC(C)Cc1ccc(cc1)C(C)C(O)=O')
|
|
```
|
|
|
|
**Available formats:**
|
|
- **Text**: SMILES, SELFIES, InChI
|
|
- **Fingerprints**: ECFP (Morgan), MACCS, RDKit, AtomPair, TopologicalTorsion
|
|
- **Graphs**: PyG (PyTorch Geometric), DGL (Deep Graph Library)
|
|
- **3D**: Graph3D, Coulomb Matrix, Distance Matrix
|
|
|
|
**Batch conversion:**
|
|
```python
|
|
converter = MolConvert(src='SMILES', dst='PyG')
|
|
graphs = converter(['SMILES1', 'SMILES2', 'SMILES3'])
|
|
```
|
|
|
|
### Molecule Filters
|
|
|
|
Remove non-drug-like molecules using curated chemical rules.
|
|
|
|
```python
|
|
from tdc.chem_utils import MolFilter
|
|
|
|
# Initialize filter with rules
|
|
mol_filter = MolFilter(
|
|
rules=['PAINS', 'BMS'], # Chemical filter rules
|
|
property_filters_dict={
|
|
'MW': (150, 500), # Molecular weight range
|
|
'LogP': (-0.4, 5.6), # Lipophilicity range
|
|
'HBD': (0, 5), # H-bond donors
|
|
'HBA': (0, 10) # H-bond acceptors
|
|
}
|
|
)
|
|
|
|
# Filter molecules
|
|
filtered_smiles = mol_filter(smiles_list)
|
|
```
|
|
|
|
**Available filter rules:**
|
|
- `PAINS` - Pan-Assay Interference Compounds
|
|
- `BMS` - Bristol-Myers Squibb HTS deck filters
|
|
- `Glaxo` - GlaxoSmithKline filters
|
|
- `Dundee` - University of Dundee filters
|
|
- `Inpharmatica` - Inpharmatica filters
|
|
- `LINT` - Pfizer LINT filters
|
|
|
|
### Label Distribution Visualization
|
|
|
|
```python
|
|
# Visualize label distribution
|
|
data.label_distribution()
|
|
|
|
# Print statistics
|
|
data.print_stats()
|
|
```
|
|
|
|
Displays histogram and computes mean, median, std for continuous labels.
|
|
|
|
### Label Binarization
|
|
|
|
Convert continuous labels to binary using threshold.
|
|
|
|
```python
|
|
from tdc.utils import binarize
|
|
|
|
# Binarize with threshold
|
|
binary_labels = binarize(y_continuous, threshold=5.0, order='ascending')
|
|
# order='ascending': values >= threshold become 1
|
|
# order='descending': values <= threshold become 1
|
|
```
|
|
|
|
### Label Units Conversion
|
|
|
|
Transform between measurement units.
|
|
|
|
```python
|
|
from tdc.chem_utils import label_transform
|
|
|
|
# Convert nM to pKd
|
|
y_pkd = label_transform(y_nM, from_unit='nM', to_unit='p')
|
|
|
|
# Convert μM to nM
|
|
y_nM = label_transform(y_uM, from_unit='uM', to_unit='nM')
|
|
```
|
|
|
|
**Available conversions:**
|
|
- Binding affinity: nM, μM, pKd, pKi, pIC50
|
|
- Log transformations
|
|
- Natural log conversions
|
|
|
|
### Label Meaning
|
|
|
|
Get interpretable descriptions for labels.
|
|
|
|
```python
|
|
# Get label mapping
|
|
label_map = data.get_label_map(name='DrugBank')
|
|
print(label_map)
|
|
# {0: 'No interaction', 1: 'Increased effect', 2: 'Decreased effect', ...}
|
|
```
|
|
|
|
### Data Balancing
|
|
|
|
Handle class imbalance via over/under-sampling.
|
|
|
|
```python
|
|
from tdc.utils import balance
|
|
|
|
# Oversample minority class
|
|
X_balanced, y_balanced = balance(X, y, method='oversample')
|
|
|
|
# Undersample majority class
|
|
X_balanced, y_balanced = balance(X, y, method='undersample')
|
|
```
|
|
|
|
### Graph Transformation for Pair Data
|
|
|
|
Convert paired data to graph representations.
|
|
|
|
```python
|
|
from tdc.utils import create_graph_from_pairs
|
|
|
|
# Create graph from drug-drug pairs
|
|
graph = create_graph_from_pairs(
|
|
pairs=ddi_pairs, # [(drug1, drug2, label), ...]
|
|
format='edge_list' # or 'PyG', 'DGL'
|
|
)
|
|
```
|
|
|
|
### Negative Sampling
|
|
|
|
Generate negative samples for binary tasks.
|
|
|
|
```python
|
|
from tdc.utils import negative_sample
|
|
|
|
# Generate negative samples for DTI
|
|
negative_pairs = negative_sample(
|
|
positive_pairs=known_interactions,
|
|
all_drugs=drug_list,
|
|
all_targets=target_list,
|
|
ratio=1.0 # Negative:positive ratio
|
|
)
|
|
```
|
|
|
|
**Use cases:**
|
|
- Drug-target interaction prediction
|
|
- Drug-drug interaction tasks
|
|
- Creating balanced datasets
|
|
|
|
### Entity Retrieval
|
|
|
|
Convert between database identifiers.
|
|
|
|
#### PubChem CID to SMILES
|
|
```python
|
|
from tdc.utils import cid2smiles
|
|
|
|
smiles = cid2smiles(2244) # Aspirin
|
|
# Returns: 'CC(=O)Oc1ccccc1C(=O)O'
|
|
```
|
|
|
|
#### UniProt ID to Amino Acid Sequence
|
|
```python
|
|
from tdc.utils import uniprot2seq
|
|
|
|
sequence = uniprot2seq('P12345')
|
|
# Returns: 'MVKVYAPASS...'
|
|
```
|
|
|
|
#### Batch Retrieval
|
|
```python
|
|
# Multiple CIDs
|
|
smiles_list = [cid2smiles(cid) for cid in [2244, 5090, 6323]]
|
|
|
|
# Multiple UniProt IDs
|
|
sequences = [uniprot2seq(uid) for uid in ['P12345', 'Q9Y5S9']]
|
|
```
|
|
|
|
## 4. Advanced Utilities
|
|
|
|
### Retrieve Dataset Names
|
|
|
|
```python
|
|
from tdc.utils import retrieve_dataset_names
|
|
|
|
# Get all datasets for a task
|
|
adme_datasets = retrieve_dataset_names('ADME')
|
|
dti_datasets = retrieve_dataset_names('DTI')
|
|
tox_datasets = retrieve_dataset_names('Tox')
|
|
|
|
print(f"ADME datasets: {adme_datasets}")
|
|
```
|
|
|
|
### Fuzzy Search
|
|
|
|
TDC supports fuzzy matching for dataset names:
|
|
|
|
```python
|
|
from tdc.single_pred import ADME
|
|
|
|
# These all work (typo-tolerant)
|
|
data = ADME(name='Caco2_Wang')
|
|
data = ADME(name='caco2_wang')
|
|
data = ADME(name='Caco2') # Partial match
|
|
```
|
|
|
|
### Data Format Options
|
|
|
|
```python
|
|
# Pandas DataFrame (default)
|
|
df = data.get_data(format='df')
|
|
|
|
# Dictionary
|
|
data_dict = data.get_data(format='dict')
|
|
|
|
# DeepPurpose format (for DeepPurpose library)
|
|
dp_format = data.get_data(format='DeepPurpose')
|
|
|
|
# PyG/DGL graphs (if applicable)
|
|
graphs = data.get_data(format='PyG')
|
|
```
|
|
|
|
### Data Loader Utilities
|
|
|
|
```python
|
|
from tdc.utils import create_fold
|
|
|
|
# Create cross-validation folds
|
|
folds = create_fold(data, fold=5, seed=42)
|
|
# Returns list of (train_idx, test_idx) tuples
|
|
|
|
# Iterate through folds
|
|
for i, (train_idx, test_idx) in enumerate(folds):
|
|
train_data = data.iloc[train_idx]
|
|
test_data = data.iloc[test_idx]
|
|
# Train and evaluate
|
|
```
|
|
|
|
## Common Workflows
|
|
|
|
### Workflow 1: Complete Data Pipeline
|
|
|
|
```python
|
|
from tdc.single_pred import ADME
|
|
from tdc import Evaluator
|
|
from tdc.chem_utils import MolConvert, MolFilter
|
|
|
|
# 1. Load data
|
|
data = ADME(name='Caco2_Wang')
|
|
|
|
# 2. Filter molecules
|
|
mol_filter = MolFilter(rules=['PAINS'])
|
|
filtered_data = data.get_data()
|
|
filtered_data = filtered_data[
|
|
filtered_data['Drug'].apply(lambda x: mol_filter([x]))
|
|
]
|
|
|
|
# 3. Split data
|
|
split = data.get_split(method='scaffold', seed=42)
|
|
train, valid, test = split['train'], split['valid'], split['test']
|
|
|
|
# 4. Convert to graph representations
|
|
converter = MolConvert(src='SMILES', dst='PyG')
|
|
train_graphs = converter(train['Drug'].tolist())
|
|
|
|
# 5. Train model (user implements)
|
|
# model.fit(train_graphs, train['Y'])
|
|
|
|
# 6. Evaluate
|
|
evaluator = Evaluator(name='MAE')
|
|
# score = evaluator(test['Y'], predictions)
|
|
```
|
|
|
|
### Workflow 2: Multi-Task Learning Preparation
|
|
|
|
```python
|
|
from tdc.benchmark_group import admet_group
|
|
from tdc.chem_utils import MolConvert
|
|
|
|
# Load benchmark group
|
|
group = admet_group(path='data/')
|
|
|
|
# Get multiple datasets
|
|
datasets = ['Caco2_Wang', 'HIA_Hou', 'Bioavailability_Ma']
|
|
all_data = {}
|
|
|
|
for dataset_name in datasets:
|
|
benchmark = group.get(dataset_name)
|
|
all_data[dataset_name] = benchmark
|
|
|
|
# Prepare for multi-task learning
|
|
converter = MolConvert(src='SMILES', dst='ECFP')
|
|
# Process each dataset...
|
|
```
|
|
|
|
### Workflow 3: DTI Cold Split Evaluation
|
|
|
|
```python
|
|
from tdc.multi_pred import DTI
|
|
from tdc import Evaluator
|
|
|
|
# Load DTI data
|
|
data = DTI(name='BindingDB_Kd')
|
|
|
|
# Cold drug split
|
|
split = data.get_split(method='cold_drug', seed=42)
|
|
train, test = split['train'], split['test']
|
|
|
|
# Verify no drug overlap
|
|
train_drugs = set(train['Drug_ID'])
|
|
test_drugs = set(test['Drug_ID'])
|
|
assert len(train_drugs & test_drugs) == 0, "Drug leakage detected!"
|
|
|
|
# Train and evaluate
|
|
# model.fit(train)
|
|
evaluator = Evaluator(name='RMSE')
|
|
# score = evaluator(test['Y'], predictions)
|
|
```
|
|
|
|
## Best Practices
|
|
|
|
1. **Always use meaningful splits** - Use scaffold or cold splits for realistic evaluation
|
|
2. **Multiple seeds** - Run experiments with multiple seeds for robust results
|
|
3. **Appropriate metrics** - Choose metrics that match your task and dataset characteristics
|
|
4. **Data filtering** - Remove PAINS and non-drug-like molecules before training
|
|
5. **Format conversion** - Convert molecules to appropriate format for your model
|
|
6. **Batch processing** - Use batch operations for efficiency with large datasets
|
|
|
|
## Performance Tips
|
|
|
|
- Convert molecules in batch mode for faster processing
|
|
- Cache converted representations to avoid recomputation
|
|
- Use appropriate data formats for your framework (PyG, DGL, etc.)
|
|
- Filter data early in the pipeline to reduce computation
|
|
|
|
## References
|
|
|
|
- TDC Documentation: https://tdc.readthedocs.io
|
|
- Data Functions: https://tdcommons.ai/fct_overview/
|
|
- Evaluation Metrics: https://tdcommons.ai/functions/model_eval/
|
|
- Data Splits: https://tdcommons.ai/functions/data_split/
|